mirror of
https://github.com/onyx-and-iris/gobs-cli.git
synced 2026-04-19 23:53:39 +00:00
Compare commits
48 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
| e5223fbdfd | |||
| c22ab4384d | |||
| 93a3d3e49f | |||
| 2228574837 | |||
| 8f1d42b677 | |||
| 620adf7e98 | |||
| 4a7b8a074a | |||
| 0811d711aa | |||
| 306f19eeae | |||
| 43dd77ffdc | |||
| f94ac1ca0c | |||
| c27a5ea6c5 | |||
| af962a26cc | |||
| 360d45aa47 | |||
| 3deb03cf32 | |||
| f58b2dfeab | |||
| 6ad530ce2e | |||
| d9d3c7c8b2 | |||
|
|
f72e34adfb | ||
| ccb3f59513 | |||
| e3fd88cf92 | |||
| 12dfab5642 | |||
| 7a2765f72c | |||
| 90aa5d4423 | |||
| da010d67a0 | |||
| 0c695298fd | |||
| 2f77fa1c54 | |||
| eafc3312a5 | |||
| 02541f9915 | |||
| 7fa43eb35c | |||
| 8aeb7cb183 | |||
| 6e25927bc1 | |||
| dd0bbfc0da | |||
| c04324d173 | |||
| 36d0753bd9 | |||
| 3095c0c49d | |||
| 53bbb58cfb | |||
| 5f2fe05caa | |||
| c653047c66 | |||
| 30fabe8cfc | |||
| 8cf969c906 | |||
| 3540c60c4b | |||
| b2c5980b4a | |||
| da1ef9f993 | |||
| 0a2c622645 | |||
| cb973c09f5 | |||
| 4fa32bfb42 | |||
| 8616f3b486 |
9
.gitignore
vendored
9
.gitignore
vendored
@@ -26,5 +26,12 @@ go.work
|
|||||||
|
|
||||||
# End of gignore: github.com/onyx-and-iris/gignore
|
# End of gignore: github.com/onyx-and-iris/gignore
|
||||||
|
|
||||||
|
# Environment
|
||||||
|
.env
|
||||||
.envrc
|
.envrc
|
||||||
*_test.go
|
|
||||||
|
# Man pages
|
||||||
|
gobs-cli.1
|
||||||
|
|
||||||
|
# Config files
|
||||||
|
config.yaml
|
||||||
|
|||||||
@@ -50,3 +50,6 @@ issues:
|
|||||||
exclude:
|
exclude:
|
||||||
# gosec: Duplicated errcheck checks
|
# gosec: Duplicated errcheck checks
|
||||||
- G104
|
- G104
|
||||||
|
exclude-files:
|
||||||
|
# Exclude vendor directory
|
||||||
|
- main_test.go
|
||||||
|
|||||||
68
CHANGELOG.md
68
CHANGELOG.md
@@ -5,6 +5,74 @@ All notable changes to this project will be documented in this file.
|
|||||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
|
# [0.8.2]
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- record start/stop and stream start/stop commands check outputActive states first.
|
||||||
|
- Errors are returned if the command cannot be performed.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- The --parent flag for the sceneitem commands has been renamed to --group, see [SceneItemCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#sceneitemcmd)
|
||||||
|
|
||||||
|
# [0.8.0] - 2025-05-27
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- record directory command, see [directory under RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- record stop now prints the output path of the recording.
|
||||||
|
|
||||||
|
|
||||||
|
# [0.7.0] - 2025-05-26
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- projector commands, see [ProjectorCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#projectorcmd)
|
||||||
|
|
||||||
|
|
||||||
|
# [0.6.1] - 2025-05-25
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- filter commands, see [FilterCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#filtercmd)
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- list commands are now printed as tables.
|
||||||
|
- This affects group, hotkey, input, profile, scene, scenecollection and sceneitem command groups.
|
||||||
|
|
||||||
|
# [0.5.0] - 2025-05-22
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- hotkey commands, see [HotkeyCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#hotkeycmd)
|
||||||
|
|
||||||
|
# [0.4.2] - 2025-05-08
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- replaybuffer toggle command
|
||||||
|
- studiomode enable/disable now print output to console
|
||||||
|
- stream start/stop now print output to console
|
||||||
|
- Unit tests
|
||||||
|
|
||||||
|
# [0.3.1] - 2025-05-02
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- --man flag for generating/viewing a man page.
|
||||||
|
- Ability to load env vars from env files, see the [README](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#environment-variables)
|
||||||
|
|
||||||
|
# [0.2.0] - 2025-04-27
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- sceneitem transform, see *transform* under [SceneItemCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#sceneitemcmd)
|
||||||
|
|
||||||
# [0.1.0] - 2025-04-24
|
# [0.1.0] - 2025-04-24
|
||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|||||||
194
README.md
194
README.md
@@ -4,6 +4,12 @@ A command line interface for OBS Websocket v5
|
|||||||
|
|
||||||
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
||||||
|
|
||||||
|
## Installation
|
||||||
|
|
||||||
|
```console
|
||||||
|
go install github.com/onyx-and-iris/gobs-cli@latest
|
||||||
|
```
|
||||||
|
|
||||||
## Configuration
|
## Configuration
|
||||||
|
|
||||||
#### Flags
|
#### Flags
|
||||||
@@ -16,17 +22,19 @@ gobs-cli --host=localhost --port=4455 --password=<websocket password> --help
|
|||||||
|
|
||||||
#### Environment Variables
|
#### Environment Variables
|
||||||
|
|
||||||
Load connection details from your environment:
|
Store and load environment variables from:
|
||||||
|
|
||||||
```bash
|
- A `.env` file in the cwd
|
||||||
#!/usr/bin/env bash
|
- $XDG_CONFIG_HOME / gobs-cli / config.env (see [os.UserConfigDir][userconfigdir])
|
||||||
|
|
||||||
export OBS_HOST=localhost
|
```env
|
||||||
export OBS_PORT=4455
|
OBS_HOST=localhost
|
||||||
export OBS_PASSWORD=<websocket password>
|
OBS_PORT=4455
|
||||||
export OBS_TIMEOUT=5
|
OBS_PASSWORD=<websocket password>
|
||||||
|
OBS_TIMEOUT=5
|
||||||
```
|
```
|
||||||
|
|
||||||
|
|
||||||
## Commands
|
## Commands
|
||||||
|
|
||||||
### VersionCmd
|
### VersionCmd
|
||||||
@@ -71,9 +79,14 @@ gobs-cli scene switch --preview LIVE
|
|||||||
### SceneItemCmd
|
### SceneItemCmd
|
||||||
|
|
||||||
- list: List all scene items.
|
- list: List all scene items.
|
||||||
|
|
||||||
|
*optional*
|
||||||
- args: SceneName
|
- args: SceneName
|
||||||
|
- defaults to current scene
|
||||||
|
|
||||||
```console
|
```console
|
||||||
|
gobs-cli sceneitem list
|
||||||
|
|
||||||
gobs-cli sceneitem list LIVE
|
gobs-cli sceneitem list LIVE
|
||||||
```
|
```
|
||||||
|
|
||||||
@@ -81,7 +94,7 @@ gobs-cli sceneitem list LIVE
|
|||||||
- flags:
|
- flags:
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- --parent: Parent group name.
|
- --group: Parent group name.
|
||||||
- args: SceneName ItemName
|
- args: SceneName ItemName
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@@ -92,7 +105,7 @@ gobs-cli sceneitem show START "Colour Source"
|
|||||||
- flags:
|
- flags:
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- --parent: Parent group name.
|
- --group: Parent group name.
|
||||||
- args: SceneName ItemName
|
- args: SceneName ItemName
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@@ -103,30 +116,65 @@ gobs-cli sceneitem hide START "Colour Source"
|
|||||||
- flags:
|
- flags:
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- --parent: Parent group name.
|
- --group: Parent group name.
|
||||||
- args: SceneName ItemName
|
- args: SceneName ItemName
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli sceneitem toggle --parent=test_group START "Colour Source 3"
|
gobs-cli sceneitem toggle --group=test_group START "Colour Source 3"
|
||||||
```
|
```
|
||||||
|
|
||||||
- visible: Get scene item visibility.
|
- visible: Get scene item visibility.
|
||||||
- flags:
|
- flags:
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- --parent: Parent group name.
|
- --group: Parent group name.
|
||||||
- args: SceneName ItemName
|
- args: SceneName ItemName
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli sceneitem visible --parent=test_group START "Colour Source 4"
|
gobs-cli sceneitem visible --group=test_group START "Colour Source 4"
|
||||||
|
```
|
||||||
|
|
||||||
|
- transform: Transform scene item.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --group: Parent group name.
|
||||||
|
|
||||||
|
- --alignment: Alignment of the scene item.
|
||||||
|
- --bounds-alignment: Bounds alignment of the scene item.
|
||||||
|
- --bounds-height: Bounds height of the scene item.
|
||||||
|
- --bounds-type: Bounds type of the scene item.
|
||||||
|
- --bounds-width: Bounds width of the scene item.
|
||||||
|
- --crop-to-bounds: Whether to crop the scene item to bounds.
|
||||||
|
- --crop-bottom: Crop bottom value of the scene item.
|
||||||
|
- --crop-left: Crop left value of the scene item.
|
||||||
|
- --crop-right: Crop right value of the scene item.
|
||||||
|
- --crop-top: Crop top value of the scene item.
|
||||||
|
- --position-x: X position of the scene item.
|
||||||
|
- --position-y: Y position of the scene item.
|
||||||
|
- --rotation: Rotation of the scene item.
|
||||||
|
- --scale-x: X scale of the scene item.
|
||||||
|
- --scale-y: Y scale of the scene item.
|
||||||
|
- args: SceneName ItemName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli sceneitem transform \
|
||||||
|
--rotation=5 \
|
||||||
|
--position-x=250.8 \
|
||||||
|
Scene "Colour Source 3"
|
||||||
```
|
```
|
||||||
|
|
||||||
### GroupCmd
|
### GroupCmd
|
||||||
|
|
||||||
- list: List all groups.
|
- list: List all groups.
|
||||||
|
|
||||||
|
*optional*
|
||||||
- args: SceneName
|
- args: SceneName
|
||||||
|
- defaults to current scene
|
||||||
|
|
||||||
```console
|
```console
|
||||||
|
gobs-cli group list
|
||||||
|
|
||||||
gobs-cli group list START
|
gobs-cli group list START
|
||||||
```
|
```
|
||||||
|
|
||||||
@@ -233,6 +281,19 @@ gobs-cli record pause
|
|||||||
gobs-cli record resume
|
gobs-cli record resume
|
||||||
```
|
```
|
||||||
|
|
||||||
|
- directory: Get/Set recording directory.
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- args: RecordDirectory
|
||||||
|
- if not passed the current record directory will be printed.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record directory
|
||||||
|
|
||||||
|
gobs-cli record directory "/home/me/obs-vids/"
|
||||||
|
gobs-cli record directory "C:/Users/me/Videos"
|
||||||
|
```
|
||||||
|
|
||||||
### StreamCmd
|
### StreamCmd
|
||||||
|
|
||||||
- start: Start streaming.
|
- start: Start streaming.
|
||||||
@@ -336,6 +397,12 @@ gobs-cli replaybuffer start
|
|||||||
gobs-cli replaybuffer stop
|
gobs-cli replaybuffer stop
|
||||||
```
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle replay buffer.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli replaybuffer toggle
|
||||||
|
```
|
||||||
|
|
||||||
- status: Get replay buffer status.
|
- status: Get replay buffer status.
