use red in example

add 0.13.3 to CHANGELOG
add style to ToC
2025-07-03 00:40:29 +01:00 · 2025-06-27 13:53:55 +01:00 · 2025-06-27 13:51:42 +01:00 · 2025-06-27 13:49:34 +01:00 · 2025-06-27 13:48:17 +01:00 · 2025-06-27 13:38:51 +01:00
43 changed files with 3161 additions and 225 deletions
--- a/.gitignore
+++ b/.gitignore
@ -26,5 +26,12 @@ go.work

 # End of gignore: github.com/onyx-and-iris/gignore

+# Environment
+.env
 .envrc
-*_test.go
+
+# Man pages
+gobs-cli.1
+
+# Config files
+config.yaml
--- a/.golangci.yml
+++ b/.golangci.yml
@ -50,3 +50,6 @@ issues:
  exclude:
    # gosec: Duplicated errcheck checks
    - G104
+  exclude-files:
+    # Exclude vendor directory
+    - main_test.go
--- a/CHANGELOG.md
+++ b/CHANGELOG.md
@ -5,6 +5,151 @@ All notable changes to this project will be documented in this file.
 The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
 and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).

+# [0.13.3] - 2025-06-27
+
+### Changed
+
+-   usage is now printed on errors.
+-   help is printed in compact mode. This should make it easier to page through help on the root command.
+
+### Fixed
+
+-   Item ID alignment in sceneitem list table.
+
+# [0.13.0] - 2025-06-23
+
+### Added
+
+-   record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
+    -   As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
+
+# [0.12.1] - 2025-06-21
+
+### Added
+
+-   Various colouring styles, see [Style](https://github.com/onyx-and-iris/gobs-cli/tree/main?tab=readme-ov-file#style)
+    -   colouring is applied to list tables as well as highlighted information in stdout/stderr output.
+    -   table border styling may be optionally disabled with the --no-border flag.
+
+### Changed
+
+-   if an itemName is passed to a sceneitem command that's in a group, without the --group flag, a friendlier error message is displayed.
+    -   it will suggest using *gobs-cli si ls* to list sources in the scene.
+-   if an invalid --monitor-index is passed to projector open a friendlier error message is displayed.
+    -   it will suggest using *gobs-cli prj ls-m* to list available monitors.
+
+
+# [0.11.0] - 2025-06-20
+
+### Added
+
+-   input list, scene list and sceneitem list now accept --uuid flag.
+-   Active column added to scene list table.
+
+### Changed
+
+-   scene list no longer prints the UUIDs by default, enable it with the --uuid flag.
+
+# [0.10.3] - 2025-06-07
+
+### Added
+
+-   filter list:
+    -   --ffmpeg, --vlc flags
+    -   Muted column to list table
+
+# [0.10.2] - 2025-06-04
+
+### Added
+
+-   screenshot save command, see [ScreenshotCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#screenshotcmd)
+
+### Fixed
+
+-   filter list:
+    -   sourceName arg now defaults to current scene. 
+    -   defaults are printed for any unmodified values.
+-   sceneitem list:
+    -   prints enabled mark instead of true/false
+
+# [0.9.0] - 2025-06-02
+
+### Added
+
+-   --version/-v option. See [Flags](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#flags)
+
+### Changed
+
+-   version command renamed to obs-version
+
+# [0.8.2] - 2025-05-29
+
+### Added
+
+-   record start/stop and stream start/stop commands check outputActive states first. 
+    -   Errors are returned if the command cannot be performed.
+
+### Changed
+
+-   The --parent flag for the sceneitem commands has been renamed to --group, see [SceneItemCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#sceneitemcmd)
+
+# [0.8.0] - 2025-05-27
+
+### Added
+
+-   record directory command, see [directory under RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
+
+### Changed
+
+-   record stop now prints the output path of the recording.
+
+
+# [0.7.0] - 2025-05-26
+
+### Added
+
+-   projector commands, see [ProjectorCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#projectorcmd)
+
+
+# [0.6.1] - 2025-05-25
+
+### Added
+
+-   filter commands, see [FilterCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#filtercmd)
+
+### Changed
+
+-   list commands are now printed as tables.
+    - This affects group, hotkey, input, profile, scene, scenecollection and sceneitem command groups.
+
+# [0.5.0] - 2025-05-22
+
+### Added
+
+-   hotkey commands, see [HotkeyCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#hotkeycmd)
+
+# [0.4.2] - 2025-05-08
+
+### Added
+
+-   replaybuffer toggle command
+-   studiomode enable/disable now print output to console
+-   stream start/stop now print output to console
+-   Unit tests
+
+# [0.3.1] - 2025-05-02
+
+### Added
+
+-   --man flag for generating/viewing a man page.
+-   Ability to load env vars from env files, see the [README](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#environment-variables)
+
+# [0.2.0] - 2025-04-27
+
+### Added
+
+-   sceneitem transform, see *transform* under [SceneItemCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#sceneitemcmd)
+
 # [0.1.0] - 2025-04-24

 ### Added
--- a/21
+++ b/21
@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2025 Onyx and Iris
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
--- a/README.md
+++ b/README.md
@ -4,40 +4,100 @@ A command line interface for OBS Websocket v5

 For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)

+-----
+
+## Table of Contents
+
+- [Installation](#installation)
+- [Configuration](#configuration)
+- [Style](#style)
+- [Commands](#commands)
+- [License](#license)
+
+## Installation
+
+```console
+go install github.com/onyx-and-iris/gobs-cli@latest
+```
+
 ## Configuration

 #### Flags

-Pass `--host`, `--port` and `--password` as flags to the root command, for example:
+-   --host/-H: Websocket host
+-   --port/-P Websocket port
+-   --password/-p: Websocket password
+-   --timeout/-T: Websocket timeout
+-   --version/-v: Print the gobs-cli version
+
+Pass `--host`, `--port` and `--password` as flags on the root command, for example:

 ```console
-gobs-cli --host=localhost --port=4455 --password=<websocket password> --help
+gobs-cli --host localhost --port 4455 --password 'websocket password' --help
 ```

 #### Environment Variables

-Load connection details from your environment:
+Store and load environment variables from:

-```bash
-#!/usr/bin/env bash
+-   A `.env` file in the cwd
+-   $XDG_CONFIG_HOME / gobs-cli / config.env (see [os.UserConfigDir][userconfigdir])

-export OBS_HOST=localhost
-export OBS_PORT=4455
-export OBS_PASSWORD=<websocket password>
-export OBS_TIMEOUT=5
+```env
+OBS_HOST=localhost
+OBS_PORT=4455
+OBS_PASSWORD=<websocket password>
+OBS_TIMEOUT=5
+```
+
+## Style
+
+Styling is opt-in, by default you will get a colourless output:
+
+![colourless](./img/colourless.png)
+
+You may enable styling with the --style/-s flag:
+
+```console
+gobs-cli --style="red" sceneitem list
+```
+
+Available styles: _red, magenta, purple, blue, cyan, green, yellow, orange, white, grey, navy, black_
+
+![coloured](./img/coloured-border.png)
+
+Optionally you may disable border colouring with the --no-border flag:
+
+![coloured-no-border](./img/coloured-no-border.png)
+
+```console
+gobs-cli --style="red" --no-border sceneitem list
+```
+
+Or with environment variables:
+
+```env
+GOBS_STYLE=red
+GOBS_STYLE_NO_BORDER=true
 ```

 ## Commands

-### VersionCmd
+### ObsVersionCmd
+
+-   Print OBS client and websocket version.

 ```console
-gobs-cli version
+gobs-cli obs-version
 ```

 ### SceneCmd

 -   list: List all scenes.
+    -   flags:
+
+        *optional*
+        -   --UUID: Display UUIDs of scenes.

