mirror of
https://github.com/onyx-and-iris/gobs-cli.git
synced 2026-04-02 07:19:19 +00:00
95 lines
3.3 KiB
Go
95 lines
3.3 KiB
Go
// Package main provides a command-line interface (CLI) tool for interacting with OBS WebSocket.
|
|
// It allows users to manage various aspects of OBS, such as scenes, inputs, recording, streaming,
|
|
// and more, by leveraging the goobs library for communication with the OBS WebSocket server.
|
|
package main
|
|
|
|
import (
|
|
"fmt"
|
|
"io"
|
|
"os"
|
|
"time"
|
|
|
|
"github.com/alecthomas/kong"
|
|
"github.com/andreykaipov/goobs"
|
|
)
|
|
|
|
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
|
type ObsConfig struct {
|
|
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST"`
|
|
Port int `flag:"port" help:"Port to connect to." default:"4455" env:"OBS_PORT"`
|
|
Password string `flag:"password" help:"Password for authentication." default:"" env:"OBS_PASSWORD"`
|
|
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT"`
|
|
}
|
|
|
|
// cli is the main command line interface structure.
|
|
// It embeds the ObsConfig struct to inherit its fields and flags.
|
|
type cli struct {
|
|
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
|
|
|
Version VersionCmd `help:"Show version." cmd:"" aliases:"v"`
|
|
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
|
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
|
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g"`
|
|
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i"`
|
|
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec"`
|
|
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st"`
|
|
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn"`
|
|
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p"`
|
|
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
|
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
|
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
|
}
|
|
|
|
type context struct {
|
|
Client *goobs.Client
|
|
Out io.Writer
|
|
}
|
|
|
|
func main() {
|
|
var client *goobs.Client
|
|
cli := cli{}
|
|
ctx := kong.Parse(
|
|
&cli,
|
|
kong.Name("GOBS-CLI"),
|
|
kong.Description("A command line tool to interact with OBS Websocket."),
|
|
)
|
|
|
|
client, err := connectObs(cli.ObsConfig)
|
|
if err != nil {
|
|
ctx.FatalIfErrorf(err)
|
|
}
|
|
|
|
ctx.Bind(&context{
|
|
Client: client,
|
|
Out: os.Stdout,
|
|
})
|
|
|
|
ctx.FatalIfErrorf(run(ctx, client))
|
|
}
|
|
|
|
// connectObs creates a new OBS client and connects to the OBS WebSocket server.
|
|
func connectObs(cfg ObsConfig) (*goobs.Client, error) {
|
|
client, err := goobs.New(
|
|
fmt.Sprintf("%s:%d", cfg.Host, cfg.Port),
|
|
goobs.WithPassword(cfg.Password),
|
|
goobs.WithResponseTimeout(time.Duration(cfg.Timeout)*time.Second),
|
|
)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
return client, nil
|
|
}
|
|
|
|
// run executes the command line interface.
|
|
// It disconnects the OBS client after the command is executed.
|
|
func run(ctx *kong.Context, client *goobs.Client) error {
|
|
defer func() error {
|
|
if err := client.Disconnect(); err != nil {
|
|
return fmt.Errorf("failed to disconnect from OBS: %w", err)
|
|
}
|
|
return nil
|
|
}()
|
|
|
|
return ctx.Run()
|
|
}
|