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@@ -399,3 +466,104 @@ gobs-cli virtualcam toggle
|
|||||||
```console
|
```console
|
||||||
gobs-cli virtualcam status
|
gobs-cli virtualcam status
|
||||||
```
|
```
|
||||||
|
|
||||||
|
### HotkeyCmd
|
||||||
|
|
||||||
|
- list: List all hotkeys.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli hotkey list
|
||||||
|
```
|
||||||
|
|
||||||
|
- trigger: Trigger a hotkey by name.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli hotkey trigger OBSBasic.StartStreaming
|
||||||
|
|
||||||
|
gobs-cli hotkey trigger OBSBasic.StopStreaming
|
||||||
|
```
|
||||||
|
|
||||||
|
- trigger-sequence: Trigger a hotkey by sequence.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --shift: Press shift.
|
||||||
|
- --ctrl: Press control.
|
||||||
|
- --alt: Press alt.
|
||||||
|
- --cmd: Press command (mac).
|
||||||
|
|
||||||
|
- args: keyID
|
||||||
|
- Check [obs-hotkeys.h][obs-keyids] for a full list of OBS key ids.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli hotkey trigger-sequence OBS_KEY_F1 --ctrl
|
||||||
|
|
||||||
|
gobs-cli hotkey trigger-sequence OBS_KEY_F1 --shift --ctrl
|
||||||
|
```
|
||||||
|
|
||||||
|
### FilterCmd
|
||||||
|
|
||||||
|
- list: List all filters.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli filter list
|
||||||
|
```
|
||||||
|
|
||||||
|
- enable: Enable filter.
|
||||||
|
- args: SourceName FilterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli enable 'Mic/Aux' 'Gain'
|
||||||
|
```
|
||||||
|
|
||||||
|
- disable: Disable filter.
|
||||||
|
- args: SourceName FilterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli disable 'Mic/Aux' 'Gain'
|
||||||
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle filter.
|
||||||
|
- args: SourceName FilterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli toggle 'Mic/Aux' 'Gain'
|
||||||
|
```
|
||||||
|
|
||||||
|
- status: Get filter status.
|
||||||
|
- args: SourceName FilterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli status 'Mic/Aux' 'Gain'
|
||||||
|
```
|
||||||
|
|
||||||
|
### ProjectorCmd
|
||||||
|
|
||||||
|
- list-monitors: List available monitors.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli projector list-monitors
|
||||||
|
```
|
||||||
|
|
||||||
|
- open: Open a fullscreen projector for a source on a specific monitor.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --monitor-index: Index of the monitor to open the projector on.
|
||||||
|
- defaults to 0
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- args: <source_name>
|
||||||
|
- defaults to current scene
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli project open
|
||||||
|
|
||||||
|
gobs-cli projector open --monitor-index=1 "test_scene"
|
||||||
|
|
||||||
|
gobs-cli projector open --monitor-index=1 "test_group"
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
||||||
|
[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
|
||||||
17
Taskfile.man.yaml
Normal file
17
Taskfile.man.yaml
Normal file
@@ -0,0 +1,17 @@
|
|||||||
|
version: '3'
|
||||||
|
|
||||||
|
tasks:
|
||||||
|
default:
|
||||||
|
desc: View man page
|
||||||
|
cmds:
|
||||||
|
- task: view
|
||||||
|
|
||||||
|
view:
|
||||||
|
desc: View man page
|
||||||
|
cmds:
|
||||||
|
- go run . --man | man -l -
|
||||||
|
|
||||||
|
generate:
|
||||||
|
desc: Generate man page
|
||||||
|
cmds:
|
||||||
|
- go run . --man > {{.PROGRAM}}.1
|
||||||
@@ -1,5 +1,8 @@
|
|||||||
version: '3'
|
version: '3'
|
||||||
|
|
||||||
|
includes:
|
||||||
|
man: Taskfile.man.yaml
|
||||||
|
|
||||||
vars:
|
vars:
|
||||||
PROGRAM: gobs-cli
|
PROGRAM: gobs-cli
|
||||||
SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
|
SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
|
||||||
|
|||||||
176
filter.go
Normal file
176
filter.go
Normal file
@@ -0,0 +1,176 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"sort"
|
||||||
|
"strings"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/filters"
|
||||||
|
"github.com/aquasecurity/table"
|
||||||
|
)
|
||||||
|
|
||||||
|
// FilterCmd provides commands to manage filters in OBS Studio.
|
||||||
|
type FilterCmd struct {
|
||||||
|
List FilterListCmd `cmd:"" help:"List all filters." aliases:"ls"`
|
||||||
|
Enable FilterEnableCmd `cmd:"" help:"Enable filter." aliases:"on"`
|
||||||
|
Disable FilterDisableCmd `cmd:"" help:"Disable filter." aliases:"off"`
|
||||||
|
Toggle FilterToggleCmd `cmd:"" help:"Toggle filter." aliases:"tg"`
|
||||||
|
Status FilterStatusCmd `cmd:"" help:"Get filter status." aliases:"ss"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterListCmd provides a command to list all filters in a scene.
|
||||||
|
type FilterListCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to list filters from."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to list all filters in a scene.
|
||||||
|
func (cmd *FilterListCmd) Run(ctx *context) error {
|
||||||
|
filters, err := ctx.Client.Filters.GetSourceFilterList(
|
||||||
|
filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if len(filters.Filters) == 0 {
|
||||||
|
fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", cmd.SourceName)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
t := table.New(ctx.Out)
|
||||||
|
t.SetPadding(3)
|
||||||
|
t.SetAlignment(table.AlignLeft, table.AlignLeft, table.AlignCenter, table.AlignLeft)
|
||||||
|
t.SetHeaders("Filter Name", "Kind", "Enabled", "Settings")
|
||||||
|
|
||||||
|
for _, filter := range filters.Filters {
|
||||||
|
var lines []string
|
||||||
|
for k, v := range filter.FilterSettings {
|
||||||
|
lines = append(lines, fmt.Sprintf("%s %v", k, v))
|
||||||
|
}
|
||||||
|
sort.Slice(lines, func(i, j int) bool {
|
||||||
|
return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
|
||||||
|
})
|
||||||
|
|
||||||
|
t.AddRow(
|
||||||
|
filter.FilterName,
|
||||||
|
snakeCaseToTitleCase(filter.FilterKind),
|
||||||
|
getEnabledMark(filter.FilterEnabled),
|
||||||
|
strings.Join(lines, "\n"),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
t.Render()
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterEnableCmd provides a command to enable a filter in a scene.
|
||||||
|
type FilterEnableCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to enable filter from."`
|
||||||
|
FilterName string `arg:"" help:"Name of the filter to enable."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to enable a filter in a scene.
|
||||||
|
func (cmd *FilterEnableCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Filters.SetSourceFilterEnabled(
|
||||||
|
filters.NewSetSourceFilterEnabledParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName).
|
||||||
|
WithFilterEnabled(true),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to enable filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterDisableCmd provides a command to disable a filter in a scene.
|
||||||
|
type FilterDisableCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to disable filter from."`
|
||||||
|
FilterName string `arg:"" help:"Name of the filter to disable."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to disable a filter in a scene.
|
||||||
|
func (cmd *FilterDisableCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Filters.SetSourceFilterEnabled(
|
||||||
|
filters.NewSetSourceFilterEnabledParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName).
|
||||||
|
WithFilterEnabled(false),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to disable filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterToggleCmd provides a command to toggle a filter in a scene.
|
||||||
|
type FilterToggleCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to toggle filter from."`
|
||||||
|
FilterName string `arg:"" help:"Name of the filter to toggle."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to toggle a filter in a scene.
|
||||||
|
func (cmd *FilterToggleCmd) Run(ctx *context) error {
|
||||||
|
filter, err := ctx.Client.Filters.GetSourceFilter(
|
||||||
|
filters.NewGetSourceFilterParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
newStatus := !filter.FilterEnabled
|
||||||
|
_, err = ctx.Client.Filters.SetSourceFilterEnabled(
|
||||||
|
filters.NewSetSourceFilterEnabledParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName).
|
||||||
|
WithFilterEnabled(newStatus),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to toggle filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
if newStatus {
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterStatusCmd provides a command to get the status of a filter in a scene.
|
||||||
|
type FilterStatusCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to get filter status from."`
|
||||||
|
FilterName string `arg:"" help:"Name of the filter to get status."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to get the status of a filter in a scene.
