use red in example

move style section.

add imgs

CHANGELOG.md

@@ -5,12 +5,31 @@ All notable changes to this project will be documented in this file.
 The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
 and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
 
-# [0.12.0] - 2025-06-21
+# [0.13.3] - 2025-06-27
+
+### Changed
+
+-   usage is now printed on errors.
+-   help is printed in compact mode. This should make it easier to page through help on the root command.
+
+### Fixed
+
+-   Item ID alignment in sceneitem list table.
+
+# [0.13.0] - 2025-06-23
+
+### Added
+
+-   record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
+    -   As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
+
+# [0.12.1] - 2025-06-21
 
 ### Added
 
 -   Various colouring styles, see [Style](https://github.com/onyx-and-iris/gobs-cli/tree/main?tab=readme-ov-file#style)
     -   colouring is applied to list tables as well as highlighted information in stdout/stderr output.
+    -   table border styling may be optionally disabled with the --no-border flag.
 
 ### Changed
 

README.md

@@ -4,6 +4,16 @@ A command line interface for OBS Websocket v5
 
 For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
 
+-----
+
+## Table of Contents
+
+- [Installation](#installation)
+- [Configuration](#configuration)
+- [Style](#style)
+- [Commands](#commands)
+- [License](#license)
+
 ## Installation
 
 ```console
@@ -40,6 +50,36 @@ OBS_PASSWORD=<websocket password>
 OBS_TIMEOUT=5
 ```
 
+## Style
+
+Styling is opt-in, by default you will get a colourless output:
+
+![colourless](./img/colourless.png)
+
+You may enable styling with the --style/-s flag:
+
+```console
+gobs-cli --style="red" sceneitem list
+```
+
+Available styles: _red, magenta, purple, blue, cyan, green, yellow, orange, white, grey, navy, black_
+
+![coloured](./img/coloured-border.png)
+
+Optionally you may disable border colouring with the --no-border flag:
+
+![coloured-no-border](./img/coloured-no-border.png)
+
+```console
+gobs-cli --style="red" --no-border sceneitem list
+```
+
+Or with environment variables:
+
+```env
+GOBS_STYLE=red
+GOBS_STYLE_NO_BORDER=true
+```
 
 ## Commands
 
@@ -313,6 +353,21 @@ gobs-cli record directory "/home/me/obs-vids/"
 gobs-cli record directory "C:/Users/me/Videos"
 ```
 
+-   split: Split recording.
+
+```console
+gobs-cli record split
+```
+
+-   chapter: Create a chapter in the recording.
+
+    *optional*
+    -   arg: ChapterName
+
+```console
+gobs-cli record chapter "Chapter Name"
+```
+
 ### StreamCmd
 
 -   start: Start streaming.
@@ -606,26 +661,9 @@ gobs-cli projector open --monitor-index=1 "test_group"
 gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
 ```
 
-## Style
+## License
 
-By default styling is disabled but you may enable it with the --style/-s flag.
+`gobs-cli` is distributed under the terms of the [MIT](https://spdx.org/licenses/MIT.html) license.
-
-Available options are:
-
-- red
-- magenta
-- purple
-- blue
-- cyan
-- green
-- yellow
-- orange
-- white
-- grey
-- navy
-- black
-
-Alternatively you may set the style with an environment variable `GOBS_STYLE`.
 
 
 [userconfigdir]: https://pkg.go.dev/os#UserConfigDir

filter_test.go

@@ -11,7 +11,7 @@ func TestFilterList(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &FilterListCmd{
 		SourceName: "Mic/Aux",
@@ -30,7 +30,7 @@ func TestFilterListScene(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &FilterListCmd{
 		SourceName: "gobs-test",
@@ -49,7 +49,7 @@ func TestFilterListEmpty(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &FilterListCmd{
 		SourceName: "NonExistentSource",

group_test.go

@@ -11,7 +11,7 @@ func TestGroupList(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &GroupListCmd{
 		SceneName: "Scene",
@@ -30,7 +30,7 @@ func TestGroupShow(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &GroupShowCmd{
 		SceneName: "Scene",
@@ -50,7 +50,7 @@ func TestGroupToggle(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdStatus := &GroupStatusCmd{
 		SceneName: "Scene",
@@ -91,7 +91,7 @@ func TestGroupStatus(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdShow := &GroupShowCmd{
 		SceneName: "Scene",

input_test.go

@@ -11,7 +11,7 @@ func TestInputList(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &InputListCmd{}
 	err := cmd.Run(context)
@@ -39,7 +39,7 @@ func TestInputListFilterInput(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &InputListCmd{Input: true}
 	err := cmd.Run(context)
@@ -73,7 +73,7 @@ func TestInputListFilterOutput(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &InputListCmd{Output: true}
 	err := cmd.Run(context)
@@ -107,7 +107,7 @@ func TestInputListFilterColour(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &InputListCmd{Colour: true}
 	err := cmd.Run(context)

main.go

@@ -8,6 +8,8 @@ import (
 	"io"
 	"os"
 	"path/filepath"
+	"runtime/debug"
+	"strings"
 	"time"
 
