diff --git a/main.go b/main.go
index 69e7fa9..5a5a3ff 100644
--- a/main.go
+++ b/main.go
@@ -24,10 +24,16 @@ type ObsConfig struct {
 	Timeout  int    `flag:"timeout"  help:"Timeout in seconds."          default:"5"         env:"OBS_TIMEOUT"  short:"T"`
 }
 
+// StyleConfig holds the configuration for styling the CLI output.
+type StyleConfig struct {
+	Style string `help:"Style used in output." flag:"style" default:"" env:"GOBS_STYLE" short:"c" enum:",red,magenta,purple,blue,cyan,green,yellow,orange,white,grey,navy,black"`
+}
+
 // CLI is the main command line interface structure.
 // It embeds the ObsConfig struct to inherit its fields and flags.
 type CLI struct {
-	ObsConfig `embed:"" help:"OBS WebSocket configuration."`
+	ObsConfig   `embed:"" help:"OBS WebSocket configuration."`
+	StyleConfig `embed:"" help:"Style configuration."`
 
 	Man     mangokong.ManFlag `help:"Print man page."`
 	Version VersionFlag       `help:"Print gobs-cli version information and quit" name:"version" short:"v"`
@@ -53,6 +59,15 @@ type CLI struct {
 type context struct {
 	Client *goobs.Client
 	Out    io.Writer
+	Style  *Style
+}
+
+func newContext(client *goobs.Client, out io.Writer, styleName string) *context {
+	return &context{
+		Client: client,
+		Out:    out,
+		Style:  styleFromFlag(styleName),
+	}
 }
 
 func main() {
@@ -73,10 +88,7 @@ func main() {
 	client, err := connectObs(cli.ObsConfig)
 	ctx.FatalIfErrorf(err)
 
-	ctx.Bind(&context{
-		Client: client,
-		Out:    os.Stdout,
-	})
+	ctx.Bind(newContext(client, os.Stdout, cli.StyleConfig.Style))
 