 ```console
 gobs-cli scene list
@ -71,9 +131,18 @@ gobs-cli scene switch --preview LIVE
 ### SceneItemCmd

 -   list: List all scene items.
+    -   flags:
+
+        *optional*
+        -   --UUID: Display UUIDs of scene items.
+
+    *optional*
    -   args: SceneName
+        -   defaults to current scene

 ```console
+gobs-cli sceneitem list
+
 gobs-cli sceneitem list LIVE
 ```

@ -81,7 +150,7 @@ gobs-cli sceneitem list LIVE
    -   flags:

        *optional*
-        -   --parent: Parent group name.
+        -   --group: Parent group name.
    -   args: SceneName ItemName

 ```console
@ -92,7 +161,7 @@ gobs-cli sceneitem show START "Colour Source"
    -   flags:

        *optional*
-        -   --parent: Parent group name.
+        -   --group: Parent group name.
    -   args: SceneName ItemName

 ```console
@ -103,30 +172,65 @@ gobs-cli sceneitem hide START "Colour Source"
    -   flags:

        *optional*
-        -   --parent: Parent group name.
+        -   --group: Parent group name.
    -   args: SceneName ItemName

 ```console
-gobs-cli sceneitem toggle --parent=test_group START "Colour Source 3"
+gobs-cli sceneitem toggle --group=test_group START "Colour Source 3"
 ```

 -   visible: Get scene item visibility.
    -   flags:

        *optional*
-        -   --parent: Parent group name.
+        -   --group: Parent group name.
    -   args: SceneName ItemName

 ```console
-gobs-cli sceneitem visible --parent=test_group START "Colour Source 4"
+gobs-cli sceneitem visible --group=test_group START "Colour Source 4"
+```
+
+-   transform: Transform scene item.
+    -   flags:
+        
+        *optional*
+        -   --group: Parent group name.
+
+        -   --alignment: Alignment of the scene item.
+        -   --bounds-alignment: Bounds alignment of the scene item.
+        -   --bounds-height: Bounds height of the scene item.
+        -   --bounds-type: Bounds type of the scene item.
+        -   --bounds-width: Bounds width of the scene item.
+        -   --crop-to-bounds: Whether to crop the scene item to bounds.
+        -   --crop-bottom: Crop bottom value of the scene item.
+        -   --crop-left: Crop left value of the scene item.
+        -   --crop-right: Crop right value of the scene item.
+        -   --crop-top: Crop top value of the scene item.
+        -   --position-x: X position of the scene item.
+        -   --position-y: Y position of the scene item.
+        -   --rotation: Rotation of the scene item.
+        -   --scale-x: X scale of the scene item.
+        -   --scale-y: Y scale of the scene item.
+    -   args: SceneName ItemName
+
+```console
+gobs-cli sceneitem transform \
+    --rotation=5 \
+    --position-x=250.8 \
+    Scene "Colour Source 3"
 ```

 ### GroupCmd

 -   list: List all groups.
+
+    *optional*
    -   args: SceneName
+        -   defaults to current scene

 ```console
+gobs-cli group list
+
 gobs-cli group list START
 ```

@ -167,6 +271,9 @@ gobs-cli group status START "test_group"
        -   --input: List all inputs.
        -   --output: List all outputs.
        -   --colour: List all colour sources.
+        -   --ffmpeg: List all ffmpeg sources.
+        -   --vlc: List all VLC sources.
+        -   --uuid: Display UUIDs of inputs.

 ```console
 gobs-cli input list
@ -233,6 +340,34 @@ gobs-cli record pause
 gobs-cli record resume
 ```

+-   directory: Get/Set recording directory.
+
+    *optional*
+    -   args: RecordDirectory
+        -   if not passed the current record directory will be printed.
+
+```console
+gobs-cli record directory
+
+gobs-cli record directory "/home/me/obs-vids/"
+gobs-cli record directory "C:/Users/me/Videos"
+```
+
+-   split: Split recording.
+
+```console
+gobs-cli record split
+```
+
+-   chapter: Create a chapter in the recording.
+
+    *optional*
+    -   arg: ChapterName
+
+```console
+gobs-cli record chapter "Chapter Name"
+```
+
 ### StreamCmd

 -   start: Start streaming.
@ -273,7 +408,7 @@ gobs-cli scenecollection list
 gobs-cli scenecollection current
 ```

-   switch: "Switch scene collection.
+-   switch: Switch scene collection.
    -   args: Name

 ```console
@ -305,21 +440,21 @@ gobs-cli profile current
    -   args: Name

 ```console
-gobs-cli profile switch test-collection
+gobs-cli profile switch test-profile
 ```

 -   create: Create profile.
    -   args: Name

 ```console
-gobs-cli profile create test-collection
+gobs-cli profile create test-profile
 ```

 -   remove: Remove profile.
    -   args: Name

 ```console
-gobs-cli profile create test-collection
+gobs-cli profile remove test-profile
 ```

 ### ReplayBufferCmd
@ -336,6 +471,12 @@ gobs-cli replaybuffer start
 gobs-cli replaybuffer stop
 ```

+-   toggle: Toggle replay buffer.
+
+```console
+gobs-cli replaybuffer toggle
+```
+
 -   status: Get replay buffer status.

 ```console
@ -399,3 +540,132 @@ gobs-cli virtualcam toggle
 ```console
 gobs-cli virtualcam status
 ```
+
+### HotkeyCmd
+
+-   list: List all hotkeys.
+
+```console
+gobs-cli hotkey list
+```
+
+-   trigger: Trigger a hotkey by name.
+
+```console
+gobs-cli hotkey trigger OBSBasic.StartStreaming
+
+gobs-cli hotkey trigger OBSBasic.StopStreaming
+```
+
+-   trigger-sequence: Trigger a hotkey by sequence.
+    -   flags:
+
+        *optional*
+        -   --shift: Press shift.
+        -   --ctrl: Press control.
+        -   --alt: Press alt.
+        -   --cmd: Press command (mac).
+
+    -   args: keyID
+        -   Check [obs-hotkeys.h][obs-keyids] for a full list of OBS key ids.
+
+```console
+gobs-cli hotkey trigger-sequence OBS_KEY_F1 --ctrl
+
+gobs-cli hotkey trigger-sequence OBS_KEY_F1 --shift --ctrl
+```
+
+### FilterCmd
+
+-   list: List all filters.
+
+    *optional*
+    -   args: SourceName
+        -   defaults to current scene
+
+```console
+gobs-cli filter list
+```
+
+-   enable: Enable filter.
+    -   args: SourceName FilterName
+
+```console
+gobs-cli enable 'Mic/Aux' 'Gain'
+```
+
+-   disable: Disable filter.
+    -   args: SourceName FilterName
+
+```console
+gobs-cli disable 'Mic/Aux' 'Gain'
+```
+
+-   toggle: Toggle filter.
+    -   args: SourceName FilterName
+
+```console
+gobs-cli toggle 'Mic/Aux' 'Gain'
+```
+
+-   status: Get filter status.
+    -   args: SourceName FilterName
+
+```console
+gobs-cli status 'Mic/Aux' 'Gain'
+```
+
+### ProjectorCmd
+
+-   list-monitors: List available monitors.
+
+```console
+gobs-cli projector list-monitors
+```
+
+-   open: Open a fullscreen projector for a source on a specific monitor.
+    -   flags:
+
+        *optional*
+        -   --monitor-index: Index of the monitor to open the projector on.
+            -   defaults to 0
+
+    *optional*
+    -   args: SourceName
+        -   defaults to current scene
+
+```console
+gobs-cli projector open
+
+gobs-cli projector open --monitor-index=1 "test_scene"
+
+gobs-cli projector open --monitor-index=1 "test_group"
+```
+
+### ScreenshotCmd
+
+-   save: Take a screenshot and save it to a file.
+    -   flags:
+
+        *optional*
+        -   --width:
+            -   defaults to 1920
+        -   --height:
+            -   defaults to 1080
+        -   --quality:
+            -   defaults to -1
+
+    -   args: SourceName FilePath
+
+```console
+gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
+```
+
+## License
+
+`gobs-cli` is distributed under the terms of the [MIT](https://spdx.org/licenses/MIT.html) license.
+
+
+[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
+[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
+[no-colour]: https://no-color.org/
--- a/Taskfile.man.yaml
+++ b/Taskfile.man.yaml
@ -0,0 +1,17 @@
+version: '3'
+
+tasks:
+  default:
+    desc: View man page
+    cmds:
+      - task: view
+
+  view:
+    desc: View man page
+    cmds:
+      - go run . --man | man -l -
+
+  generate:
+    desc: Generate man page
+    cmds:
+      - go run . --man > {{.PROGRAM}}.1
--- a/Taskfile.yaml
+++ b/Taskfile.yaml
@ -1,9 +1,14 @@
 version: '3'