|
||||||
|
func (cmd *FilterStatusCmd) Run(ctx *context) error {
|
||||||
|
filter, err := ctx.Client.Filters.GetSourceFilter(
|
||||||
|
filters.NewGetSourceFilterParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get status of filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
if filter.FilterEnabled {
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
76
filter_test.go
Normal file
76
filter_test.go
Normal file
@@ -0,0 +1,76 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestFilterList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &FilterListCmd{
|
||||||
|
SourceName: "Mic/Aux",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list filters: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "test_filter") {
|
||||||
|
t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestFilterListScene(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &FilterListCmd{
|
||||||
|
SourceName: "gobs-test",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list filters in scene: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "test_filter") {
|
||||||
|
t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestFilterListEmpty(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &FilterListCmd{
|
||||||
|
SourceName: "NonExistentSource",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err == nil {
|
||||||
|
t.Fatal("Expected error for non-existent source, but got none")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "No source was found by the name of `NonExistentSource`.") {
|
||||||
|
t.Fatalf(
|
||||||
|
"Expected error to contain 'No source was found by the name of `NonExistentSource`.', got '%s'",
|
||||||
|
err.Error(),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
10
go.mod
10
go.mod
@@ -4,14 +4,24 @@ go 1.24.0
|
|||||||
|
|
||||||
require (
|
require (
|
||||||
github.com/alecthomas/kong v1.10.0
|
github.com/alecthomas/kong v1.10.0
|
||||||
|
github.com/alecthomas/mango-kong v0.1.0
|
||||||
github.com/andreykaipov/goobs v1.5.6
|
github.com/andreykaipov/goobs v1.5.6
|
||||||
|
github.com/aquasecurity/table v1.10.0
|
||||||
|
github.com/titusjaka/kong-dotenv-go v0.1.0
|
||||||
)
|
)
|
||||||
|
|
||||||
require (
|
require (
|
||||||
github.com/buger/jsonparser v1.1.1 // indirect
|
github.com/buger/jsonparser v1.1.1 // indirect
|
||||||
github.com/gorilla/websocket v1.5.3 // indirect
|
github.com/gorilla/websocket v1.5.3 // indirect
|
||||||
github.com/hashicorp/logutils v1.0.0 // indirect
|
github.com/hashicorp/logutils v1.0.0 // indirect
|
||||||
|
github.com/joho/godotenv v1.5.1 // indirect
|
||||||
|
github.com/mattn/go-runewidth v0.0.13 // indirect
|
||||||
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
||||||
github.com/mmcloughlin/profile v0.1.1 // indirect
|
github.com/mmcloughlin/profile v0.1.1 // indirect
|
||||||
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
|
||||||
|
github.com/muesli/roff v0.1.0 // indirect
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
||||||
|
github.com/rivo/uniseg v0.2.0 // indirect
|
||||||
|
golang.org/x/sys v0.1.0 // indirect
|
||||||
|
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 // indirect
|
||||||
)
|
)
|
||||||
|
|||||||
20
go.sum
20
go.sum
@@ -2,10 +2,14 @@ github.com/alecthomas/assert/v2 v2.11.0 h1:2Q9r3ki8+JYXvGsDyBXwH3LcJ+WK5D0gc5E8v
|
|||||||
github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
|
github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
|
||||||
github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
|
github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
|
||||||
github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
|
github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
|
||||||
|
github.com/alecthomas/mango-kong v0.1.0 h1:iFVfP1k1K4qpml3JUQmD5I8MCQYfIvsD9mRdrw7jJC4=
|
||||||
|
github.com/alecthomas/mango-kong v0.1.0/go.mod h1:t+TYVdsONUolf/BwVcm+15eqcdAj15h4Qe9MMFAwwT4=
|
||||||
github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
|
github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
|
||||||
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
||||||
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
||||||
github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
|
github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
|
||||||
|
github.com/aquasecurity/table v1.10.0 h1:gPWV28qp9XSlvXdT3ku8yKQoZE6II0vsmegKpW+dB08=
|
||||||
|
github.com/aquasecurity/table v1.10.0/go.mod h1:eqOmvjjB7AhXFgFqpJUEE/ietg7RrMSJZXyTN8E/wZw=
|
||||||
github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
|
github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
|
||||||
github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
|
github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
|
||||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||||
@@ -16,15 +20,31 @@ github.com/hashicorp/logutils v1.0.0 h1:dLEQVugN8vlakKOUE3ihGLTZJRB4j+M2cdTm/ORI
|
|||||||
github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
|
github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
|
||||||
github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
|
github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
|
||||||
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
||||||
|
github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
|
||||||
|
github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
|
||||||
|
github.com/mattn/go-runewidth v0.0.13 h1:lTGmDsbAYt5DmK6OnoV7EuIF1wEIFAcxld6ypU4OSgU=
|
||||||
|
github.com/mattn/go-runewidth v0.0.13/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
|
||||||
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
||||||
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
||||||
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
||||||
github.com/mmcloughlin/profile v0.1.1/go.mod h1:IhHD7q1ooxgwTgjxQYkACGA77oFTDdFVejUS1/tS/qU=
|
github.com/mmcloughlin/profile v0.1.1/go.mod h1:IhHD7q1ooxgwTgjxQYkACGA77oFTDdFVejUS1/tS/qU=
|
||||||
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab h1:m7QFONkzLK0fVXCjwX5tANcnj1yXxTnYQtnfJiY3tcA=
|
||||||
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
|
||||||
|
github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
|
||||||
|
github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
||||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||||
|
github.com/rivo/uniseg v0.2.0 h1:S1pD9weZBuJdFmowNwbpi7BJ8TNftyUImj/0WQi72jY=
|
||||||
|
github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
|
||||||
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
||||||
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
||||||
|
github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
|
||||||
|
github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
|
||||||
|
golang.org/x/sys v0.1.0 h1:kunALQeHf1/185U1i0GOB/fy1IPRDDpuoOOqRReG57U=
|
||||||
|
golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||||
|
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 h1:CBpWXWQpIRjzmkkA+M7q9Fqnwd2mZr3AFqexg8YTfoM=
|
||||||
|
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
|
||||||
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||||
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||||
|
|||||||
20
group.go
20
group.go
@@ -4,6 +4,7 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||||
|
"github.com/aquasecurity/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// GroupCmd provides commands to manage groups in OBS Studio.
|
// GroupCmd provides commands to manage groups in OBS Studio.
|
||||||
@@ -17,21 +18,36 @@ type GroupCmd struct {
|
|||||||
|
|
||||||
// GroupListCmd provides a command to list all groups in a scene.
|
// GroupListCmd provides a command to list all groups in a scene.
|
||||||
type GroupListCmd struct {
|
type GroupListCmd struct {
|
||||||
SceneName string `arg:"" help:"Name of the scene to list groups from."`
|
SceneName string `arg:"" help:"Name of the scene to list groups from." default:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all groups in a scene.
|
// Run executes the command to list all groups in a scene.
|
||||||
func (cmd *GroupListCmd) Run(ctx *context) error {
|
func (cmd *GroupListCmd) Run(ctx *context) error {
|
||||||
|
if cmd.SceneName == "" {
|
||||||
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||||
|
}
|
||||||
|
cmd.SceneName = currentScene.SceneName
|
||||||
|
}
|
||||||
|
|
||||||
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||||
WithSceneName(cmd.SceneName))
|
WithSceneName(cmd.SceneName))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get scene item list: %w", err)
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
t := table.New(ctx.Out)
|
||||||
|
t.SetPadding(3)
|
||||||
|
t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter)
|
||||||
|
t.SetHeaders("ID", "Group Name", "Enabled")
|
||||||
|
|
||||||
for _, item := range resp.SceneItems {
|
for _, item := range resp.SceneItems {
|
||||||
if item.IsGroup {
|
if item.IsGroup {
|
||||||
fmt.Fprintf(ctx.Out, "Group ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
|
t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
t.Render()
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
130
group_test.go
Normal file
130
group_test.go
Normal file
@@ -0,0 +1,130 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestGroupList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &GroupListCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list groups: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "test_group") {
|
||||||
|
t.Fatalf("Expected output to contain 'test_group', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGroupShow(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &GroupShowCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to show group: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Group test_group is now shown.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGroupToggle(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &GroupStatusCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get group status: %v", err)
|
||||||
|
}
|
||||||
|
var enabled bool
|
||||||
|
if strings.Contains(out.String(), "Group test_group is shown.") {
|
||||||
|
enabled = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdToggle := &GroupToggleCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err = cmdToggle.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to toggle group: %v", err)
|
||||||
|
}
|
||||||
|
if enabled {
|
||||||
|
if out.String() != "Group test_group is now hidden.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Group test_group is now hidden.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Group test_group is now shown.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGroupStatus(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdShow := &GroupShowCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err := cmdShow.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to show group: %v", err)
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStatus := &GroupStatusCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err = cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get group status: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Group test_group is shown.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Group test_group is shown.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
79
hotkey.go
Normal file
79
hotkey.go
Normal file
@@ -0,0 +1,79 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/general"
|
||||||
|
"github.com/andreykaipov/goobs/api/typedefs"
|
||||||
|
"github.com/aquasecurity/table"
|
||||||
|
)
|
||||||
|
|
||||||
|
// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
|
||||||
|
type HotkeyCmd struct {
|
||||||
|
List HotkeyListCmd `cmd:"" help:"List all hotkeys." aliases:"ls"`
|
||||||
|
Trigger HotkeyTriggerCmd `cmd:"" help:"Trigger a hotkey by name." aliases:"tr"`
|
||||||
|
TriggerSequence HotkeyTriggerSequenceCmd `cmd:"" help:"Trigger a hotkey by sequence." aliases:"trs"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// HotkeyListCmd provides a command to list all hotkeys.
|
||||||
|
type HotkeyListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to list all hotkeys.
|
||||||
|
func (cmd *HotkeyListCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.General.GetHotkeyList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
t := table.New(ctx.Out)
|
||||||
|
t.SetPadding(3)
|
||||||
|
t.SetAlignment(table.AlignLeft)
|
||||||
|
t.SetHeaders("Hotkey Name")
|
||||||
|
|
||||||
|
for _, hotkey := range resp.Hotkeys {
|
||||||
|
t.AddRow(hotkey)
|
||||||
|
}
|
||||||
|
t.Render()
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// HotkeyTriggerCmd provides a command to trigger a hotkey.
|
||||||
|
type HotkeyTriggerCmd struct {
|
||||||
|
Hotkey string `help:"Hotkey name to trigger." arg:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to trigger a hotkey.
|
||||||
|
func (cmd *HotkeyTriggerCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.General.TriggerHotkeyByName(
|
||||||
|
general.NewTriggerHotkeyByNameParams().WithHotkeyName(cmd.Hotkey),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// HotkeyTriggerSequenceCmd provides a command to trigger a hotkey sequence.
|
||||||
|
type HotkeyTriggerSequenceCmd struct {
|
||||||
|
Shift bool `flag:"" help:"Shift modifier."`
|
||||||
|
Ctrl bool `flag:"" help:"Control modifier."`
|
||||||
|
Alt bool `flag:"" help:"Alt modifier."`
|
||||||
|
Cmd bool `flag:"" help:"Command modifier."`
|
||||||
|
KeyID string ` help:"Key ID to trigger." arg:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to trigger a hotkey sequence.
|
||||||
|
func (cmd *HotkeyTriggerSequenceCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.General.TriggerHotkeyByKeySequence(
|
||||||
|
general.NewTriggerHotkeyByKeySequenceParams().
|
||||||
|
WithKeyId(cmd.KeyID).
|
||||||
|
WithKeyModifiers(&typedefs.KeyModifiers{
|
||||||
|
Shift: cmd.Shift,
|
||||||
|
Control: cmd.Ctrl,
|
||||||
|
Alt: cmd.Alt,
|
||||||
|
Command: cmd.Cmd,
|
||||||
|
}),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
16
input.go
16
input.go
@@ -5,6 +5,7 @@ import (
|
|||||||
"strings"
|
"strings"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/inputs"
|
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||||
|
"github.com/aquasecurity/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// InputCmd provides commands to manage inputs in OBS Studio.
|
// InputCmd provides commands to manage inputs in OBS Studio.