 	"github.com/alecthomas/kong"
@@ -16,6 +18,19 @@ import (
 	kongdotenv "github.com/titusjaka/kong-dotenv-go"
 )
 
+var version string // Version of the CLI, set at build time.
+
+// VersionFlag is a custom flag type that prints the version and exits.
+type VersionFlag string
+
+func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }  // nolint: revive
+func (v VersionFlag) IsBool() bool                       { return true } // nolint: revive
+func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
+	fmt.Printf("gobs-cli version: %s\n", vars["version"])
+	app.Exit(0)
+	return nil
+}
+
 // ObsConfig holds the configuration for connecting to the OBS WebSocket server.
 type ObsConfig struct {
 	Host     string `flag:"host"     help:"Host to connect to."          default:"localhost" env:"OBS_HOST"     short:"H"`
@@ -27,10 +42,11 @@ type ObsConfig struct {
 // StyleConfig holds the configuration for styling the CLI output.
 type StyleConfig struct {
 	Style    string `help:"Style used in output."                   flag:"style"     default:""      env:"GOBS_STYLE"           short:"s" enum:",red,magenta,purple,blue,cyan,green,yellow,orange,white,grey,navy,black"`
+	NoBorder bool   `help:"Disable table border styling in output." flag:"no-border" default:"false" env:"GOBS_STYLE_NO_BORDER" short:"b"`
 }
 
 // CLI is the main command line interface structure.
-// It embeds the ObsConfig struct to inherit its fields and flags.
+// It embeds ObsConfig and StyleConfig to provide configuration options.
 type CLI struct {
 	ObsConfig   `embed:"" help:"OBS WebSocket configuration."`
 	StyleConfig `embed:"" help:"Style configuration."`
@@ -62,11 +78,11 @@ type context struct {
 	Style  *Style
 }
 
-func newContext(client *goobs.Client, out io.Writer, styleName string) *context {
+func newContext(client *goobs.Client, out io.Writer, styleCfg StyleConfig) *context {
 	return &context{
 		Client: client,
 		Out:    out,
-		Style:  styleFromFlag(styleName),
+		Style:  styleFromFlag(styleCfg),
 	}
 }
 
@@ -80,15 +96,30 @@ func main() {
 	var cli CLI
 	ctx := kong.Parse(
 		&cli,
-		kong.Name("GOBS-CLI"),
+		kong.Name("gobs-cli"),
 		kong.Description("A command line tool to interact with OBS Websocket."),
 		kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
-	)
+		kong.UsageOnError(),
+		kong.ConfigureHelp(kong.HelpOptions{
+			Compact: true,
+		}),
+		kong.Vars{
+			"version": func() string {
+				if version == "" {
+					info, ok := debug.ReadBuildInfo()
+					if !ok {
+						return "(unable to read build info)"
+					}
+					version = strings.Split(info.Main.Version, "-")[0]
+				}
+				return version
+			}(),
+		})
 
 	client, err := connectObs(cli.ObsConfig)
 	ctx.FatalIfErrorf(err)
 
-	ctx.Bind(newContext(client, os.Stdout, cli.StyleConfig.Style))
+	ctx.Bind(newContext(client, os.Stdout, cli.StyleConfig))
 
 	ctx.FatalIfErrorf(run(ctx, client))
 }

record.go

@@ -4,6 +4,7 @@ import (
 	"fmt"
 
 	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/andreykaipov/goobs/api/requests/record"
 )
 
 // RecordCmd handles the recording commands.
@@ -15,6 +16,8 @@ type RecordCmd struct {
 	Pause     RecordPauseCmd     `cmd:"" help:"Pause recording."                   aliases:"p"`
 	Resume    RecordResumeCmd    `cmd:"" help:"Resume recording."                  aliases:"r"`
 	Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory."       aliases:"d"`
+	Split     RecordSplitCmd     `cmd:"" help:"Split recording."                   aliases:"sp"`
+	Chapter   RecordChapterCmd   `cmd:"" help:"Create a chapter in the recording." aliases:"c"`
 }
 