+includes:
+  man: Taskfile.man.yaml
+
 vars:
  PROGRAM: gobs-cli
  SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
  BIN_DIR: bin
+  VERSION:
+    sh: 'git describe --tags $(git rev-list --tags --max-count=1)'

 tasks:
  default:
@ -32,13 +37,13 @@ tasks:
  build-windows:
    desc: Build the gobs-cli project for Windows
    cmds:
-      - GOOS=windows GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
+      - GOOS=windows GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
    internal: true

  build-linux:
    desc: Build the gobs-cli project for Linux
    cmds:
-      - GOOS=linux GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
+      - GOOS=linux GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
    internal: true

  test:
--- a/filter.go
+++ b/filter.go
@ -0,0 +1,218 @@
+package main
+
+import (
+	"fmt"
+	"maps"
+	"sort"
+	"strings"
+
+	"github.com/andreykaipov/goobs/api/requests/filters"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
+)
+
+// FilterCmd provides commands to manage filters in OBS Studio.
+type FilterCmd struct {
+	List    FilterListCmd    `cmd:"" help:"List all filters."  aliases:"ls"`
+	Enable  FilterEnableCmd  `cmd:"" help:"Enable filter."     aliases:"on"`
+	Disable FilterDisableCmd `cmd:"" help:"Disable filter."    aliases:"off"`
+	Toggle  FilterToggleCmd  `cmd:"" help:"Toggle filter."     aliases:"tg"`
+	Status  FilterStatusCmd  `cmd:"" help:"Get filter status." aliases:"ss"`
+}
+
+// FilterListCmd provides a command to list all filters in a scene.
+type FilterListCmd struct {
+	SourceName string `arg:"" help:"Name of the source to list filters from." default:""`
+}
+
+// Run executes the command to list all filters in a scene.
+// nolint: misspell
+func (cmd *FilterListCmd) Run(ctx *context) error {
+	if cmd.SourceName == "" {
+		currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+		if err != nil {
+			return fmt.Errorf("failed to get current program scene: %w", err)
+		}
+		cmd.SourceName = currentScene.SceneName
+	}
+
+	sourceFilters, err := ctx.Client.Filters.GetSourceFilterList(
+		filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
+	)
+	if err != nil {
+		return err
+	}
+
+	if len(sourceFilters.Filters) == 0 {
+		fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", ctx.Style.Highlight(cmd.SourceName))
+		return nil
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+		Headers("Filter Name", "Kind", "Enabled", "Settings").
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Left)
+			case 1:
+				style = style.Align(lipgloss.Left)
+			case 2:
+				style = style.Align(lipgloss.Center)
+			case 3:
+				style = style.Align(lipgloss.Left)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+	for _, filter := range sourceFilters.Filters {
+		defaultSettings, err := ctx.Client.Filters.GetSourceFilterDefaultSettings(
+			filters.NewGetSourceFilterDefaultSettingsParams().
+				WithFilterKind(filter.FilterKind),
+		)
+		if err != nil {
+			return fmt.Errorf("failed to get default settings for filter %s: %w",
+				ctx.Style.Error(filter.FilterName), err)
+		}
+		maps.Insert(defaultSettings.DefaultFilterSettings, maps.All(filter.FilterSettings))
+
+		var lines []string
+		for k, v := range defaultSettings.DefaultFilterSettings {
+			lines = append(lines, fmt.Sprintf("%s: %v", snakeCaseToTitleCase(k), v))
+		}
+		sort.Slice(lines, func(i, j int) bool {
+			return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
+		})
+
+		t.Row(
+			filter.FilterName,
+			snakeCaseToTitleCase(filter.FilterKind),
+			getEnabledMark(filter.FilterEnabled),
+			strings.Join(lines, "\n"),
+		)
+	}
+	fmt.Fprintln(ctx.Out, t.Render())
+	return nil
+}
+
+// FilterEnableCmd provides a command to enable a filter in a scene.
+type FilterEnableCmd struct {
+	SourceName string `arg:"" help:"Name of the source to enable filter from."`
+	FilterName string `arg:"" help:"Name of the filter to enable."`
+}
+
+// Run executes the command to enable a filter in a scene.
+func (cmd *FilterEnableCmd) Run(ctx *context) error {
+	_, err := ctx.Client.Filters.SetSourceFilterEnabled(
+		filters.NewSetSourceFilterEnabledParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName).
+			WithFilterEnabled(true),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to enable filter %s on source %s: %w",
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
+	}
+	fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
+		ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
+	return nil
+}
+
+// FilterDisableCmd provides a command to disable a filter in a scene.
+type FilterDisableCmd struct {
+	SourceName string `arg:"" help:"Name of the source to disable filter from."`
+	FilterName string `arg:"" help:"Name of the filter to disable."`
+}
+
+// Run executes the command to disable a filter in a scene.
+func (cmd *FilterDisableCmd) Run(ctx *context) error {
+	_, err := ctx.Client.Filters.SetSourceFilterEnabled(
+		filters.NewSetSourceFilterEnabledParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName).
+			WithFilterEnabled(false),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to disable filter %s on source %s: %w",
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
+	}
+	fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
+		ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
+	return nil
+}
+
+// FilterToggleCmd provides a command to toggle a filter in a scene.
+type FilterToggleCmd struct {
+	SourceName string `arg:"" help:"Name of the source to toggle filter from."`
+	FilterName string `arg:"" help:"Name of the filter to toggle."`
+}
+
+// Run executes the command to toggle a filter in a scene.
+func (cmd *FilterToggleCmd) Run(ctx *context) error {
+	filter, err := ctx.Client.Filters.GetSourceFilter(
+		filters.NewGetSourceFilterParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get filter %s on source %s: %w",
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
+	}
+
+	newStatus := !filter.FilterEnabled
+	_, err = ctx.Client.Filters.SetSourceFilterEnabled(
+		filters.NewSetSourceFilterEnabledParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName).
+			WithFilterEnabled(newStatus),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to toggle filter %s on source %s: %w",
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
+	}
+
+	if newStatus {
+		fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
+			ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
+	} else {
+		fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
+			ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
+	}
+	return nil
+}
+
+// FilterStatusCmd provides a command to get the status of a filter in a scene.
+type FilterStatusCmd struct {
+	SourceName string `arg:"" help:"Name of the source to get filter status from."`
+	FilterName string `arg:"" help:"Name of the filter to get status."`
+}
+
+// Run executes the command to get the status of a filter in a scene.
+func (cmd *FilterStatusCmd) Run(ctx *context) error {
+	filter, err := ctx.Client.Filters.GetSourceFilter(
+		filters.NewGetSourceFilterParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get status of filter %s on source %s: %w",
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
+	}
+	if filter.FilterEnabled {
+		fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
+			ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
+	} else {
+		fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
+			ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
+	}
+	return nil
+}
--- a/filter_test.go
+++ b/filter_test.go
@ -0,0 +1,67 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestFilterList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &FilterListCmd{
+		SourceName: "Mic/Aux",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list filters: %v", err)
+	}
+	if !strings.Contains(out.String(), "test_filter") {
+		t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
+	}
+}
+
+func TestFilterListScene(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &FilterListCmd{
+		SourceName: "gobs-test",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list filters in scene: %v", err)
+	}
+	if !strings.Contains(out.String(), "test_filter") {
+		t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
+	}
+}
+
+func TestFilterListEmpty(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &FilterListCmd{
+		SourceName: "NonExistentSource",
+	}
+	err := cmd.Run(context)
+	if err == nil {
+		t.Fatal("Expected error for non-existent source, but got none")
+	}
+	if !strings.Contains(err.Error(), "No source was found by the name of `NonExistentSource`.") {
+		t.Fatalf(
+			"Expected error to contain 'No source was found by the name of `NonExistentSource`.', got '%s'",
+			err.Error(),
+		)
+	}
+}
--- a/go.mod
+++ b/go.mod
@ -4,14 +4,32 @@ go 1.24.0

 require (
 	github.com/alecthomas/kong v1.10.0
+	github.com/alecthomas/mango-kong v0.1.0
 	github.com/andreykaipov/goobs v1.5.6
+	github.com/charmbracelet/lipgloss v1.1.0
+	github.com/titusjaka/kong-dotenv-go v0.1.0
 )