|
||||||
@@ -28,21 +29,28 @@ func (cmd *InputListCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
t := table.New(ctx.Out)
|
||||||
|
t.SetPadding(3)
|
||||||
|
t.SetAlignment(table.AlignLeft, table.AlignLeft)
|
||||||
|
t.SetHeaders("Input Name", "Kind")
|
||||||
|
|
||||||
for _, input := range resp.Inputs {
|
for _, input := range resp.Inputs {
|
||||||
if cmd.Input && strings.Contains(input.InputKind, "input") {
|
if cmd.Input && strings.Contains(input.InputKind, "input") {
|
||||||
fmt.Fprintln(ctx.Out, "Input:", input.InputName)
|
t.AddRow(input.InputName, input.InputKind)
|
||||||
}
|
}
|
||||||
if cmd.Output && strings.Contains(input.InputKind, "output") {
|
if cmd.Output && strings.Contains(input.InputKind, "output") {
|
||||||
fmt.Fprintln(ctx.Out, "Output:", input.InputName)
|
t.AddRow(input.InputName, input.InputKind)
|
||||||
}
|
}
|
||||||
if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
|
if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
|
||||||
fmt.Fprintln(ctx.Out, "Colour Source:", input.InputName)
|
t.AddRow(input.InputName, input.InputKind)
|
||||||
}
|
}
|
||||||
|
|
||||||
if !cmd.Input && !cmd.Output && !cmd.Colour {
|
if !cmd.Input && !cmd.Output && !cmd.Colour {
|
||||||
fmt.Fprintln(ctx.Out, "Source:", input.InputName)
|
t.AddRow(input.InputName, input.InputKind)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
t.Render()
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
140
input_test.go
Normal file
140
input_test.go
Normal file
@@ -0,0 +1,140 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestInputList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &InputListCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list inputs: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
expectedInputs := []string{
|
||||||
|
"Desktop Audio",
|
||||||
|
"Mic/Aux",
|
||||||
|
"Colour Source",
|
||||||
|
"Colour Source 2",
|
||||||
|
"Colour Source 3",
|
||||||
|
}
|
||||||
|
output := out.String()
|
||||||
|
for _, input := range expectedInputs {
|
||||||
|
if !strings.Contains(output, input) {
|
||||||
|
t.Fatalf("Expected output to contain '%s', got '%s'", input, output)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestInputListFilterInput(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &InputListCmd{Input: true}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list inputs with filter: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
expectedInputs := []string{
|
||||||
|
"Mic/Aux",
|
||||||
|
}
|
||||||
|
expectedFilteredOut := []string{
|
||||||
|
"Desktop Audio",
|
||||||
|
"Colour Source",
|
||||||
|
"Colour Source 2",
|
||||||
|
"Colour Source 3",
|
||||||
|
}
|
||||||
|
for _, input := range expectedInputs {
|
||||||
|
if !strings.Contains(out.String(), input) {
|
||||||
|
t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
for _, filteredOut := range expectedFilteredOut {
|
||||||
|
if strings.Contains(out.String(), filteredOut) {
|
||||||
|
t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestInputListFilterOutput(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &InputListCmd{Output: true}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list outputs with filter: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
expectedInputs := []string{
|
||||||
|
"Desktop Audio",
|
||||||
|
}
|
||||||
|
expectedFilteredOut := []string{
|
||||||
|
"Mic/Aux",
|
||||||
|
"Colour Source",
|
||||||
|
"Colour Source 2",
|
||||||
|
"Colour Source 3",
|
||||||
|
}
|
||||||
|
for _, input := range expectedInputs {
|
||||||
|
if !strings.Contains(out.String(), input) {
|
||||||
|
t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
for _, filteredOut := range expectedFilteredOut {
|
||||||
|
if strings.Contains(out.String(), filteredOut) {
|
||||||
|
t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestInputListFilterColour(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &InputListCmd{Colour: true}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list colour inputs with filter: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
expectedInputs := []string{
|
||||||
|
"Colour Source",
|
||||||
|
"Colour Source 2",
|
||||||
|
"Colour Source 3",
|
||||||
|
}
|
||||||
|
for _, input := range expectedInputs {
|
||||||
|
if !strings.Contains(out.String(), input) {
|
||||||
|
t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
21
main.go
21
main.go
@@ -7,10 +7,13 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
"io"
|
"io"
|
||||||
"os"
|
"os"
|
||||||
|
"path/filepath"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/alecthomas/kong"
|
"github.com/alecthomas/kong"
|
||||||
|
mangokong "github.com/alecthomas/mango-kong"
|
||||||
"github.com/andreykaipov/goobs"
|
"github.com/andreykaipov/goobs"
|
||||||
|
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
||||||
)
|
)
|
||||||
|
|
||||||
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
||||||
@@ -21,11 +24,13 @@ type ObsConfig struct {
|
|||||||
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT"`
|
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// cli is the main command line interface structure.
|
// CLI is the main command line interface structure.
|
||||||
// It embeds the ObsConfig struct to inherit its fields and flags.
|
// It embeds the ObsConfig struct to inherit its fields and flags.
|
||||||
type cli struct {
|
type CLI struct {
|
||||||
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
||||||
|
|
||||||
|
Man mangokong.ManFlag `help:"Print man page."`
|
||||||
|
|
||||||
Version VersionCmd `help:"Show version." cmd:"" aliases:"v"`
|
Version VersionCmd `help:"Show version." cmd:"" aliases:"v"`
|
||||||
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
||||||
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
||||||
@@ -38,6 +43,9 @@ type cli struct {
|
|||||||
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
||||||
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
||||||
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
||||||
|
Hotkey HotkeyCmd `help:"Manage hotkeys." cmd:"" aliases:"hk"`
|
||||||
|
Filter FilterCmd `help:"Manage filters." cmd:"" aliases:"f"`
|
||||||
|
Projector ProjectorCmd `help:"Manage projectors." cmd:"" aliases:"prj"`
|
||||||
}
|
}
|
||||||
|
|
||||||
type context struct {
|
type context struct {
|
||||||
@@ -46,11 +54,18 @@ type context struct {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func main() {
|
func main() {
|
||||||
cli := cli{}
|
userConfigDir, err := os.UserConfigDir()
|
||||||
|
if err != nil {
|
||||||
|
fmt.Fprintf(os.Stderr, "Error getting user config directory: %v\n", err)
|
||||||
|
os.Exit(1)
|
||||||
|
}
|
||||||
|
|
||||||
|
var cli CLI
|
||||||
ctx := kong.Parse(
|
ctx := kong.Parse(
|
||||||
&cli,
|
&cli,
|
||||||
kong.Name("GOBS-CLI"),
|
kong.Name("GOBS-CLI"),
|
||||||
kong.Description("A command line tool to interact with OBS Websocket."),
|
kong.Description("A command line tool to interact with OBS Websocket."),
|
||||||
|
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
||||||
)
|
)
|
||||||
|
|
||||||
client, err := connectObs(cli.ObsConfig)
|
client, err := connectObs(cli.ObsConfig)
|
||||||
|
|||||||
136
main_test.go
Normal file
136
main_test.go
Normal file
@@ -0,0 +1,136 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"os"
|
||||||
|
"testing"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/filters"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/ui"
|
||||||
|
typedefs "github.com/andreykaipov/goobs/api/typedefs"
|
||||||
|
)
|
||||||
|
|
||||||
|
func getClient(t *testing.T) (*goobs.Client, func()) {
|
||||||
|
t.Helper()
|
||||||
|
client, err := connectObs(ObsConfig{
|
||||||
|
Host: os.Getenv("OBS_HOST"),
|
||||||
|
Port: 4455,
|
||||||
|
Password: os.Getenv("OBS_PASSWORD"),
|
||||||
|
Timeout: 5,
|
||||||
|
})
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to connect to OBS: %v", err)
|
||||||
|
}
|
||||||
|
return client, func() {
|
||||||
|
if err := client.Disconnect(); err != nil {
|
||||||
|
t.Fatalf("Failed to disconnect from OBS: %v", err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestMain(m *testing.M) {
|
||||||
|
client, err := connectObs(ObsConfig{
|
||||||
|
Host: os.Getenv("OBS_HOST"),
|
||||||
|
Port: 4455,
|
||||||
|
Password: os.Getenv("OBS_PASSWORD"),
|
||||||
|
Timeout: 5,
|
||||||
|
})
|
||||||
|
if err != nil {
|
||||||
|
os.Exit(1)
|
||||||
|
}
|
||||||
|
defer client.Disconnect()
|
||||||
|
|
||||||
|
setup(client)
|
||||||
|
|
||||||
|
// Run the tests
|
||||||
|
exitCode := m.Run()
|
||||||
|
|
||||||
|
teardown(client)
|
||||||
|
|
||||||
|
// Exit with the appropriate code
|
||||||
|
os.Exit(exitCode)
|
||||||
|
}
|
||||||
|
|
||||||
|
func setup(client *goobs.Client) {
|
||||||
|
client.Config.SetStreamServiceSettings(config.NewSetStreamServiceSettingsParams().
|
||||||
|
WithStreamServiceType("rtmp_common").
|
||||||
|
WithStreamServiceSettings(&typedefs.StreamServiceSettings{
|
||||||
|
Server: "auto",
|
||||||
|
Key: os.Getenv("OBS_STREAM_KEY"),
|
||||||
|
}))
|
||||||
|
|
||||||
|
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
||||||
|
WithSceneCollectionName("test-collection"))
|
||||||
|
|
||||||
|
client.Scenes.CreateScene(scenes.NewCreateSceneParams().
|
||||||
|
WithSceneName("gobs-test"))
|
||||||
|
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||||
|
WithSceneName("gobs-test").
|
||||||
|
WithInputName("gobs-test-input").
|
||||||
|
WithInputKind("color_source_v3").
|
||||||
|
WithInputSettings(map[string]any{
|
||||||
|
"color": 3279460728,
|
||||||
|
"width": 1920,
|
||||||
|
"height": 1080,
|
||||||
|
"visible": true,
|
||||||
|
}).
|
||||||
|
WithSceneItemEnabled(true))
|
||||||
|
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||||
|
WithSceneName("gobs-test").
|
||||||
|
WithInputName("gobs-test-input-2").
|
||||||
|
WithInputKind("color_source_v3").
|
||||||
|
WithInputSettings(map[string]any{
|
||||||
|
"color": 1789347616,
|
||||||
|
"width": 720,
|
||||||
|
"height": 480,
|
||||||
|
"visible": true,
|
||||||
|
}).
|
||||||
|
WithSceneItemEnabled(true))
|
||||||
|
|
||||||
|
// Create source filter on an audio input
|
||||||
|
client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
|
||||||
|
WithSourceName("Mic/Aux").
|
||||||
|
WithFilterName("test_filter").
|
||||||
|
WithFilterKind("compressor_filter").
|
||||||
|
WithFilterSettings(map[string]any{
|
||||||
|
"threshold": -20,
|
||||||
|
"ratio": 4,
|
||||||
|
"attack_time": 10,
|
||||||
|
"release_time": 100,
|
||||||
|
"output_gain": -3.6,
|
||||||
|
"sidechain_source": nil,
|
||||||
|
}))
|
||||||
|
|
||||||
|
// Create source filter on a scene
|
||||||
|
client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
|
||||||
|
WithSourceName("gobs-test").
|
||||||
|
WithFilterName("test_filter").
|
||||||
|
WithFilterKind("luma_key_filter_v2").
|
||||||
|
WithFilterSettings(map[string]any{
|
||||||
|
"luma": 0.5,
|
||||||
|
}))
|
||||||
|
}
|
||||||
|
|
||||||
|
func teardown(client *goobs.Client) {
|
||||||
|
client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
|
||||||
|
WithSourceName("Mic/Aux").
|
||||||
|
WithFilterName("test_filter"))
|
||||||
|
client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
|
||||||
|
WithSourceName("gobs-test").
|
||||||
|
WithFilterName("test_filter"))
|
||||||
|
|
||||||
|
client.Scenes.RemoveScene(scenes.NewRemoveSceneParams().
|
||||||
|
WithSceneName("gobs-test"))
|
||||||
|
|
||||||
|
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
||||||
|
WithSceneCollectionName("default"))
|
||||||
|
|
||||||
|
client.Stream.StopStream()
|
||||||
|
client.Record.StopRecord()
|
||||||
|
client.Outputs.StopReplayBuffer()
|
||||||
|
client.Ui.SetStudioModeEnabled(ui.NewSetStudioModeEnabledParams().