 // RecordStartCmd starts the recording.
@@ -187,3 +190,68 @@ func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
 	fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
 	return nil
 }
+
+// RecordSplitCmd splits the current recording.
+type RecordSplitCmd struct{} // size = 0x0
+
+// Run executes the command to split the recording.
+func (cmd *RecordSplitCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot split")
+	}
+
+	_, err = ctx.Client.Record.SplitRecordFile()
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintln(ctx.Out, "Recording split successfully.")
+	return nil
+}
+
+// RecordChapterCmd creates a chapter in the recording.
+type RecordChapterCmd struct {
+	ChapterName string `arg:"" help:"Name of the chapter to create." default:""`
+}
+
+// Run executes the command to create a chapter in the recording.
+func (cmd *RecordChapterCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot create chapter")
+	}
+
+	var params *record.CreateRecordChapterParams
+	if cmd.ChapterName == "" {
+		params = record.NewCreateRecordChapterParams()
+	} else {
+		params = record.NewCreateRecordChapterParams().WithChapterName(cmd.ChapterName)
+	}
+
+	_, err = ctx.Client.Record.CreateRecordChapter(params)
+	if err != nil {
+		return err
+	}
+
+	if cmd.ChapterName == "" {
+		cmd.ChapterName = "unnamed"
+	}
+
+	fmt.Fprintf(ctx.Out, "Chapter %s created successfully.\n", ctx.Style.Highlight(cmd.ChapterName))
+	return nil
+}

record_test.go

@@ -12,7 +12,7 @@ func TestRecordStart(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdStatus := &RecordStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -52,7 +52,7 @@ func TestRecordStop(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdStatus := &RecordStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -92,7 +92,7 @@ func TestRecordToggle(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdStatus := &RecordStatusCmd{}
 	err := cmdStatus.Run(context)

replaybuffer_test.go

@@ -11,7 +11,7 @@ func TestReplayBufferStart(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &ReplayBufferStartCmd{}
 	err := cmd.Run(context)
@@ -28,7 +28,7 @@ func TestReplayBufferStop(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &ReplayBufferStopCmd{}
 	err := cmd.Run(context)
@@ -45,7 +45,7 @@ func TestReplayBufferToggle(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdStatus := &ReplayBufferStatusCmd{}
 	err := cmdStatus.Run(context)

scene_test.go

@@ -10,7 +10,7 @@ func TestSceneList(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &SceneListCmd{}
 	err := cmd.Run(context)
@@ -27,7 +27,7 @@ func TestSceneCurrent(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	// Set the current scene to "gobs-test"
 	cmdSwitch := &SceneSwitchCmd{

sceneitem.go

@@ -59,7 +59,7 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
 		style := lipgloss.NewStyle().Padding(0, 3)
 		switch col {
 		case 0:
-			style = style.Align(lipgloss.Left)
+			style = style.Align(lipgloss.Center)
 		case 1:
 			style = style.Align(lipgloss.Left)
 		case 2:

sceneitem_test.go

@@ -11,7 +11,7 @@ func TestSceneItemList(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &SceneItemListCmd{
 		SceneName: "gobs-test",

stream_test.go

@@ -12,7 +12,7 @@ func TestStreamStart(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdStatus := &StreamStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -51,7 +51,7 @@ func TestStreamStop(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdStatus := &StreamStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -90,7 +90,7 @@ func TestStreamToggle(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdStatus := &StreamStatusCmd{}
 	err := cmdStatus.Run(context)

studiomode_test.go

@@ -10,7 +10,7 @@ func TestStudioModeEnable(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdEnable := &StudioModeEnableCmd{}
 	err := cmdEnable.Run(context)
@@ -38,7 +38,7 @@ func TestStudioModeDisable(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmdDisable := &StudioModeDisableCmd{}
 	err := cmdDisable.Run(context)

style.go

@@ -26,88 +26,88 @@ func (s *Style) Error(text string) string {
 	return lipgloss.NewStyle().Foreground(lipgloss.Color("#FF0000")).Render(text) // Red for errors
 }
 
-func newRedStyle() *Style {
+func newRedStyle() Style {
-	return &Style{
+	return Style{
 		name:      "red",
 		border:    lipgloss.Color("#D32F2F"), // Strong red for border
 		oddRows:   lipgloss.Color("#FFCDD2"), // Very light red for odd rows
 		evenRows:  lipgloss.Color("#EF9A9A"), // Light red for even rows
-		highlight: lipgloss.Color("#EF9A9A"),
+		highlight: lipgloss.Color("#EF9A9A"), // Highlight in light red
 	}
 }
 