 require (
+	github.com/aymanbagabas/go-osc52/v2 v2.0.1 // indirect
 	github.com/buger/jsonparser v1.1.1 // indirect
+	github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc // indirect
+	github.com/charmbracelet/x/ansi v0.8.0 // indirect
+	github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd // indirect
+	github.com/charmbracelet/x/term v0.2.1 // indirect
 	github.com/gorilla/websocket v1.5.3 // indirect
 	github.com/hashicorp/logutils v1.0.0 // indirect
+	github.com/joho/godotenv v1.5.1 // indirect
+	github.com/lucasb-eyer/go-colorful v1.2.0 // indirect
+	github.com/mattn/go-isatty v0.0.20 // indirect
+	github.com/mattn/go-runewidth v0.0.16 // indirect
 	github.com/mitchellh/mapstructure v1.5.0 // indirect
 	github.com/mmcloughlin/profile v0.1.1 // indirect
+	github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
+	github.com/muesli/roff v0.1.0 // indirect
+	github.com/muesli/termenv v0.16.0 // indirect
 	github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
+	github.com/rivo/uniseg v0.4.7 // indirect
+	github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e // indirect
+	golang.org/x/sys v0.30.0 // indirect
 )
--- a/go.sum
+++ b/go.sum
@ -2,12 +2,30 @@ github.com/alecthomas/assert/v2 v2.11.0 h1:2Q9r3ki8+JYXvGsDyBXwH3LcJ+WK5D0gc5E8v
 github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
 github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
 github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
+github.com/alecthomas/mango-kong v0.1.0 h1:iFVfP1k1K4qpml3JUQmD5I8MCQYfIvsD9mRdrw7jJC4=
+github.com/alecthomas/mango-kong v0.1.0/go.mod h1:t+TYVdsONUolf/BwVcm+15eqcdAj15h4Qe9MMFAwwT4=
 github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
 github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
 github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
 github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
+github.com/aymanbagabas/go-osc52/v2 v2.0.1 h1:HwpRHbFMcZLEVr42D4p7XBqjyuxQH5SMiErDT4WkJ2k=
+github.com/aymanbagabas/go-osc52/v2 v2.0.1/go.mod h1:uYgXzlJ7ZpABp8OJ+exZzJJhRNQ2ASbcXHWsFqH8hp8=
+github.com/aymanbagabas/go-udiff v0.2.0 h1:TK0fH4MteXUDspT88n8CKzvK0X9O2xu9yQjWpi6yML8=
+github.com/aymanbagabas/go-udiff v0.2.0/go.mod h1:RE4Ex0qsGkTAJoQdQQCA0uG+nAzJO/pI/QwceO5fgrA=
 github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
 github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
+github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc h1:4pZI35227imm7yK2bGPcfpFEmuY1gc2YSTShr4iJBfs=
+github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc/go.mod h1:X4/0JoqgTIPSFcRA/P6INZzIuyqdFY5rm8tb41s9okk=
+github.com/charmbracelet/lipgloss v1.1.0 h1:vYXsiLHVkK7fp74RkV7b2kq9+zDLoEU4MZoFqR/noCY=
+github.com/charmbracelet/lipgloss v1.1.0/go.mod h1:/6Q8FR2o+kj8rz4Dq0zQc3vYf7X+B0binUUBwA0aL30=
+github.com/charmbracelet/x/ansi v0.8.0 h1:9GTq3xq9caJW8ZrBTe0LIe2fvfLR/bYXKTx2llXn7xE=
+github.com/charmbracelet/x/ansi v0.8.0/go.mod h1:wdYl/ONOLHLIVmQaxbIYEC/cRKOQyjTkowiI4blgS9Q=
+github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd h1:vy0GVL4jeHEwG5YOXDmi86oYw2yuYUGqz6a8sLwg0X8=
+github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd/go.mod h1:xe0nKWGd3eJgtqZRaN9RjMtK7xUYchjzPr7q6kcvCCs=
+github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a h1:G99klV19u0QnhiizODirwVksQB91TJKV/UaTnACcG30=
+github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a/go.mod h1:wDlXFlCrmJ8J+swcL/MnGUuYnqgQdW9rhSD61oNMb6U=
+github.com/charmbracelet/x/term v0.2.1 h1:AQeHeLZ1OqSXhrAWpYUtZyX1T3zVxfpZuEQMIQaGIAQ=
+github.com/charmbracelet/x/term v0.2.1/go.mod h1:oQ4enTYFV7QN4m0i9mzHrViD7TQKvNEEkHUMCmsxdUg=
 github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
 github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
 github.com/gorilla/websocket v1.5.3 h1:saDtZ6Pbx/0u+bgYQ3q96pZgCzfhKXGPqt7kZ72aNNg=
@ -16,15 +34,41 @@ github.com/hashicorp/logutils v1.0.0 h1:dLEQVugN8vlakKOUE3ihGLTZJRB4j+M2cdTm/ORI
 github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
 github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
 github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
+github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
+github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
+github.com/lucasb-eyer/go-colorful v1.2.0 h1:1nnpGOrhyZZuNyfu1QjKiUICQ74+3FNCN69Aj6K7nkY=
+github.com/lucasb-eyer/go-colorful v1.2.0/go.mod h1:R4dSotOR9KMtayYi1e77YzuveK+i7ruzyGqttikkLy0=
+github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY=
+github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y=
+github.com/mattn/go-runewidth v0.0.16 h1:E5ScNMtiwvlvB5paMFdw9p4kSQzbXFikJ5SQO6TULQc=
+github.com/mattn/go-runewidth v0.0.16/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
 github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
 github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
 github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
 github.com/mmcloughlin/profile v0.1.1/go.mod h1:IhHD7q1ooxgwTgjxQYkACGA77oFTDdFVejUS1/tS/qU=
+github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab h1:m7QFONkzLK0fVXCjwX5tANcnj1yXxTnYQtnfJiY3tcA=
+github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
+github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
+github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
+github.com/muesli/termenv v0.16.0 h1:S5AlUN9dENB57rsbnkPyfdGuWIlkmzJjbFf0Tf5FWUc=
+github.com/muesli/termenv v0.16.0/go.mod h1:ZRfOIKPFDYQoDFF4Olj7/QJbW60Ol/kL1pU3VfY/Cnk=
 github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
 github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
 github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
+github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
+github.com/rivo/uniseg v0.4.7 h1:WUdvkW8uEhrYfLC4ZzdpI2ztxP1I582+49Oc5Mq64VQ=
+github.com/rivo/uniseg v0.4.7/go.mod h1:FN3SvrM+Zdj16jyLfmOkMNblXMcoc8DfTHruCPUcx88=
 github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
 github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
+github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
+github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
+github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e h1:JVG44RsyaB9T2KIHavMF/ppJZNG9ZpyihvCd0w101no=
+github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e/go.mod h1:RbqR21r5mrJuqunuUZ/Dhy/avygyECGrLceyNeo4LiM=
+golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561 h1:MDc5xs78ZrZr3HMQugiXOAkSZtfTpbJLDr/lwfgO53E=
+golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561/go.mod h1:cyybsKvd6eL0RnXn6p/Grxp8F5bW7iYuBgsNCOHpMYE=
+golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.30.0 h1:QjkSwP/36a20jFYWkSue1YwXzLmsV5Gfq7Eiy72C1uc=
+golang.org/x/sys v0.30.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
 gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
 gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
--- a/group.go
+++ b/group.go
@ -4,6 +4,8 @@ import (
 	"fmt"

 	"github.com/andreykaipov/goobs/api/requests/sceneitems"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )

 // GroupCmd provides commands to manage groups in OBS Studio.
@ -17,21 +19,64 @@ type GroupCmd struct {

 // GroupListCmd provides a command to list all groups in a scene.
 type GroupListCmd struct {
-	SceneName string `arg:"" help:"Name of the scene to list groups from."`
+	SceneName string `arg:"" help:"Name of the scene to list groups from." default:""`
 }

 // Run executes the command to list all groups in a scene.
+// nolint: misspell
 func (cmd *GroupListCmd) Run(ctx *context) error {
+	if cmd.SceneName == "" {
+		currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+		if err != nil {
+			return fmt.Errorf("failed to get current program scene: %w", err)
+		}
+		cmd.SceneName = currentScene.SceneName
+	}
+
 	resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
 		WithSceneName(cmd.SceneName))
 	if err != nil {
 		return fmt.Errorf("failed to get scene item list: %w", err)
 	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+		Headers("ID", "Group Name", "Enabled").
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Center)
+			case 1:
+				style = style.Align(lipgloss.Left)
+			case 2:
+				style = style.Align(lipgloss.Center)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+	var found bool
 	for _, item := range resp.SceneItems {
 		if item.IsGroup {
-			fmt.Fprintf(ctx.Out, "Group ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
+			t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
+			found = true
 		}
 	}
+
+	if !found {
+		fmt.Fprintf(ctx.Out, "No groups found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
+		return nil
+	}
+
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }

@ -59,13 +104,17 @@ func (cmd *GroupShowCmd) Run(ctx *context) error {
 			if err != nil {
 				return fmt.Errorf("failed to set scene item enabled: %w", err)
 			}
-			fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
+			fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
 			found = true
 			break
 		}
 	}
 	if !found {
-		return fmt.Errorf("group '%s' not found", cmd.GroupName)
+		return fmt.Errorf(
+			"group %s not found in scene %s",
+			ctx.Style.Error(cmd.GroupName),
+			ctx.Style.Error(cmd.SceneName),
+		)
 	}
 	return nil
 }
@ -94,13 +143,17 @@ func (cmd *GroupHideCmd) Run(ctx *context) error {
 			if err != nil {
 				return fmt.Errorf("failed to set scene item enabled: %w", err)
 			}
-			fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
+			fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
 			found = true
 			break
 		}
 	}
 	if !found {
-		return fmt.Errorf("group '%s' not found", cmd.GroupName)
+		return fmt.Errorf(
+			"group %s not found in scene %s",
+			ctx.Style.Error(cmd.GroupName),
+			ctx.Style.Error(cmd.SceneName),
+		)
 	}
 	return nil
 }
@ -131,16 +184,20 @@ func (cmd *GroupToggleCmd) Run(ctx *context) error {
 				return fmt.Errorf("failed to set scene item enabled: %w", err)
 			}
 			if newState {
-				fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
+				fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
 			} else {
-				fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
+				fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
 			}
 			found = true
 			break
 		}
 	}
 	if !found {
-		return fmt.Errorf("group '%s' not found", cmd.GroupName)
+		return fmt.Errorf(
+			"group %s not found in scene %s",
+			ctx.Style.Error(cmd.GroupName),
+			ctx.Style.Error(cmd.SceneName),
+		)
 	}

 	return nil
@ -162,12 +219,12 @@ func (cmd *GroupStatusCmd) Run(ctx *context) error {
 	for _, item := range resp.SceneItems {
 		if item.IsGroup && item.SourceName == cmd.GroupName {
 			if item.SceneItemEnabled {
-				fmt.Fprintf(ctx.Out, "Group %s is shown.\n", cmd.GroupName)
+				fmt.Fprintf(ctx.Out, "Group %s is shown.\n", ctx.Style.Highlight(cmd.GroupName))
 			} else {
-				fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", cmd.GroupName)
+				fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", ctx.Style.Highlight(cmd.GroupName))
 			}
 			return nil
 		}
 	}
-	return fmt.Errorf("group '%s' not found", cmd.GroupName)
+	return fmt.Errorf("group %s not found in scene %s", ctx.Style.Error(cmd.GroupName), ctx.Style.Error(cmd.SceneName))
 }
--- a/group_test.go
+++ b/group_test.go
@ -0,0 +1,118 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestGroupList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &GroupListCmd{
+		SceneName: "Scene",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list groups: %v", err)
+	}
+	if !strings.Contains(out.String(), "test_group") {
+		t.Fatalf("Expected output to contain 'test_group', got '%s'", out.String())
+	}
+}
+
+func TestGroupShow(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &GroupShowCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to show group: %v", err)
+	}
+	if out.String() != "Group test_group is now shown.\n" {
+		t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
+	}
+}
+
+func TestGroupToggle(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdStatus := &GroupStatusCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get group status: %v", err)
+	}
+	var enabled bool
+	if strings.Contains(out.String(), "Group test_group is shown.") {
+		enabled = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdToggle := &GroupToggleCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err = cmdToggle.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to toggle group: %v", err)
+	}
+	if enabled {
+		if out.String() != "Group test_group is now hidden.\n" {
+			t.Fatalf("Expected output to be 'Group test_group is now hidden.', got '%s'", out.String())
+		}
+	} else {
+		if out.String() != "Group test_group is now shown.\n" {
+			t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
+		}
+	}
+}
+
+func TestGroupStatus(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdShow := &GroupShowCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err := cmdShow.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to show group: %v", err)
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStatus := &GroupStatusCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err = cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get group status: %v", err)
+	}
+	if out.String() != "Group test_group is shown.\n" {
+		t.Fatalf("Expected output to be 'Group test_group is shown.', got '%s'", out.String())
+	}
+}
--- a/hotkey.go
+++ b/hotkey.go
@ -0,0 +1,93 @@
+package main
+
+import (
+	"fmt"
+
+	"github.com/andreykaipov/goobs/api/requests/general"
+	"github.com/andreykaipov/goobs/api/typedefs"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
+)
+
+// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
+type HotkeyCmd struct {
+	List            HotkeyListCmd            `cmd:"" help:"List all hotkeys."             aliases:"ls"`
+	Trigger         HotkeyTriggerCmd         `cmd:"" help:"Trigger a hotkey by name."     aliases:"tr"`
+	TriggerSequence HotkeyTriggerSequenceCmd `cmd:"" help:"Trigger a hotkey by sequence." aliases:"trs"`
+}
+
+// HotkeyListCmd provides a command to list all hotkeys.
+type HotkeyListCmd struct{} // size = 0x0
+
+// Run executes the command to list all hotkeys.
+func (cmd *HotkeyListCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.General.GetHotkeyList()
+	if err != nil {
+		return err
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+		Headers("Hotkey Name").
+		StyleFunc(func(row, _ int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center) // nolint: misspell
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+	for _, hotkey := range resp.Hotkeys {
+		t.Row(hotkey)
+	}
+	fmt.Fprintln(ctx.Out, t.Render())
+	return nil
+}
+
+// HotkeyTriggerCmd provides a command to trigger a hotkey.
+type HotkeyTriggerCmd struct {
+	Hotkey string `help:"Hotkey name to trigger." arg:""`
+}
+
+// Run executes the command to trigger a hotkey.
+func (cmd *HotkeyTriggerCmd) Run(ctx *context) error {
+	_, err := ctx.Client.General.TriggerHotkeyByName(
+		general.NewTriggerHotkeyByNameParams().WithHotkeyName(cmd.Hotkey),
+	)
+	if err != nil {
+		return err
+	}
+	return nil
+}
+
+// HotkeyTriggerSequenceCmd provides a command to trigger a hotkey sequence.
+type HotkeyTriggerSequenceCmd struct {
+	Shift bool   `flag:"" help:"Shift modifier."`
+	Ctrl  bool   `flag:"" help:"Control modifier."`
+	Alt   bool   `flag:"" help:"Alt modifier."`
+	Cmd   bool   `flag:"" help:"Command modifier."`
+	KeyID string `        help:"Key ID to trigger." arg:""`
+}
+
+// Run executes the command to trigger a hotkey sequence.
+func (cmd *HotkeyTriggerSequenceCmd) Run(ctx *context) error {
+	_, err := ctx.Client.General.TriggerHotkeyByKeySequence(
+		general.NewTriggerHotkeyByKeySequenceParams().
+			WithKeyId(cmd.KeyID).
+			WithKeyModifiers(&typedefs.KeyModifiers{
+				Shift:   cmd.Shift,
+				Control: cmd.Ctrl,
+				Alt:     cmd.Alt,
+				Command: cmd.Cmd,
+			}),
+	)
+	if err != nil {
+		return err
+	}
+	return nil
+}
--- a/img/coloured-border.png
+++ b/img/coloured-border.png
--- a/img/coloured-no-border.png
+++ b/img/coloured-no-border.png
--- a/img/colourless.png
+++ b/img/colourless.png
--- a/input.go
+++ b/input.go
@ -1,10 +1,14 @@
+// nolint: misspell
 package main

 import (
 	"fmt"
+	"sort"
 	"strings"

 	"github.com/andreykaipov/goobs/api/requests/inputs"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )

 // InputCmd provides commands to manage inputs in OBS Studio.
@ -20,6 +24,9 @@ type InputListCmd struct {
 	Input  bool `flag:"" help:"List all inputs."         aliases:"i"`
 	Output bool `flag:"" help:"List all outputs."        aliases:"o"`
 	Colour bool `flag:"" help:"List all colour sources." aliases:"c"`
+	Ffmpeg bool `flag:"" help:"List all ffmpeg sources." aliases:"f"`
+	Vlc    bool `flag:"" help:"List all VLC sources."    aliases:"v"`
+	UUID   bool `flag:"" help:"Display UUIDs of inputs." aliases:"u"`
 }

 // Run executes the command to list all inputs.
@ -28,21 +35,90 @@ func (cmd *InputListCmd) Run(ctx *context) error {
 	if err != nil {
 		return err
 	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	if cmd.UUID {
+		t.Headers("Input Name", "Kind", "Muted", "UUID")
+	} else {
+		t.Headers("Input Name", "Kind", "Muted")
+	}
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		case 1:
+			style = style.Align(lipgloss.Left)
+		case 2:
+			style = style.Align(lipgloss.Center)
+		case 3:
+			style = style.Align(lipgloss.Left)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+
+	sort.Slice(resp.Inputs, func(i, j int) bool {
+		return resp.Inputs[i].InputName < resp.Inputs[j].InputName
+	})
+
 	for _, input := range resp.Inputs {
-		if cmd.Input && strings.Contains(input.InputKind, "input") {
-			fmt.Fprintln(ctx.Out, "Input:", input.InputName)
+		var muteMark string
+		resp, err := ctx.Client.Inputs.GetInputMute(
+			inputs.NewGetInputMuteParams().WithInputName(input.InputName),
+		)
+		if err != nil {
+			if err.Error() == "request GetInputMute: InvalidResourceState (604): The specified input does not support audio." {
+				muteMark = "N/A"
+			} else {
+				return fmt.Errorf("failed to get input mute state: %w", err)
 			}
-		if cmd.Output && strings.Contains(input.InputKind, "output") {
-			fmt.Fprintln(ctx.Out, "Output:", input.InputName)
-		}
-		if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
-			fmt.Fprintln(ctx.Out, "Colour Source:", input.InputName)
+		} else {
+			muteMark = getEnabledMark(resp.InputMuted)
 		}