|
||||||
|
WithStudioModeEnabled(false))
|
||||||
|
}
|
||||||
53
profile.go
53
profile.go
@@ -5,39 +5,50 @@ import (
|
|||||||
"slices"
|
"slices"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/config"
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
"github.com/aquasecurity/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
||||||
type ProfileCmd struct {
|
type ProfileCmd struct {
|
||||||
List ListProfileCmd `help:"List profiles." cmd:"" aliases:"ls"`
|
List ProfileListCmd `help:"List profiles." cmd:"" aliases:"ls"`
|
||||||
Current CurrentProfileCmd `help:"Get current profile." cmd:"" aliases:"c"`
|
Current ProfileCurrentCmd `help:"Get current profile." cmd:"" aliases:"c"`
|
||||||
Switch SwitchProfileCmd `help:"Switch profile." cmd:"" aliases:"sw"`
|
Switch ProfileSwitchCmd `help:"Switch profile." cmd:"" aliases:"sw"`
|
||||||
Create CreateProfileCmd `help:"Create profile." cmd:"" aliases:"new"`
|
Create ProfileCreateCmd `help:"Create profile." cmd:"" aliases:"new"`
|
||||||
Remove RemoveProfileCmd `help:"Remove profile." cmd:"" aliases:"rm"`
|
Remove ProfileRemoveCmd `help:"Remove profile." cmd:"" aliases:"rm"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// ListProfileCmd provides a command to list all profiles.
|
// ProfileListCmd provides a command to list all profiles.
|
||||||
type ListProfileCmd struct{} // size = 0x0
|
type ProfileListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to list all profiles.
|
// Run executes the command to list all profiles.
|
||||||
func (cmd *ListProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileListCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
t := table.New(ctx.Out)
|
||||||
|
t.SetPadding(3)
|
||||||
|
t.SetAlignment(table.AlignLeft, table.AlignCenter)
|
||||||
|
t.SetHeaders("Profile Name", "Current")
|
||||||
|
|
||||||
for _, profile := range profiles.Profiles {
|
for _, profile := range profiles.Profiles {
|
||||||
fmt.Fprintln(ctx.Out, profile)
|
var enabledMark string
|
||||||
|
if profile == profiles.CurrentProfileName {
|
||||||
|
enabledMark = getEnabledMark(true)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
t.AddRow(profile, enabledMark)
|
||||||
|
}
|
||||||
|
t.Render()
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CurrentProfileCmd provides a command to get the current profile.
|
// ProfileCurrentCmd provides a command to get the current profile.
|
||||||
type CurrentProfileCmd struct{} // size = 0x0
|
type ProfileCurrentCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to get the current profile.
|
// Run executes the command to get the current profile.
|
||||||
func (cmd *CurrentProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileCurrentCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -47,13 +58,13 @@ func (cmd *CurrentProfileCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// SwitchProfileCmd provides a command to switch to a different profile.
|
// ProfileSwitchCmd provides a command to switch to a different profile.
|
||||||
type SwitchProfileCmd struct {
|
type ProfileSwitchCmd struct {
|
||||||
Name string `arg:"" help:"Name of the profile to switch to." required:""`
|
Name string `arg:"" help:"Name of the profile to switch to." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to switch to a different profile.
|
// Run executes the command to switch to a different profile.
|
||||||
func (cmd *SwitchProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -74,13 +85,13 @@ func (cmd *SwitchProfileCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateProfileCmd provides a command to create a new profile.
|
// ProfileCreateCmd provides a command to create a new profile.
|
||||||
type CreateProfileCmd struct {
|
type ProfileCreateCmd struct {
|
||||||
Name string `arg:"" help:"Name of the profile to create." required:""`
|
Name string `arg:"" help:"Name of the profile to create." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to create a new profile.
|
// Run executes the command to create a new profile.
|
||||||
func (cmd *CreateProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileCreateCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -100,13 +111,13 @@ func (cmd *CreateProfileCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// RemoveProfileCmd provides a command to remove an existing profile.
|
// ProfileRemoveCmd provides a command to remove an existing profile.
|
||||||
type RemoveProfileCmd struct {
|
type ProfileRemoveCmd struct {
|
||||||
Name string `arg:"" help:"Name of the profile to delete." required:""`
|
Name string `arg:"" help:"Name of the profile to delete." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to remove an existing profile.
|
// Run executes the command to remove an existing profile.
|
||||||
func (cmd *RemoveProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileRemoveCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
|
|||||||
66
projector.go
Normal file
66
projector.go
Normal file
@@ -0,0 +1,66 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/ui"
|
||||||
|
"github.com/aquasecurity/table"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ProjectorCmd provides a command to manage projectors in OBS.
|
||||||
|
type ProjectorCmd struct {
|
||||||
|
ListMonitors ProjectorListMonitorsCmd `cmd:"" help:"List available monitors." aliases:"ls-m"`
|
||||||
|
Open ProjectorOpenCmd `cmd:"" help:"Open a fullscreen projector for a source on a specific monitor." aliases:"o"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ProjectorListMonitorsCmd provides a command to list all monitors available for projectors.
|
||||||
|
type ProjectorListMonitorsCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to list all monitors available for projectors.
|
||||||
|
func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
|
||||||
|
monitors, err := ctx.Client.Ui.GetMonitorList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if len(monitors.Monitors) == 0 {
|
||||||
|
ctx.Out.Write([]byte("No monitors found for projectors.\n"))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
t := table.New(ctx.Out)
|
||||||
|
t.SetPadding(3)
|
||||||
|
t.SetAlignment(table.AlignCenter, table.AlignLeft)
|
||||||
|
t.SetHeaders("Monitor ID", "Monitor Name")
|
||||||
|
|
||||||
|
for _, monitor := range monitors.Monitors {
|
||||||
|
t.AddRow(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
|
||||||
|
}
|
||||||
|
|
||||||
|
t.Render()
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ProjectorOpenCmd provides a command to open a fullscreen projector for a specific source.
|
||||||
|
type ProjectorOpenCmd struct {
|
||||||
|
MonitorIndex int `flag:"" help:"Index of the monitor to open the projector on." default:"0"`
|
||||||
|
SourceName string ` help:"Name of the source to project." default:"" arg:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to show details of a specific projector.
|
||||||
|
func (cmd *ProjectorOpenCmd) Run(ctx *context) error {
|
||||||
|
if cmd.SourceName == "" {
|
||||||
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||||
|
}
|
||||||
|
cmd.SourceName = currentScene.SceneName
|
||||||
|
}
|
||||||
|
|
||||||
|
ctx.Client.Ui.OpenSourceProjector(ui.NewOpenSourceProjectorParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithMonitorIndex(cmd.MonitorIndex))
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Opened projector for source '%s' on monitor index %d.\n", cmd.SourceName, cmd.MonitorIndex)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
92
record.go
92
record.go
@@ -2,6 +2,8 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
)
|
)
|
||||||
|
|
||||||
// RecordCmd handles the recording commands.
|
// RecordCmd handles the recording commands.
|
||||||
@@ -9,8 +11,10 @@ type RecordCmd struct {
|
|||||||
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
||||||
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
||||||
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
||||||
|
Status RecordStatusCmd `cmd:"" help:"Show recording status." aliases:"ss"`
|
||||||
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
||||||
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
||||||
|
Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// RecordStartCmd starts the recording.
|
// RecordStartCmd starts the recording.
|
||||||
@@ -18,7 +22,19 @@ type RecordStartCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to start recording.
|
// Run executes the command to start recording.
|
||||||
func (cmd *RecordStartCmd) Run(ctx *context) error {
|
func (cmd *RecordStartCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Record.StartRecord()
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if status.OutputActive {
|
||||||
|
if status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is already in progress and paused")
|
||||||
|
}
|
||||||
|
return fmt.Errorf("recording is already in progress")
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.StartRecord()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -31,11 +47,20 @@ type RecordStopCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to stop recording.
|
// Run executes the command to stop recording.
|
||||||
func (cmd *RecordStopCmd) Run(ctx *context) error {
|
func (cmd *RecordStopCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Record.StopRecord()
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
|
||||||
|
resp, err := ctx.Client.Record.StopRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "%s", fmt.Sprintf("Recording stopped successfully. Output file: %s\n", resp.OutputPath))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -44,25 +69,39 @@ type RecordToggleCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to toggle recording.
|
// Run executes the command to toggle recording.
|
||||||
func (cmd *RecordToggleCmd) Run(ctx *context) error {
|
func (cmd *RecordToggleCmd) Run(ctx *context) error {
|
||||||
// Check if recording is in progress
|
status, err := ctx.Client.Record.ToggleRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if status.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording started successfully.")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordStatusCmd shows the recording status.
|
||||||
|
type RecordStatusCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to show recording status.
|
||||||
|
func (cmd *RecordStatusCmd) Run(ctx *context) error {
|
||||||
status, err := ctx.Client.Record.GetRecordStatus()
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
if status.OutputActive {
|
if status.OutputActive {
|
||||||
_, err = ctx.Client.Record.StopRecord()
|
if status.OutputPaused {
|
||||||
if err != nil {
|
fmt.Fprintln(ctx.Out, "Recording is paused.")
|
||||||
return err
|
|
||||||
}
|
|
||||||
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
|
||||||
} else {
|
} else {
|
||||||
_, err = ctx.Client.Record.StartRecord()
|
fmt.Fprintln(ctx.Out, "Recording is in progress.")
|
||||||
if err != nil {
|
|
||||||
return err
|
|
||||||
}
|
}
|
||||||
fmt.Fprintln(ctx.Out, "Recording started successfully.")
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording is not in progress.")
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -117,3 +156,30 @@ func (cmd *RecordResumeCmd) Run(ctx *context) error {
|
|||||||
fmt.Fprintln(ctx.Out, "Recording resumed successfully.")
|
fmt.Fprintln(ctx.Out, "Recording resumed successfully.")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// RecordDirectoryCmd sets the recording directory.
|
||||||
|
type RecordDirectoryCmd struct {
|
||||||
|
RecordDirectory string `arg:"" help:"Directory to save recordings." default:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to set the recording directory.