-func newMagentaStyle() *Style {
+func newMagentaStyle() Style {
-	return &Style{
+	return Style{
 		name:      "magenta",
 		border:    lipgloss.Color("#C2185B"), // Strong magenta for border
 		oddRows:   lipgloss.Color("#F8BBD0"), // Very light magenta/pink for odd rows
 		evenRows:  lipgloss.Color("#F48FB1"), // Light magenta/pink for even rows
-		highlight: lipgloss.Color("#F48FB1"),
+		highlight: lipgloss.Color("#F48FB1"), // Highlight in light magenta/pink
 	}
 }
 
-func newPurpleStyle() *Style {
+func newPurpleStyle() Style {
-	return &Style{
+	return Style{
 		name:      "purple",
 		border:    lipgloss.Color("#7B1FA2"), // Strong purple for border
 		oddRows:   lipgloss.Color("#E1BEE7"), // Very light purple for odd rows
 		evenRows:  lipgloss.Color("#CE93D8"), // Light purple for even rows
-		highlight: lipgloss.Color("#CE93D8"),
+		highlight: lipgloss.Color("#CE93D8"), // Highlight in light purple
 	}
 }
 
-func newBlueStyle() *Style {
+func newBlueStyle() Style {
-	return &Style{
+	return Style{
 		name:      "blue",
 		border:    lipgloss.Color("#1976D2"), // Medium blue for border
 		oddRows:   lipgloss.Color("#E3F2FD"), // Very light blue for odd rows
 		evenRows:  lipgloss.Color("#BBDEFB"), // Light blue for even rows
-		highlight: lipgloss.Color("#1976D2"),
+		highlight: lipgloss.Color("#1976D2"), // Highlight in medium blue
 	}
 }
 
-func newCyanStyle() *Style {
+func newCyanStyle() Style {
-	return &Style{
+	return Style{
 		name:      "cyan",
 		border:    lipgloss.Color("#00BFCF"), // A strong cyan for border
 		oddRows:   lipgloss.Color("#E0F7FA"), // Very light cyan for odd rows
 		evenRows:  lipgloss.Color("#B2EBF2"), // Slightly darker light cyan for even rows
-		highlight: lipgloss.Color("#00BFCF"),
+		highlight: lipgloss.Color("#00BFCF"), // Highlight in strong cyan
 	}
 }
 
-func newGreenStyle() *Style {
+func newGreenStyle() Style {
-	return &Style{
+	return Style{
 		name:      "green",
 		border:    lipgloss.Color("#43A047"), // Medium green for border
 		oddRows:   lipgloss.Color("#E8F5E9"), // Very light green for odd rows
 		evenRows:  lipgloss.Color("#C8E6C9"), // Light green for even rows
-		highlight: lipgloss.Color("#43A047"),
+		highlight: lipgloss.Color("#43A047"), // Highlight in medium green
 	}
 }
 
-func newYellowStyle() *Style {
+func newYellowStyle() Style {
-	return &Style{
+	return Style{
 		name:      "yellow",
 		border:    lipgloss.Color("#FBC02D"), // Strong yellow for border
 		oddRows:   lipgloss.Color("#FFF9C4"), // Very light yellow for odd rows
 		evenRows:  lipgloss.Color("#FFF59D"), // Light yellow for even rows
-		highlight: lipgloss.Color("#FBC02D"),
+		highlight: lipgloss.Color("#FBC02D"), // Highlight in strong yellow
 	}
 }
 
-func newOrangeStyle() *Style {
+func newOrangeStyle() Style {
-	return &Style{
+	return Style{
 		name:      "orange",
 		border:    lipgloss.Color("#F57C00"), // Strong orange for border
 		oddRows:   lipgloss.Color("#FFF3E0"), // Very light orange for odd rows
 		evenRows:  lipgloss.Color("#FFE0B2"), // Light orange for even rows
-		highlight: lipgloss.Color("#F57C00"),
+		highlight: lipgloss.Color("#F57C00"), // Highlight in strong orange
 	}
 }
 
-func newWhiteStyle() *Style {
+func newWhiteStyle() Style {
-	return &Style{
+	return Style{
 		name:      "white",
 		border:    lipgloss.Color("#FFFFFF"), // White for border
 		oddRows:   lipgloss.Color("#F0F0F0"), // Very light grey for odd rows
@@ -116,8 +116,8 @@ func newWhiteStyle() *Style {
 	}
 }
 