-		if !cmd.Input && !cmd.Output && !cmd.Colour {
-			fmt.Fprintln(ctx.Out, "Source:", input.InputName)
+		type filter struct {
+			enabled bool
+			keyword string
+		}
+		filters := []filter{
+			{cmd.Input, "input"},
+			{cmd.Output, "output"},
+			{cmd.Colour, "color"}, // nolint: misspell
+			{cmd.Ffmpeg, "ffmpeg"},
+			{cmd.Vlc, "vlc"},
+		}
+
+		var added bool
+		for _, f := range filters {
+			if f.enabled && strings.Contains(input.InputKind, f.keyword) {
+				if cmd.UUID {
+					t.Row(input.InputName, input.InputKind, muteMark, input.InputUuid)
+				} else {
+					t.Row(input.InputName, input.InputKind, muteMark)
+				}
+				added = true
+				break
 			}
 		}
+
+		if !added && (!cmd.Input && !cmd.Output && !cmd.Colour && !cmd.Ffmpeg && !cmd.Vlc) {
+			if cmd.UUID {
+				t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark, input.InputUuid)
+			} else {
+				t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark)
+			}
+		}
+	}
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }

@ -60,7 +136,7 @@ func (cmd *InputMuteCmd) Run(ctx *context) error {
 		return fmt.Errorf("failed to mute input: %w", err)
 	}

-	fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
+	fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
 	return nil
 }

@ -78,7 +154,7 @@ func (cmd *InputUnmuteCmd) Run(ctx *context) error {
 		return fmt.Errorf("failed to unmute input: %w", err)
 	}

-	fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
+	fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
 	return nil
 }

@ -106,9 +182,9 @@ func (cmd *InputToggleCmd) Run(ctx *context) error {
 	}

 	if newMuteState {
-		fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
+		fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
 	} else {
-		fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
+		fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
 	}
 	return nil
 }
--- a/input_test.go
+++ b/input_test.go
@ -0,0 +1,128 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestInputList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &InputListCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list inputs: %v", err)
+	}
+
+	expectedInputs := []string{
+		"Desktop Audio",
+		"Mic/Aux",
+		"Colour Source",
+		"Colour Source 2",
+		"Colour Source 3",
+	}
+	output := out.String()
+	for _, input := range expectedInputs {
+		if !strings.Contains(output, input) {
+			t.Fatalf("Expected output to contain '%s', got '%s'", input, output)
+		}
+	}
+}
+
+func TestInputListFilterInput(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &InputListCmd{Input: true}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list inputs with filter: %v", err)
+	}
+
+	expectedInputs := []string{
+		"Mic/Aux",
+	}
+	expectedFilteredOut := []string{
+		"Desktop Audio",
+		"Colour Source",
+		"Colour Source 2",
+		"Colour Source 3",
+	}
+	for _, input := range expectedInputs {
+		if !strings.Contains(out.String(), input) {
+			t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
+		}
+	}
+	for _, filteredOut := range expectedFilteredOut {
+		if strings.Contains(out.String(), filteredOut) {
+			t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
+		}
+	}
+}
+
+func TestInputListFilterOutput(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &InputListCmd{Output: true}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list outputs with filter: %v", err)
+	}
+
+	expectedInputs := []string{
+		"Desktop Audio",
+	}
+	expectedFilteredOut := []string{
+		"Mic/Aux",
+		"Colour Source",
+		"Colour Source 2",
+		"Colour Source 3",
+	}
+	for _, input := range expectedInputs {
+		if !strings.Contains(out.String(), input) {
+			t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
+		}
+	}
+	for _, filteredOut := range expectedFilteredOut {
+		if strings.Contains(out.String(), filteredOut) {
+			t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
+		}
+	}
+}
+
+func TestInputListFilterColour(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &InputListCmd{Colour: true}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list colour inputs with filter: %v", err)
+	}
+
+	expectedInputs := []string{
+		"Colour Source",
+		"Colour Source 2",
+		"Colour Source 3",
+	}
+	for _, input := range expectedInputs {
+		if !strings.Contains(out.String(), input) {
+			t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
+		}
+	}
+}
--- a/main.go
+++ b/main.go
@ -7,63 +7,120 @@ import (
 	"fmt"
 	"io"
 	"os"
+	"path/filepath"
+	"runtime/debug"
+	"strings"
 	"time"

 	"github.com/alecthomas/kong"
+	mangokong "github.com/alecthomas/mango-kong"
 	"github.com/andreykaipov/goobs"
+	kongdotenv "github.com/titusjaka/kong-dotenv-go"
 )

+var version string // Version of the CLI, set at build time.
+
+// VersionFlag is a custom flag type that prints the version and exits.
+type VersionFlag string
+
+func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }  // nolint: revive
+func (v VersionFlag) IsBool() bool                       { return true } // nolint: revive
+func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
+	fmt.Printf("gobs-cli version: %s\n", vars["version"])
+	app.Exit(0)
+	return nil
+}
+
 // ObsConfig holds the configuration for connecting to the OBS WebSocket server.
 type ObsConfig struct {
-	Host     string `flag:"host"     help:"Host to connect to."          default:"localhost" env:"OBS_HOST"`
-	Port     int    `flag:"port"     help:"Port to connect to."          default:"4455"      env:"OBS_PORT"`
-	Password string `flag:"password" help:"Password for authentication." default:""          env:"OBS_PASSWORD"`
-	Timeout  int    `flag:"timeout"  help:"Timeout in seconds."          default:"5"         env:"OBS_TIMEOUT"`
+	Host     string `flag:"host"     help:"Host to connect to."          default:"localhost" env:"OBS_HOST"     short:"H"`
+	Port     int    `flag:"port"     help:"Port to connect to."          default:"4455"      env:"OBS_PORT"     short:"P"`
+	Password string `flag:"password" help:"Password for authentication." default:""          env:"OBS_PASSWORD" short:"p"`
+	Timeout  int    `flag:"timeout"  help:"Timeout in seconds."          default:"5"         env:"OBS_TIMEOUT"  short:"T"`
 }

-// cli is the main command line interface structure.
-// It embeds the ObsConfig struct to inherit its fields and flags.
-type cli struct {
-	ObsConfig `embed:"" help:"OBS WebSocket configuration."`
+// StyleConfig holds the configuration for styling the CLI output.
+type StyleConfig struct {
+	Style    string `help:"Style used in output."                   flag:"style"     default:""      env:"GOBS_STYLE"           short:"s" enum:",red,magenta,purple,blue,cyan,green,yellow,orange,white,grey,navy,black"`
+	NoBorder bool   `help:"Disable table border styling in output." flag:"no-border" default:"false" env:"GOBS_STYLE_NO_BORDER" short:"b"`
+}