 	ctx.FatalIfErrorf(run(ctx, client))
 }
diff --git a/style.go b/style.go
new file mode 100644
index 0000000..f8d5ed9
--- /dev/null
+++ b/style.go
@@ -0,0 +1,184 @@
+// nolint: misspell
+package main
+
+import (
+	"fmt"
+	"os"
+
+	"github.com/charmbracelet/lipgloss"
+)
+
+// Style defines colours for the table styles.
+type Style struct {
+	name      string
+	border    lipgloss.Color
+	oddRows   lipgloss.Color
+	evenRows  lipgloss.Color
+	highlight lipgloss.Color
+}
+
+// Highlight applies the highlight style to the given text.
+func (s *Style) Highlight(text string) string {
+	return lipgloss.NewStyle().Foreground(s.highlight).Render(text)
+}
+
+func (s *Style) Error(text string) string {
+	return lipgloss.NewStyle().Foreground(lipgloss.Color("#FF0000")).Render(text) // Red for errors
+}
+
+func newRedStyle() *Style {
+	return &Style{
+		name:      "red",
+		border:    lipgloss.Color("#D32F2F"), // Strong red for border
+		oddRows:   lipgloss.Color("#FFCDD2"), // Very light red for odd rows
+		evenRows:  lipgloss.Color("#EF9A9A"), // Light red for even rows
+		highlight: lipgloss.Color("#EF9A9A"),
+	}
+}
+
+func newMagentaStyle() *Style {
+	return &Style{
+		name:      "magenta",
+		border:    lipgloss.Color("#C2185B"), // Strong magenta for border
+		oddRows:   lipgloss.Color("#F8BBD0"), // Very light magenta/pink for odd rows
+		evenRows:  lipgloss.Color("#F48FB1"), // Light magenta/pink for even rows
+		highlight: lipgloss.Color("#F48FB1"),
+	}
+}
+
+func newPurpleStyle() *Style {
+	return &Style{
+		name:      "purple",
+		border:    lipgloss.Color("#7B1FA2"), // Strong purple for border
+		oddRows:   lipgloss.Color("#E1BEE7"), // Very light purple for odd rows
+		evenRows:  lipgloss.Color("#CE93D8"), // Light purple for even rows
+		highlight: lipgloss.Color("#CE93D8"),
+	}
+}
+
+func newBlueStyle() *Style {
+	return &Style{
+		name:      "blue",
+		border:    lipgloss.Color("#1976D2"), // Medium blue for border
+		oddRows:   lipgloss.Color("#E3F2FD"), // Very light blue for odd rows
+		evenRows:  lipgloss.Color("#BBDEFB"), // Light blue for even rows
+		highlight: lipgloss.Color("#1976D2"),
+	}
+}
+
+func newCyanStyle() *Style {
+	return &Style{
+		name:      "cyan",
+		border:    lipgloss.Color("#00BFCF"), // A strong cyan for border
+		oddRows:   lipgloss.Color("#E0F7FA"), // Very light cyan for odd rows
+		evenRows:  lipgloss.Color("#B2EBF2"), // Slightly darker light cyan for even rows
+		highlight: lipgloss.Color("#00BFCF"),
+	}
+}
+
+func newGreenStyle() *Style {
+	return &Style{
+		name:      "green",
+		border:    lipgloss.Color("#43A047"), // Medium green for border
+		oddRows:   lipgloss.Color("#E8F5E9"), // Very light green for odd rows
+		evenRows:  lipgloss.Color("#C8E6C9"), // Light green for even rows
+		highlight: lipgloss.Color("#43A047"),
+	}
+}
+
+func newYellowStyle() *Style {
+	return &Style{
+		name:      "yellow",
+		border:    lipgloss.Color("#FBC02D"), // Strong yellow for border
+		oddRows:   lipgloss.Color("#FFF9C4"), // Very light yellow for odd rows
+		evenRows:  lipgloss.Color("#FFF59D"), // Light yellow for even rows
+		highlight: lipgloss.Color("#FBC02D"),
+	}
+}
+
+func newOrangeStyle() *Style {
+	return &Style{
+		name:      "orange",
+		border:    lipgloss.Color("#F57C00"), // Strong orange for border
+		oddRows:   lipgloss.Color("#FFF3E0"), // Very light orange for odd rows
+		evenRows:  lipgloss.Color("#FFE0B2"), // Light orange for even rows
+		highlight: lipgloss.Color("#F57C00"),
+	}
+}
+
+func newWhiteStyle() *Style {
+	return &Style{
+		name:      "white",
+		border:    lipgloss.Color("#FFFFFF"), // White for border
+		oddRows:   lipgloss.Color("#F0F0F0"), // Very light grey for odd rows
+		evenRows:  lipgloss.Color("#E0E0E0"), // Light grey for even rows
+		highlight: lipgloss.Color("#FFFFFF"), // Highlight in white
+	}
+}
+
+func newGreyStyle() *Style {
+	return &Style{
+		name:      "grey",
+		border:    lipgloss.Color("#9E9E9E"), // Medium grey for border
+		oddRows:   lipgloss.Color("#F5F5F5"), // Very light grey for odd rows
+		evenRows:  lipgloss.Color("#EEEEEE"), // Light grey for even rows
+		highlight: lipgloss.Color("#9E9E9E"), // Highlight in medium grey
+	}
+}
+
+func newNavyBlueStyle() *Style {
+	return &Style{
+		name:      "navy",
+		border:    lipgloss.Color("#001F3F"), // Navy blue for border
+		oddRows:   lipgloss.Color("#CFE2F3"), // Very light blue for odd rows
+		evenRows:  lipgloss.Color("#A9CCE3"), // Light blue for even rows
+		highlight: lipgloss.Color("#001F3F"), // Highlight in navy blue
+	}
+}
+
+func newBlackStyle() *Style {
+	return &Style{
+		name:      "black",
+		border:    lipgloss.Color("#000000"), // Black for border
+		oddRows:   lipgloss.Color("#333333"), // Dark grey for odd rows
+		evenRows:  lipgloss.Color("#444444"), // Slightly lighter dark grey for even rows
+		highlight: lipgloss.Color("#000000"), // Highlight in black
+	}
+}
+
+func styleFromFlag(colour string) *Style {
+	switch colour {
+	case "red":
+		return newRedStyle()
+	case "magenta":
+		return newMagentaStyle()
+	case "purple":
+		return newPurpleStyle()
+	case "blue":
+		return newBlueStyle()
+	case "cyan":
+		return newCyanStyle()
+	case "green":
+		return newGreenStyle()
+	case "yellow":
+		return newYellowStyle()
+	case "orange":
+		return newOrangeStyle()
+	case "white":
+		return newWhiteStyle()
+	case "grey":
+		return newGreyStyle()
+	case "navy":
+		return newNavyBlueStyle()
+	case "black":
+		return newBlackStyle()
+	default:
+		err := os.Setenv("NO_COLOR", "1") // nolint: misspell
+		if err != nil {
+			// If we can't set NO_COLOR, we just log the error and continue
+			// This is a fallback to ensure that the application can still run
+			fmt.Fprintf(os.Stderr, "Error setting NO_COLOR: %v\n", err)
+		}
+		return &Style{}
+	}
+}