|
||||||
|
func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
|
||||||
|
if cmd.RecordDirectory == "" {
|
||||||
|
resp, err := ctx.Client.Config.GetRecordDirectory()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", resp.RecordDirectory)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err := ctx.Client.Config.SetRecordDirectory(
|
||||||
|
config.NewSetRecordDirectoryParams().WithRecordDirectory(cmd.RecordDirectory),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", cmd.RecordDirectory)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|||||||
135
record_test.go
Normal file
135
record_test.go
Normal file
@@ -0,0 +1,135 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
"time"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestRecordStart(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &RecordStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get recording status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if out.String() == "Recording is in progress.\n" {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStart := &RecordStartCmd{}
|
||||||
|
err = cmdStart.Run(context)
|
||||||
|
if active {
|
||||||
|
if err == nil {
|
||||||
|
t.Fatalf("Expected error when starting recording while active, got nil")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "recording is already in progress") {
|
||||||
|
t.Fatalf("Expected error message to contain 'recording is already in progress', got '%s'", err.Error())
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to start recording: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Recording started successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to contain 'Recording started successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
time.Sleep(1 * time.Second) // Wait for the recording to start
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestRecordStop(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &RecordStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get recording status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if out.String() == "Recording is in progress.\n" {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStop := &RecordStopCmd{}
|
||||||
|
err = cmdStop.Run(context)
|
||||||
|
if !active {
|
||||||
|
if err == nil {
|
||||||
|
t.Fatalf("Expected error when stopping recording while inactive, got nil")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "recording is not in progress") {
|
||||||
|
t.Fatalf("Expected error message to contain 'recording is not in progress', got '%s'", err.Error())
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to stop recording: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "Recording stopped successfully. Output file: ") {
|
||||||
|
t.Fatalf("Expected output to contain 'Recording stopped successfully. Output file: ', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
time.Sleep(1 * time.Second) // Wait for the recording to stop
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestRecordToggle(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &RecordStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get recording status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if out.String() == "Recording is in progress.\n" {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdToggle := &RecordToggleCmd{}
|
||||||
|
err = cmdToggle.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to toggle recording: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
time.Sleep(1 * time.Second) // Wait for a second to ensure toggle has taken effect
|
||||||
|
|
||||||
|
if active {
|
||||||
|
if out.String() != "Recording stopped successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Recording started successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -8,6 +8,7 @@ import (
|
|||||||
type ReplayBufferCmd struct {
|
type ReplayBufferCmd struct {
|
||||||
Start ReplayBufferStartCmd `help:"Start replay buffer." cmd:"" aliases:"s"`
|
Start ReplayBufferStartCmd `help:"Start replay buffer." cmd:"" aliases:"s"`
|
||||||
Stop ReplayBufferStopCmd `help:"Stop replay buffer." cmd:"" aliases:"st"`
|
Stop ReplayBufferStopCmd `help:"Stop replay buffer." cmd:"" aliases:"st"`
|
||||||
|
Toggle ReplayBufferToggleCmd `help:"Toggle replay buffer." cmd:"" aliases:"tg"`
|
||||||
Status ReplayBufferStatusCmd `help:"Get replay buffer status." cmd:"" aliases:"ss"`
|
Status ReplayBufferStatusCmd `help:"Get replay buffer status." cmd:"" aliases:"ss"`
|
||||||
Save ReplayBufferSaveCmd `help:"Save replay buffer." cmd:"" aliases:"sv"`
|
Save ReplayBufferSaveCmd `help:"Save replay buffer." cmd:"" aliases:"sv"`
|
||||||
}
|
}
|
||||||
@@ -18,7 +19,11 @@ type ReplayBufferStartCmd struct{} // size = 0x0
|
|||||||
// Run executes the command to start the replay buffer.
|
// Run executes the command to start the replay buffer.
|
||||||
func (cmd *ReplayBufferStartCmd) Run(ctx *context) error {
|
func (cmd *ReplayBufferStartCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.StartReplayBuffer()
|
_, err := ctx.Client.Outputs.StartReplayBuffer()
|
||||||
return err
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to start replay buffer: %w", err)
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer started.")
|
||||||
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// ReplayBufferStopCmd stops the replay buffer.
|
// ReplayBufferStopCmd stops the replay buffer.
|
||||||
@@ -27,7 +32,29 @@ type ReplayBufferStopCmd struct{} // size = 0x0
|
|||||||
// Run executes the command to stop the replay buffer.
|
// Run executes the command to stop the replay buffer.
|
||||||
func (cmd *ReplayBufferStopCmd) Run(ctx *context) error {
|
func (cmd *ReplayBufferStopCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.StopReplayBuffer()
|
_, err := ctx.Client.Outputs.StopReplayBuffer()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to stop replay buffer: %w", err)
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ReplayBufferToggleCmd toggles the replay buffer state.
|
||||||
|
type ReplayBufferToggleCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to toggle the replay buffer.
|
||||||
|
func (cmd *ReplayBufferToggleCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Outputs.ToggleReplayBuffer()
|
||||||
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if status.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer started.")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// ReplayBufferStatusCmd retrieves the status of the replay buffer.
|
// ReplayBufferStatusCmd retrieves the status of the replay buffer.
|
||||||
|
|||||||
85
replaybuffer_test.go
Normal file
85
replaybuffer_test.go
Normal file
@@ -0,0 +1,85 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestReplayBufferStart(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &ReplayBufferStartCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to start replay buffer: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Replay buffer started.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Replay buffer started', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestReplayBufferStop(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &ReplayBufferStopCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to stop replay buffer: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Replay buffer stopped.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestReplayBufferToggle(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &ReplayBufferStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get replay buffer status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if strings.Contains(out.String(), "Replay buffer is active") {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdToggle := &ReplayBufferToggleCmd{}
|
||||||
|
err = cmdToggle.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to toggle replay buffer: %v", err)
|
||||||
|
}
|
||||||
|
if active {
|
||||||
|
if out.String() != "Replay buffer stopped.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Replay buffer started.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Replay buffer started.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
9
scene.go
9
scene.go
@@ -5,6 +5,7 @@ import (
|
|||||||
"slices"
|
"slices"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/scenes"
|
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||||
|
"github.com/aquasecurity/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// SceneCmd provides commands to manage scenes in OBS Studio.
|
// SceneCmd provides commands to manage scenes in OBS Studio.
|
||||||
@@ -24,10 +25,16 @@ func (cmd *SceneListCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
t := table.New(ctx.Out)
|
||||||
|
t.SetPadding(3)
|
||||||
|
t.SetAlignment(table.AlignLeft, table.AlignLeft)
|
||||||
|
t.SetHeaders("Scene Name", "UUID")
|
||||||
|
|
||||||
slices.Reverse(scenes.Scenes)
|
slices.Reverse(scenes.Scenes)
|
||||||
for _, scene := range scenes.Scenes {
|
for _, scene := range scenes.Scenes {
|
||||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
t.AddRow(scene.SceneName, scene.SceneUuid)
|
||||||
}
|
}
|
||||||
|
t.Render()
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
58
scene_test.go
Normal file
58
scene_test.go
Normal file
@@ -0,0 +1,58 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestSceneList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &SceneListCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list scenes: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "gobs-test") {
|
||||||
|
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestSceneCurrent(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
// Set the current scene to "gobs-test"
|
||||||
|
cmdSwitch := &SceneSwitchCmd{
|
||||||
|
NewScene: "gobs-test",
|
||||||
|
}
|
||||||
|
err := cmdSwitch.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to switch to scene: %v", err)
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdCurrent := &SceneCurrentCmd{}
|
||||||
|
err = cmdCurrent.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get current scene: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "gobs-test\n" {
|
||||||
|
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -4,38 +4,44 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/config"
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
"github.com/aquasecurity/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
||||||
type SceneCollectionCmd struct {
|
type SceneCollectionCmd struct {
|
||||||
List ListSceneCollectionCmd `help:"List scene collections." cmd:"" aliases:"ls"`
|
List SceneCollectionListCmd `help:"List scene collections." cmd:"" aliases:"ls"`
|
||||||
Current CurrentSceneCollectionCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
|
Current SceneCollectionCurrentCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
|
||||||
Switch SwitchSceneCollectionCmd `help:"Switch scene collection." cmd:"" aliases:"sw"`
|
Switch SceneCollectionSwitchCmd `help:"Switch scene collection." cmd:"" aliases:"sw"`
|
||||||
Create CreateSceneCollectionCmd `help:"Create scene collection." cmd:"" aliases:"new"`
|
Create SceneCollectionCreateCmd `help:"Create scene collection." cmd:"" aliases:"new"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// ListSceneCollectionCmd provides a command to list all scene collections.
|
// SceneCollectionListCmd provides a command to list all scene collections.
|
||||||
type ListSceneCollectionCmd struct{} // size = 0x0
|
type SceneCollectionListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to list all scene collections.
|
// Run executes the command to list all scene collections.
|
||||||
func (cmd *ListSceneCollectionCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
|
||||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get scene collection list: %w", err)
|
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
for _, collection := range collections.SceneCollections {
|
t := table.New(ctx.Out)
|
||||||
fmt.Fprintln(ctx.Out, collection)
|
t.SetPadding(3)
|
||||||
}
|
t.SetAlignment(table.AlignLeft)
|
||||||
|
t.SetHeaders("Scene Collection Name")
|
||||||
|
|
||||||
|
for _, collection := range collections.SceneCollections {
|
||||||
|
t.AddRow(collection)
|
||||||
|
}
|
||||||
|
t.Render()
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CurrentSceneCollectionCmd provides a command to get the current scene collection.
|
// SceneCollectionCurrentCmd provides a command to get the current scene collection.
|
||||||
type CurrentSceneCollectionCmd struct{} // size = 0x0
|
type SceneCollectionCurrentCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to get the current scene collection.
|
// Run executes the command to get the current scene collection.
|
||||||
func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionCurrentCmd) Run(ctx *context) error {
|
||||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get scene collection list: %w", err)
|
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||||
@@ -45,13 +51,13 @@ func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// SwitchSceneCollectionCmd provides a command to switch to a different scene collection.
|
// SceneCollectionSwitchCmd provides a command to switch to a different scene collection.
|
||||||
type SwitchSceneCollectionCmd struct {
|
type SceneCollectionSwitchCmd struct {
|
||||||
Name string `arg:"" help:"Name of the scene collection to switch to." required:""`
|
Name string `arg:"" help:"Name of the scene collection to switch to." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to switch to a different scene collection.
|
// Run executes the command to switch to a different scene collection.
|
||||||
func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
|
||||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -74,13 +80,13 @@ func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateSceneCollectionCmd provides a command to create a new scene collection.
|
// SceneCollectionCreateCmd provides a command to create a new scene collection.
|
||||||
type CreateSceneCollectionCmd struct {
|
type SceneCollectionCreateCmd struct {
|
||||||
Name string `arg:"" help:"Name of the scene collection to create." required:""`
|
Name string `arg:"" help:"Name of the scene collection to create." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to create a new scene collection.
|
// Run executes the command to create a new scene collection.
|
||||||
func (cmd *CreateSceneCollectionCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionCreateCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Config.CreateSceneCollection(
|
_, err := ctx.Client.Config.CreateSceneCollection(
|
||||||
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||||
)
|
)
|
||||||
|
|||||||
207
sceneitem.go
207
sceneitem.go
@@ -2,9 +2,11 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"sort"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs"
|
"github.com/andreykaipov/goobs"
|
||||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||||
|
"github.com/aquasecurity/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// SceneItemCmd provides commands to manage scene items in OBS Studio.
|
// SceneItemCmd provides commands to manage scene items in OBS Studio.
|
||||||
@@ -14,41 +16,88 @@ type SceneItemCmd struct {
|
|||||||
Hide SceneItemHideCmd `cmd:"" help:"Hide scene item." aliases:"h"`
|
Hide SceneItemHideCmd `cmd:"" help:"Hide scene item." aliases:"h"`
|
||||||
Toggle SceneItemToggleCmd `cmd:"" help:"Toggle scene item." aliases:"tg"`
|
Toggle SceneItemToggleCmd `cmd:"" help:"Toggle scene item." aliases:"tg"`
|
||||||
Visible SceneItemVisibleCmd `cmd:"" help:"Get scene item visibility." aliases:"v"`
|
Visible SceneItemVisibleCmd `cmd:"" help:"Get scene item visibility." aliases:"v"`
|
||||||
|
Transform SceneItemTransformCmd `cmd:"" help:"Transform scene item." aliases:"t"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// SceneItemListCmd provides a command to list all scene items in a scene.
|
// SceneItemListCmd provides a command to list all scene items in a scene.
|
||||||
type SceneItemListCmd struct {
|
type SceneItemListCmd struct {
|
||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Name of the scene to list items from." default:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all scene items in a scene.
|
// Run executes the command to list all scene items in a scene.