-	Version         VersionCmd         `help:"Show version."             cmd:"" aliases:"v"`
-	Scene           SceneCmd           `help:"Manage scenes."            cmd:"" aliases:"sc"`
-	Sceneitem       SceneItemCmd       `help:"Manage scene items."       cmd:"" aliases:"si"`
-	Group           GroupCmd           `help:"Manage groups."            cmd:"" aliases:"g"`
-	Input           InputCmd           `help:"Manage inputs."            cmd:"" aliases:"i"`
-	Record          RecordCmd          `help:"Manage recording."         cmd:"" aliases:"rec"`
-	Stream          StreamCmd          `help:"Manage streaming."         cmd:"" aliases:"st"`
-	Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn"`
-	Profile         ProfileCmd         `help:"Manage profiles."          cmd:"" aliases:"p"`
-	Replaybuffer    ReplayBufferCmd    `help:"Manage replay buffer."     cmd:"" aliases:"rb"`
-	Studiomode      StudioModeCmd      `help:"Manage studio mode."       cmd:"" aliases:"sm"`
-	Virtualcam      VirtualCamCmd      `help:"Manage virtual camera."    cmd:"" aliases:"vc"`
+// CLI is the main command line interface structure.
+// It embeds ObsConfig and StyleConfig to provide configuration options.
+type CLI struct {
+	ObsConfig   `embed:"" help:"OBS WebSocket configuration."`
+	StyleConfig `embed:"" help:"Style configuration."`
+
+	Man     mangokong.ManFlag `help:"Print man page."`
+	Version VersionFlag       `help:"Print gobs-cli version information and quit" name:"version" short:"v"`
+
+	ObsVersion      ObsVersionCmd      `help:"Print OBS client and websocket version." cmd:"" aliases:"v"`
+	Scene           SceneCmd           `help:"Manage scenes."                          cmd:"" aliases:"sc"  group:"Scene"`
+	Sceneitem       SceneItemCmd       `help:"Manage scene items."                     cmd:"" aliases:"si"  group:"Scene Item"`
+	Group           GroupCmd           `help:"Manage groups."                          cmd:"" aliases:"g"   group:"Group"`
+	Input           InputCmd           `help:"Manage inputs."                          cmd:"" aliases:"i"   group:"Input"`
+	Record          RecordCmd          `help:"Manage recording."                       cmd:"" aliases:"rec" group:"Recording"`
+	Stream          StreamCmd          `help:"Manage streaming."                       cmd:"" aliases:"st"  group:"Streaming"`
+	Scenecollection SceneCollectionCmd `help:"Manage scene collections."               cmd:"" aliases:"scn" group:"Scene Collection"`
+	Profile         ProfileCmd         `help:"Manage profiles."                        cmd:"" aliases:"p"   group:"Profile"`
+	Replaybuffer    ReplayBufferCmd    `help:"Manage replay buffer."                   cmd:"" aliases:"rb"  group:"Replay Buffer"`
+	Studiomode      StudioModeCmd      `help:"Manage studio mode."                     cmd:"" aliases:"sm"  group:"Studio Mode"`
+	Virtualcam      VirtualCamCmd      `help:"Manage virtual camera."                  cmd:"" aliases:"vc"  group:"Virtual Camera"`
+	Hotkey          HotkeyCmd          `help:"Manage hotkeys."                         cmd:"" aliases:"hk"  group:"Hotkey"`
+	Filter          FilterCmd          `help:"Manage filters."                         cmd:"" aliases:"f"   group:"Filter"`
+	Projector       ProjectorCmd       `help:"Manage projectors."                      cmd:"" aliases:"prj" group:"Projector"`
+	Screenshot      ScreenshotCmd      `help:"Take screenshots."                       cmd:"" aliases:"ss"  group:"Screenshot"`
 }

 type context struct {
 	Client *goobs.Client
 	Out    io.Writer
+	Style  *Style
+}
+
+func newContext(client *goobs.Client, out io.Writer, styleCfg StyleConfig) *context {
+	return &context{
+		Client: client,
+		Out:    out,
+		Style:  styleFromFlag(styleCfg),
+	}
 }

 func main() {
-	var client *goobs.Client
-	cli := cli{}
-	ctx := kong.Parse(
-		&cli,
-		kong.Name("GOBS-CLI"),
-		kong.Description("A command line tool to interact with OBS Websocket."),
-	)
-
-	client, err := connectObs(cli.ObsConfig)
+	userConfigDir, err := os.UserConfigDir()
 	if err != nil {
-		ctx.FatalIfErrorf(err)
+		fmt.Fprintf(os.Stderr, "Error getting user config directory: %v\n", err)
+		os.Exit(1)
 	}

-	ctx.Bind(&context{
-		Client: client,
-		Out:    os.Stdout,
+	var cli CLI
+	ctx := kong.Parse(
+		&cli,
+		kong.Name("gobs-cli"),
+		kong.Description("A command line tool to interact with OBS Websocket."),
+		kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
+		kong.UsageOnError(),
+		kong.ConfigureHelp(kong.HelpOptions{
+			Compact: true,
+		}),
+		kong.Vars{
+			"version": func() string {
+				if version == "" {
+					info, ok := debug.ReadBuildInfo()
+					if !ok {
+						return "(unable to read build info)"
+					}
+					version = strings.Split(info.Main.Version, "-")[0]
+				}
+				return version
+			}(),
 		})

+	client, err := connectObs(cli.ObsConfig)
+	ctx.FatalIfErrorf(err)
+
+	ctx.Bind(newContext(client, os.Stdout, cli.StyleConfig))
+
 	ctx.FatalIfErrorf(run(ctx, client))
 }

--- a/main_test.go
+++ b/main_test.go
@ -0,0 +1,136 @@
+package main
+
+import (
+	"os"
+	"testing"
+
+	"github.com/andreykaipov/goobs"
+	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/andreykaipov/goobs/api/requests/filters"
+	"github.com/andreykaipov/goobs/api/requests/inputs"
+	"github.com/andreykaipov/goobs/api/requests/scenes"
+	"github.com/andreykaipov/goobs/api/requests/ui"
+	typedefs "github.com/andreykaipov/goobs/api/typedefs"
+)
+
+func getClient(t *testing.T) (*goobs.Client, func()) {
+	t.Helper()
+	client, err := connectObs(ObsConfig{
+		Host:     os.Getenv("OBS_HOST"),
+		Port:     4455,
+		Password: os.Getenv("OBS_PASSWORD"),
+		Timeout:  5,
+	})
+	if err != nil {
+		t.Fatalf("Failed to connect to OBS: %v", err)
+	}
+	return client, func() {
+		if err := client.Disconnect(); err != nil {
+			t.Fatalf("Failed to disconnect from OBS: %v", err)
+		}
+	}
+}
+
+func TestMain(m *testing.M) {
+	client, err := connectObs(ObsConfig{
+		Host:     os.Getenv("OBS_HOST"),
+		Port:     4455,
+		Password: os.Getenv("OBS_PASSWORD"),
+		Timeout:  5,
+	})
+	if err != nil {
+		os.Exit(1)
+	}
+	defer client.Disconnect()
+
+	setup(client)
+
+	// Run the tests
+	exitCode := m.Run()
+
+	teardown(client)
+
+	// Exit with the appropriate code
+	os.Exit(exitCode)
+}
+
+func setup(client *goobs.Client) {
+	client.Config.SetStreamServiceSettings(config.NewSetStreamServiceSettingsParams().
+		WithStreamServiceType("rtmp_common").
+		WithStreamServiceSettings(&typedefs.StreamServiceSettings{
+			Server: "auto",
+			Key:    os.Getenv("OBS_STREAM_KEY"),
+		}))
+
+	client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
+		WithSceneCollectionName("test-collection"))
+
+	client.Scenes.CreateScene(scenes.NewCreateSceneParams().
+		WithSceneName("gobs-test"))
+	client.Inputs.CreateInput(inputs.NewCreateInputParams().
+		WithSceneName("gobs-test").
+		WithInputName("gobs-test-input").
+		WithInputKind("color_source_v3").
+		WithInputSettings(map[string]any{
+			"color":   3279460728,
+			"width":   1920,
+			"height":  1080,
+			"visible": true,
+		}).
+		WithSceneItemEnabled(true))
+	client.Inputs.CreateInput(inputs.NewCreateInputParams().
+		WithSceneName("gobs-test").
+		WithInputName("gobs-test-input-2").
+		WithInputKind("color_source_v3").
+		WithInputSettings(map[string]any{
+			"color":   1789347616,
+			"width":   720,
+			"height":  480,
+			"visible": true,
+		}).
+		WithSceneItemEnabled(true))
+
+	// Create source filter on an audio input
+	client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
+		WithSourceName("Mic/Aux").
+		WithFilterName("test_filter").
+		WithFilterKind("compressor_filter").
+		WithFilterSettings(map[string]any{
+			"threshold":        -20,
+			"ratio":            4,
+			"attack_time":      10,
+			"release_time":     100,
+			"output_gain":      -3.6,
+			"sidechain_source": nil,
+		}))
+
+	// Create source filter on a scene
+	client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
+		WithSourceName("gobs-test").
+		WithFilterName("test_filter").
+		WithFilterKind("luma_key_filter_v2").
+		WithFilterSettings(map[string]any{
+			"luma": 0.5,
+		}))
+}
+
+func teardown(client *goobs.Client) {
+	client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
+		WithSourceName("Mic/Aux").
+		WithFilterName("test_filter"))
+	client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
+		WithSourceName("gobs-test").
+		WithFilterName("test_filter"))
+
+	client.Scenes.RemoveScene(scenes.NewRemoveSceneParams().
+		WithSceneName("gobs-test"))
+
+	client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
+		WithSceneCollectionName("default"))
+
+	client.Stream.StopStream()
+	client.Record.StopRecord()
+	client.Outputs.StopReplayBuffer()
+	client.Ui.SetStudioModeEnabled(ui.NewSetStudioModeEnabledParams().
+		WithStudioModeEnabled(false))
+}
--- a/profile.go
+++ b/profile.go
@ -5,55 +5,85 @@ import (
 	"slices"