-func newGreyStyle() *Style {
+func newGreyStyle() Style {
-	return &Style{
+	return Style{
 		name:      "grey",
 		border:    lipgloss.Color("#9E9E9E"), // Medium grey for border
 		oddRows:   lipgloss.Color("#F5F5F5"), // Very light grey for odd rows
@@ -126,8 +126,8 @@ func newGreyStyle() *Style {
 	}
 }
 
-func newNavyBlueStyle() *Style {
+func newNavyBlueStyle() Style {
-	return &Style{
+	return Style{
 		name:      "navy",
 		border:    lipgloss.Color("#001F3F"), // Navy blue for border
 		oddRows:   lipgloss.Color("#CFE2F3"), // Very light blue for odd rows
@@ -136,8 +136,8 @@ func newNavyBlueStyle() *Style {
 	}
 }
 
-func newBlackStyle() *Style {
+func newBlackStyle() Style {
-	return &Style{
+	return Style{
 		name:      "black",
 		border:    lipgloss.Color("#000000"), // Black for border
 		oddRows:   lipgloss.Color("#333333"), // Dark grey for odd rows
@@ -146,32 +146,34 @@ func newBlackStyle() *Style {
 	}
 }
 
-func styleFromFlag(colour string) *Style {
+func styleFromFlag(cfg StyleConfig) *Style {
-	switch colour {
+	var style Style
+
+	switch cfg.Style {
 	case "red":
-		return newRedStyle()
+		style = newRedStyle()
 	case "magenta":
-		return newMagentaStyle()
+		style = newMagentaStyle()
 	case "purple":
-		return newPurpleStyle()
+		style = newPurpleStyle()
 	case "blue":
-		return newBlueStyle()
+		style = newBlueStyle()
 	case "cyan":
-		return newCyanStyle()
+		style = newCyanStyle()
 	case "green":
-		return newGreenStyle()
+		style = newGreenStyle()
 	case "yellow":
-		return newYellowStyle()
+		style = newYellowStyle()
 	case "orange":
-		return newOrangeStyle()
+		style = newOrangeStyle()
 	case "white":
-		return newWhiteStyle()
+		style = newWhiteStyle()
 	case "grey":
-		return newGreyStyle()
+		style = newGreyStyle()
 	case "navy":
-		return newNavyBlueStyle()
+		style = newNavyBlueStyle()
 	case "black":
-		return newBlackStyle()
+		style = newBlackStyle()
 	default:
 		err := os.Setenv("NO_COLOR", "1") // nolint: misspell
 		if err != nil {
@@ -179,6 +181,12 @@ func styleFromFlag(colour string) *Style {
 			// This is a fallback to ensure that the application can still run
 			fmt.Fprintf(os.Stderr, "Error setting NO_COLOR: %v\n", err)
 		}
-		return &Style{}
 	}
+
+	// If noBorder is true, we disable the border styling
+	if cfg.NoBorder {
+		style.border = ""
+	}
+
+	return &style
 }

version.go

@@ -2,38 +2,8 @@ package main
 
 import (
 	"fmt"
-	"runtime/debug"
-	"strings"
-
-	"github.com/alecthomas/kong"
 )
 
-var version string
-
-// VersionFlag is a custom flag type for displaying version information.
-type VersionFlag string
-
-// Decode implements the kong.Flag interface.
-func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }
-
-// IsBool implements the kong.Flag interface.
-func (v VersionFlag) IsBool() bool { return true }
-
-// BeforeApply implements the kong.Flag interface.
-func (v VersionFlag) BeforeApply(app *kong.Kong, _ kong.Vars) error { // nolint: unparam
-	if version == "" {
-		info, ok := debug.ReadBuildInfo()
-		if !ok {
-			return fmt.Errorf("failed to read build info")
-		}
-		version = strings.Split(info.Main.Version, "-")[0]
-	}
-
-	fmt.Printf("gobs-cli version: %s\n", version)
-	app.Exit(0) // Exit the application after printing the version
-	return nil
-}
-
 // ObsVersionCmd handles the version command.
 type ObsVersionCmd struct{} // size = 0x0
 

version_test.go

@@ -11,7 +11,7 @@ func TestVersion(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := newContext(client, &out, "")
+	context := newContext(client, &out, StyleConfig{})
 
 	cmd := &ObsVersionCmd{}
 	err := cmd.Run(context)