|
||||||
func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
||||||
|
if cmd.SceneName == "" {
|
||||||
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||||
|
}
|
||||||
|
cmd.SceneName = currentScene.SceneName
|
||||||
|
}
|
||||||
|
|
||||||
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||||
WithSceneName(cmd.SceneName))
|
WithSceneName(cmd.SceneName))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get scene item list: %w", err)
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
}
|
}
|
||||||
for _, item := range resp.SceneItems {
|
|
||||||
fmt.Fprintf(ctx.Out, "Item ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
|
if len(resp.SceneItems) == 0 {
|
||||||
|
fmt.Fprintf(ctx.Out, "No scene items found in scene '%s'.\n", cmd.SceneName)
|
||||||
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
t := table.New(ctx.Out)
|
||||||
|
t.SetPadding(3)
|
||||||
|
t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter, table.AlignCenter)
|
||||||
|
t.SetHeaders("Item ID", "Item Name", "In Group", "Enabled")
|
||||||
|
|
||||||
|
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||||
|
return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
|
||||||
|
})
|
||||||
|
|
||||||
|
for _, item := range resp.SceneItems {
|
||||||
|
if item.IsGroup {
|
||||||
|
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||||
|
WithSceneName(item.SourceName))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get group scene item list for '%s': %w", item.SourceName, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||||
|
return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
|
||||||
|
})
|
||||||
|
|
||||||
|
for _, groupItem := range resp.SceneItems {
|
||||||
|
t.AddRow(
|
||||||
|
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||||
|
groupItem.SourceName,
|
||||||
|
item.SourceName,
|
||||||
|
fmt.Sprintf("%t", item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", fmt.Sprintf("%t", item.SceneItemEnabled))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
t.Render()
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// getSceneNameAndItemID retrieves the scene name and item ID for a given item in a scene or group.
|
||||||
func getSceneNameAndItemID(
|
func getSceneNameAndItemID(
|
||||||
client *goobs.Client,
|
client *goobs.Client,
|
||||||
sceneName string,
|
sceneName string,
|
||||||
itemName string,
|
itemName string,
|
||||||
parent string,
|
group string,
|
||||||
) (string, int, error) {
|
) (string, int, error) {
|
||||||
if parent != "" {
|
if group != "" {
|
||||||
resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||||
WithSceneName(parent))
|
WithSceneName(group))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return "", 0, err
|
return "", 0, err
|
||||||
}
|
}
|
||||||
for _, item := range resp.SceneItems {
|
for _, item := range resp.SceneItems {
|
||||||
if item.SourceName == itemName {
|
if item.SourceName == itemName {
|
||||||
return parent, int(item.SceneItemID), nil
|
return group, int(item.SceneItemID), nil
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
|
return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
|
||||||
@@ -65,7 +114,7 @@ func getSceneNameAndItemID(
|
|||||||
|
|
||||||
// SceneItemShowCmd provides a command to show a scene item.
|
// SceneItemShowCmd provides a command to show a scene item.
|
||||||
type SceneItemShowCmd struct {
|
type SceneItemShowCmd struct {
|
||||||
Parent string `flag:"" help:"Parent group name."`
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
ItemName string `arg:"" help:"Item name."`
|
ItemName string `arg:"" help:"Item name."`
|
||||||
@@ -73,7 +122,7 @@ type SceneItemShowCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to show a scene item.
|
// Run executes the command to show a scene item.
|
||||||
func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -85,12 +134,19 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if cmd.Group != "" {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now visible.\n", cmd.ItemName, cmd.Group)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
|
||||||
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// SceneItemHideCmd provides a command to hide a scene item.
|
// SceneItemHideCmd provides a command to hide a scene item.
|
||||||
type SceneItemHideCmd struct {
|
type SceneItemHideCmd struct {
|
||||||
Parent string `flag:"" help:"Parent group name."`
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
ItemName string `arg:"" help:"Item name."`
|
ItemName string `arg:"" help:"Item name."`
|
||||||
@@ -98,7 +154,7 @@ type SceneItemHideCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to hide a scene item.
|
// Run executes the command to hide a scene item.
|
||||||
func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -110,6 +166,13 @@ func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if cmd.Group != "" {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now hidden.\n", cmd.ItemName, cmd.Group)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
|
||||||
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -126,7 +189,7 @@ func getItemEnabled(client *goobs.Client, sceneName string, itemID int) (bool, e
|
|||||||
|
|
||||||
// SceneItemToggleCmd provides a command to toggle the visibility of a scene item.
|
// SceneItemToggleCmd provides a command to toggle the visibility of a scene item.
|
||||||
type SceneItemToggleCmd struct {
|
type SceneItemToggleCmd struct {
|
||||||
Parent string `flag:"" help:"Parent group name."`
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
ItemName string `arg:"" help:"Item name."`
|
ItemName string `arg:"" help:"Item name."`
|
||||||
@@ -134,7 +197,7 @@ type SceneItemToggleCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to toggle the visibility of a scene item.
|
// Run executes the command to toggle the visibility of a scene item.
|
||||||
func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -151,12 +214,19 @@ func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if itemEnabled {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
|
||||||
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// SceneItemVisibleCmd provides a command to check the visibility of a scene item.
|
// SceneItemVisibleCmd provides a command to check the visibility of a scene item.
|
||||||
type SceneItemVisibleCmd struct {
|
type SceneItemVisibleCmd struct {
|
||||||
Parent string `flag:"" help:"Parent group name."`
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
ItemName string `arg:"" help:"Item name."`
|
ItemName string `arg:"" help:"Item name."`
|
||||||
@@ -164,7 +234,7 @@ type SceneItemVisibleCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to check the visibility of a scene item.
|
// Run executes the command to check the visibility of a scene item.
|
||||||
func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -181,3 +251,110 @@ func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// SceneItemTransformCmd provides a command to transform a scene item.
|
||||||
|
type SceneItemTransformCmd struct {
|
||||||
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
|
ItemName string `arg:"" help:"Item name."`
|
||||||
|
|
||||||
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
|
Alignment float64 `flag:"" help:"Alignment of the scene item."`
|
||||||
|
BoundsAlignment float64 `flag:"" help:"Bounds alignment of the scene item."`
|
||||||
|
BoundsHeight float64 `flag:"" help:"Bounds height of the scene item." default:"1.0"`
|
||||||
|
BoundsType string `flag:"" help:"Bounds type of the scene item." default:"OBS_BOUNDS_NONE"`
|
||||||
|
BoundsWidth float64 `flag:"" help:"Bounds width of the scene item." default:"1.0"`
|
||||||
|
CropToBounds bool `flag:"" help:"Whether to crop the scene item to bounds."`
|
||||||
|
CropBottom float64 `flag:"" help:"Crop bottom value of the scene item."`
|
||||||
|
CropLeft float64 `flag:"" help:"Crop left value of the scene item."`
|
||||||
|
CropRight float64 `flag:"" help:"Crop right value of the scene item."`
|
||||||
|
CropTop float64 `flag:"" help:"Crop top value of the scene item."`
|
||||||
|
PositionX float64 `flag:"" help:"X position of the scene item."`
|
||||||
|
PositionY float64 `flag:"" help:"Y position of the scene item."`
|
||||||
|
Rotation float64 `flag:"" help:"Rotation of the scene item."`
|
||||||
|
ScaleX float64 `flag:"" help:"X scale of the scene item."`
|
||||||
|
ScaleY float64 `flag:"" help:"Y scale of the scene item."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to transform a scene item.
|
||||||
|
func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
||||||
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// Get the current transform of the scene item
|
||||||
|
resp, err := ctx.Client.SceneItems.GetSceneItemTransform(sceneitems.NewGetSceneItemTransformParams().
|
||||||
|
WithSceneName(sceneName).
|
||||||
|
WithSceneItemId(sceneItemID))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// Update the transform with the provided values
|
||||||
|
transform := resp.SceneItemTransform
|
||||||
|
|
||||||
|
if cmd.Alignment != 0 {
|
||||||
|
transform.Alignment = cmd.Alignment
|
||||||
|
}
|
||||||
|
if cmd.BoundsAlignment != 0 {
|
||||||
|
transform.BoundsAlignment = cmd.BoundsAlignment
|
||||||
|
}
|
||||||
|
|
||||||
|
if cmd.BoundsHeight != 0 {
|
||||||
|
transform.BoundsHeight = cmd.BoundsHeight
|
||||||
|
}
|
||||||
|
if cmd.BoundsType != "" {
|
||||||
|
transform.BoundsType = cmd.BoundsType
|
||||||
|
}
|
||||||
|
if cmd.BoundsWidth != 0 {
|
||||||
|
transform.BoundsWidth = cmd.BoundsWidth
|
||||||
|
}
|
||||||
|
|
||||||
|
if cmd.CropToBounds {
|
||||||
|
transform.CropToBounds = cmd.CropToBounds
|
||||||
|
}
|
||||||
|
if cmd.CropBottom != 0 {
|
||||||
|
transform.CropBottom = cmd.CropBottom
|
||||||
|
}
|
||||||
|
if cmd.CropLeft != 0 {
|
||||||
|
transform.CropLeft = cmd.CropLeft
|
||||||
|
}
|
||||||
|
if cmd.CropRight != 0 {
|
||||||
|
transform.CropRight = cmd.CropRight
|
||||||
|
}
|
||||||
|
if cmd.CropTop != 0 {
|
||||||
|
transform.CropTop = cmd.CropTop
|
||||||
|
}
|
||||||
|
if cmd.PositionX != 0 {
|
||||||
|
transform.PositionX = cmd.PositionX
|
||||||
|
}
|
||||||
|
if cmd.PositionY != 0 {
|
||||||
|
transform.PositionY = cmd.PositionY
|
||||||
|
}
|
||||||
|
if cmd.Rotation != 0 {
|
||||||
|
transform.Rotation = cmd.Rotation
|
||||||
|
}
|
||||||
|
if cmd.ScaleX != 0 {
|
||||||
|
transform.ScaleX = cmd.ScaleX
|
||||||
|
}
|
||||||
|
if cmd.ScaleY != 0 {
|
||||||
|
transform.ScaleY = cmd.ScaleY
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.SceneItems.SetSceneItemTransform(sceneitems.NewSetSceneItemTransformParams().
|
||||||
|
WithSceneName(sceneName).
|
||||||
|
WithSceneItemId(sceneItemID).
|
||||||
|
WithSceneItemTransform(transform))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if cmd.Group != "" {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' transformed.\n", cmd.ItemName, cmd.Group)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' transformed.\n", cmd.ItemName, cmd.SceneName)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|||||||
32
sceneitem_test.go
Normal file
32
sceneitem_test.go
Normal file
@@ -0,0 +1,32 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestSceneItemList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &SceneItemListCmd{
|
||||||
|
SceneName: "gobs-test",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list scene items: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "gobs-test-input") {
|
||||||
|
t.Fatalf("Expected output to contain 'gobs-test-input', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "gobs-test-input-2") {
|
||||||
|
t.Fatalf("Expected output to contain 'gobs-test-input-2', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
38
stream.go
38
stream.go
@@ -17,10 +17,21 @@ type StreamStartCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to start streaming.
|
// Run executes the command to start streaming.
|
||||||
func (cmd *StreamStartCmd) Run(ctx *context) error {
|
func (cmd *StreamStartCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Stream.StartStream()
|
// Check if the stream is already active
|
||||||
|
status, err := ctx.Client.Stream.GetStreamStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
if status.OutputActive {
|
||||||
|
return fmt.Errorf("stream is already in progress")
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Stream.StartStream()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Stream started successfully.")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -29,10 +40,21 @@ type StreamStopCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to stop streaming.
|
// Run executes the command to stop streaming.
|
||||||
func (cmd *StreamStopCmd) Run(ctx *context) error {
|
func (cmd *StreamStopCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Stream.StopStream()
|
// Check if the stream is already inactive
|
||||||
|
status, err := ctx.Client.Stream.GetStreamStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("stream is not in progress")
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Stream.StopStream()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -41,19 +63,15 @@ type StreamToggleCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to toggle streaming.
|
// Run executes the command to toggle streaming.
|
||||||
func (cmd *StreamToggleCmd) Run(ctx *context) error {
|
func (cmd *StreamToggleCmd) Run(ctx *context) error {
|
||||||
status, err := ctx.Client.Stream.GetStreamStatus()
|
status, err := ctx.Client.Stream.ToggleStream()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
if status.OutputActive {
|
if status.OutputActive {
|
||||||
_, err = ctx.Client.Stream.StopStream()
|
fmt.Fprintln(ctx.Out, "Stream started successfully.")
|
||||||
fmt.Fprintf(ctx.Out, "Stopping stream...\n")
|
|
||||||
} else {
|
} else {
|
||||||
_, err = ctx.Client.Stream.StartStream()
|
fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
|
||||||
fmt.Fprintf(ctx.Out, "Starting stream...\n")
|
|
||||||
}
|
|
||||||
if err != nil {
|
|
||||||
return err
|
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
132
stream_test.go
Normal file
132
stream_test.go
Normal file
@@ -0,0 +1,132 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
"time"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestStreamStart(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &StreamStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get stream status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if strings.Contains(out.String(), "Output active: true") {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStart := &StreamStartCmd{}
|
||||||
|
err = cmdStart.Run(context)
|
||||||
|
if active {
|
||||||
|
if err == nil {
|
||||||
|
t.Fatalf("Expected error when starting stream while active, got nil")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "stream is already in progress") {
|
||||||
|
t.Fatalf("Expected error message to contain 'stream is already in progress', got '%s'", err.Error())
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to start stream: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Stream started successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to contain 'Stream started successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
time.Sleep(2 * time.Second) // Wait for the stream to start
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestStreamStop(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &StreamStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get stream status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if strings.Contains(out.String(), "Output active: true") {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStop := &StreamStopCmd{}
|
||||||
|
err = cmdStop.Run(context)
|
||||||
|
if !active {
|
||||||
|
if err == nil {
|
||||||
|
t.Fatalf("Expected error when stopping stream while inactive, got nil")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "stream is not in progress") {
|
||||||
|
t.Fatalf("Expected error message to contain 'stream is not in progress', got '%s'", err.Error())
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to stop stream: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Stream stopped successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to contain 'Stream stopped successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
time.Sleep(2 * time.Second) // Wait for the stream to stop
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestStreamToggle(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &StreamStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get stream status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if strings.Contains(out.String(), "Output active: true") {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdToggle := &StreamToggleCmd{}
|
||||||
|
err = cmdToggle.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to toggle stream: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
if active {
|
||||||
|
if out.String() != "Stream stopped successfully.\n" {
|
||||||
|
t.Fatalf("Expected 'Stream stopped successfully.', got: %s", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Stream started successfully.\n" {
|
||||||
|
t.Fatalf("Expected 'Stream started successfully.', got: %s", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
time.Sleep(2 * time.Second) // Wait for the stream to toggle
|
||||||
|
}
|
||||||
@@ -23,6 +23,8 @@ func (cmd *StudioModeEnableCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to enable studio mode: %w", err)
|
return fmt.Errorf("failed to enable studio mode: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Studio mode is now enabled")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -35,6 +37,8 @@ func (cmd *StudioModeDisableCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to disable studio mode: %w", err)
|
return fmt.Errorf("failed to disable studio mode: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Studio mode is now disabled")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
68
studiomode_test.go
Normal file
68
studiomode_test.go
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestStudioModeEnable(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdEnable := &StudioModeEnableCmd{}
|
||||||
|
err := cmdEnable.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("failed to enable studio mode: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Studio mode is now enabled\n" {
|
||||||
|
t.Fatalf("expected 'Studio mode is now enabled', got: %s", out.String())
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStatus := &StudioModeStatusCmd{}
|
||||||
|
err = cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("failed to get studio mode status: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Studio mode is enabled\n" {
|
||||||
|
t.Fatalf("expected 'Studio mode is enabled', got: %s", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestStudioModeDisable(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdDisable := &StudioModeDisableCmd{}
|
||||||
|
err := cmdDisable.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("failed to disable studio mode: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Studio mode is now disabled\n" {
|
||||||
|
t.Fatalf("expected 'Studio mode is now disabled', got: %s", out.String())
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStatus := &StudioModeStatusCmd{}
|
||||||
|
err = cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("failed to get studio mode status: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Studio mode is disabled\n" {
|
||||||
|
t.Fatalf("expected 'Studio mode is disabled', got: %s", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
22
util.go
Normal file
22
util.go
Normal file
@@ -0,0 +1,22 @@
|
|||||||
|
// Package util provides utility functions for the application.
|
||||||
|
|
||||||
|
package main
|
||||||
|
|
||||||
|
import "strings"
|
||||||
|
|
||||||
|
func snakeCaseToTitleCase(snake string) string {
|
||||||
|
words := strings.Split(snake, "_")
|
||||||
|
for i, word := range words {
|
||||||
|
if len(word) > 0 {
|
||||||
|
words[i] = strings.ToUpper(word[:1]) + word[1:]
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return strings.Join(words, " ")
|
||||||
|
}
|
||||||
|
|
||||||
|
func getEnabledMark(enabled bool) string {
|
||||||
|
if enabled {
|
||||||
|
return "\u2713" // green check mark
|
||||||
|
}
|
||||||
|
return "\u274c" // red cross mark
|
||||||
|
}
|
||||||
20
util_test.go
Normal file
20
util_test.go
Normal file
@@ -0,0 +1,20 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import "testing"
|
||||||
|
|
||||||
|
func TestSnakeCaseToTitleCase(t *testing.T) {
|
||||||
|
tests := []struct {
|
||||||
|
input string
|
||||||
|
expected string
|
||||||
|
}{
|
||||||
|
{"hello_world", "Hello World"},
|
||||||
|
{"snake_case_to_title_case", "Snake Case To Title Case"},
|
||||||
|
}
|
||||||
|
|
||||||
|
for _, test := range tests {
|
||||||
|
result := snakeCaseToTitleCase(test.input)
|
||||||
|
if result != test.expected {
|
||||||
|
t.Errorf("Expected '%s' but got '%s'", test.expected, result)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
30
version_test.go
Normal file
30
version_test.go
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestVersion(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &VersionCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get version: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "OBS Client Version:") {
|
||||||
|
t.Fatalf("Expected output to contain 'OBS Client Version:', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "with Websocket Version:") {
|
||||||
|
t.Fatalf("Expected output to contain 'with Websocket Version:', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -6,17 +6,17 @@ import (
|
|||||||
|
|
||||||
// VirtualCamCmd handles the virtual camera commands.
|
// VirtualCamCmd handles the virtual camera commands.
|
||||||
type VirtualCamCmd struct {
|
type VirtualCamCmd struct {
|
||||||
Start StartVirtualCamCmd `help:"Start virtual camera." cmd:"" aliases:"s"`
|
Start VirtualCamStartCmd `help:"Start virtual camera." cmd:"" aliases:"s"`
|
||||||
Stop StopVirtualCamCmd `help:"Stop virtual camera." cmd:"" aliases:"st"`
|
Stop VirtualCamStopCmd `help:"Stop virtual camera." cmd:"" aliases:"st"`
|
||||||
Toggle ToggleVirtualCamCmd `help:"Toggle virtual camera." cmd:"" aliases:"tg"`
|
Toggle VirtualCamToggleCmd `help:"Toggle virtual camera." cmd:"" aliases:"tg"`
|
||||||
Status StatusVirtualCamCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
|
Status VirtualCamStatusCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// StartVirtualCamCmd starts the virtual camera.
|
// VirtualCamStartCmd starts the virtual camera.
|
||||||
type StartVirtualCamCmd struct{} // size = 0x0
|
type VirtualCamStartCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to start the virtual camera.
|
// Run executes the command to start the virtual camera.
|
||||||
func (c *StartVirtualCamCmd) Run(ctx *context) error {
|
func (c *VirtualCamStartCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.StartVirtualCam()
|
_, err := ctx.Client.Outputs.StartVirtualCam()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to start virtual camera: %w", err)
|
return fmt.Errorf("failed to start virtual camera: %w", err)
|
||||||
@@ -25,11 +25,11 @@ func (c *StartVirtualCamCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// StopVirtualCamCmd stops the virtual camera.
|
// VirtualCamStopCmd stops the virtual camera.
|
||||||
type StopVirtualCamCmd struct{} // size = 0x0
|
type VirtualCamStopCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to stop the virtual camera.
|
// Run executes the command to stop the virtual camera.
|
||||||
func (c *StopVirtualCamCmd) Run(ctx *context) error {
|
func (c *VirtualCamStopCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.StopVirtualCam()
|
_, err := ctx.Client.Outputs.StopVirtualCam()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to stop virtual camera: %w", err)
|
return fmt.Errorf("failed to stop virtual camera: %w", err)
|
||||||
@@ -38,23 +38,29 @@ func (c *StopVirtualCamCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// ToggleVirtualCamCmd toggles the virtual camera.
|
// VirtualCamToggleCmd toggles the virtual camera.
|
||||||
type ToggleVirtualCamCmd struct{} // size = 0x0
|
type VirtualCamToggleCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to toggle the virtual camera.
|
// Run executes the command to toggle the virtual camera.
|
||||||
func (c *ToggleVirtualCamCmd) Run(ctx *context) error {
|
func (c *VirtualCamToggleCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.ToggleVirtualCam()
|
resp, err := ctx.Client.Outputs.ToggleVirtualCam()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to toggle virtual camera: %w", err)
|
return fmt.Errorf("failed to toggle virtual camera: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if resp.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Virtual camera is now active.")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Virtual camera is now inactive.")
|
||||||
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// StatusVirtualCamCmd retrieves the status of the virtual camera.
|
// VirtualCamStatusCmd retrieves the status of the virtual camera.
|
||||||
type StatusVirtualCamCmd struct{} // size = 0x0
|
type VirtualCamStatusCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to get the status of the virtual camera.
|
// Run executes the command to get the status of the virtual camera.
|
||||||
func (c *StatusVirtualCamCmd) Run(ctx *context) error {
|
func (c *VirtualCamStatusCmd) Run(ctx *context) error {
|
||||||
status, err := ctx.Client.Outputs.GetVirtualCamStatus()
|
status, err := ctx.Client.Outputs.GetVirtualCamStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get virtual camera status: %w", err)
|
return fmt.Errorf("failed to get virtual camera status: %w", err)
|
||||||
|
|||||||
Reference in New Issue
Block a user