 	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )

 // ProfileCmd provides commands to manage profiles in OBS Studio.
 type ProfileCmd struct {
-	List    ListProfileCmd    `help:"List profiles."       cmd:"" aliases:"ls"`
-	Current CurrentProfileCmd `help:"Get current profile." cmd:"" aliases:"c"`
-	Switch  SwitchProfileCmd  `help:"Switch profile."      cmd:"" aliases:"sw"`
-	Create  CreateProfileCmd  `help:"Create profile."      cmd:"" aliases:"cr"`
-	Remove  RemoveProfileCmd  `help:"Remove profile."      cmd:"" aliases:"rm"`
+	List    ProfileListCmd    `help:"List profiles."       cmd:"" aliases:"ls"`
+	Current ProfileCurrentCmd `help:"Get current profile." cmd:"" aliases:"c"`
+	Switch  ProfileSwitchCmd  `help:"Switch profile."      cmd:"" aliases:"sw"`
+	Create  ProfileCreateCmd  `help:"Create profile."      cmd:"" aliases:"new"`
+	Remove  ProfileRemoveCmd  `help:"Remove profile."      cmd:"" aliases:"rm"`
 }

-// ListProfileCmd provides a command to list all profiles.
-type ListProfileCmd struct{} // size = 0x0
+// ProfileListCmd provides a command to list all profiles.
+type ProfileListCmd struct{} // size = 0x0

 // Run executes the command to list all profiles.
-func (cmd *ListProfileCmd) Run(ctx *context) error {
+// nolint: misspell
+func (cmd *ProfileListCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
 	}

+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+		Headers("Profile Name", "Current").
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Left)
+			case 1:
+				style = style.Align(lipgloss.Center)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
 	for _, profile := range profiles.Profiles {
-		fmt.Fprintln(ctx.Out, profile)
+		var enabledMark string
+		if profile == profiles.CurrentProfileName {
+			enabledMark = getEnabledMark(true)
 		}

+		t.Row(profile, enabledMark)
+	}
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }

-// CurrentProfileCmd provides a command to get the current profile.
-type CurrentProfileCmd struct{} // size = 0x0
+// ProfileCurrentCmd provides a command to get the current profile.
+type ProfileCurrentCmd struct{} // size = 0x0

 // Run executes the command to get the current profile.
-func (cmd *CurrentProfileCmd) Run(ctx *context) error {
+func (cmd *ProfileCurrentCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
 	}
-	fmt.Fprintf(ctx.Out, "Current profile: %s\n", profiles.CurrentProfileName)
+	fmt.Fprintf(ctx.Out, "Current profile: %s\n", ctx.Style.Highlight(profiles.CurrentProfileName))

 	return nil
 }

-// SwitchProfileCmd provides a command to switch to a different profile.
-type SwitchProfileCmd struct {
+// ProfileSwitchCmd provides a command to switch to a different profile.
+type ProfileSwitchCmd struct {
 	Name string `arg:"" help:"Name of the profile to switch to." required:""`
 }

 // Run executes the command to switch to a different profile.
-func (cmd *SwitchProfileCmd) Run(ctx *context) error {
+func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
@ -61,71 +91,78 @@ func (cmd *SwitchProfileCmd) Run(ctx *context) error {
 	current := profiles.CurrentProfileName

 	if current == cmd.Name {
-		return nil
+		return fmt.Errorf("already using profile %s", ctx.Style.Error(cmd.Name))
 	}

 	_, err = ctx.Client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().WithProfileName(cmd.Name))
 	if err != nil {
-		return err
+		return fmt.Errorf("failed to switch to profile %s: %w", ctx.Style.Error(cmd.Name), err)
 	}

-	fmt.Fprintf(ctx.Out, "Switched from profile %s to %s\n", current, cmd.Name)
+	fmt.Fprintf(
+		ctx.Out,
+		"Switched from profile %s to %s\n",
+		ctx.Style.Highlight(current),
+		ctx.Style.Highlight(cmd.Name),
+	)

 	return nil
 }

-// CreateProfileCmd provides a command to create a new profile.
-type CreateProfileCmd struct {
+// ProfileCreateCmd provides a command to create a new profile.
+type ProfileCreateCmd struct {
 	Name string `arg:"" help:"Name of the profile to create." required:""`
 }

 // Run executes the command to create a new profile.
-func (cmd *CreateProfileCmd) Run(ctx *context) error {
+func (cmd *ProfileCreateCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
 	}

 	if slices.Contains(profiles.Profiles, cmd.Name) {
-		return fmt.Errorf("profile %s already exists", cmd.Name)
+		return fmt.Errorf("profile %s already exists", ctx.Style.Error(cmd.Name))
 	}

 	_, err = ctx.Client.Config.CreateProfile(config.NewCreateProfileParams().WithProfileName(cmd.Name))
 	if err != nil {
-		return err
+		return fmt.Errorf("failed to create profile %s: %w", ctx.Style.Error(cmd.Name), err)
 	}

-	fmt.Fprintf(ctx.Out, "Created profile: %s\n", cmd.Name)
+	fmt.Fprintf(ctx.Out, "Created profile: %s\n", ctx.Style.Highlight(cmd.Name))

 	return nil
 }

-// RemoveProfileCmd provides a command to remove an existing profile.
-type RemoveProfileCmd struct {
+// ProfileRemoveCmd provides a command to remove an existing profile.
+type ProfileRemoveCmd struct {
 	Name string `arg:"" help:"Name of the profile to delete." required:""`
 }

 // Run executes the command to remove an existing profile.
-func (cmd *RemoveProfileCmd) Run(ctx *context) error {
+func (cmd *ProfileRemoveCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
 	}

 	if !slices.Contains(profiles.Profiles, cmd.Name) {
-		return fmt.Errorf("profile %s does not exist", cmd.Name)
+		return fmt.Errorf("profile %s does not exist", ctx.Style.Error(cmd.Name))
 	}

+	// Prevent deletion of the current profile
+	// This is allowed in OBS Studio (with a confirmation prompt), but we want to prevent it here
 	if profiles.CurrentProfileName == cmd.Name {
-		return fmt.Errorf("cannot delete current profile %s", cmd.Name)
+		return fmt.Errorf("cannot delete current profile %s", ctx.Style.Error(cmd.Name))
 	}

 	_, err = ctx.Client.Config.RemoveProfile(config.NewRemoveProfileParams().WithProfileName(cmd.Name))
 	if err != nil {
-		return err
+		return fmt.Errorf("failed to delete profile %s: %w", ctx.Style.Error(cmd.Name), err)
 	}

-	fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", cmd.Name)
+	fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", ctx.Style.Highlight(cmd.Name))

 	return nil
 }
--- a/projector.go
+++ b/projector.go
@ -0,0 +1,111 @@
+package main
+
+import (
+	"fmt"
+
+	"github.com/andreykaipov/goobs/api/requests/ui"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
+)
+
+// ProjectorCmd provides a command to manage projectors in OBS.
+type ProjectorCmd struct {
+	ListMonitors ProjectorListMonitorsCmd `cmd:"" help:"List available monitors."                                        aliases:"ls-m"`
+	Open         ProjectorOpenCmd         `cmd:"" help:"Open a fullscreen projector for a source on a specific monitor." aliases:"o"`
+}
+
+// ProjectorListMonitorsCmd provides a command to list all monitors available for projectors.
+type ProjectorListMonitorsCmd struct{} // size = 0x0
+
+// Run executes the command to list all monitors available for projectors.
+// nolint: misspell
+func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
+	monitors, err := ctx.Client.Ui.GetMonitorList()
+	if err != nil {
+		return err
+	}
+
+	if len(monitors.Monitors) == 0 {
+		fmt.Fprintf(ctx.Out, "No monitors found.\n")
+		return nil
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+		Headers("Monitor ID", "Monitor Name").
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Center)
+			case 1:
+				style = style.Align(lipgloss.Left)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+	for _, monitor := range monitors.Monitors {
+		t.Row(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
+	}
+
+	fmt.Fprintln(ctx.Out, t.Render())
+	return nil
+}
+
+// ProjectorOpenCmd provides a command to open a fullscreen projector for a specific source.
+type ProjectorOpenCmd struct {
+	MonitorIndex int    `flag:"" help:"Index of the monitor to open the projector on." default:"0"`
+	SourceName   string `        help:"Name of the source to project."                 default:""  arg:""`
+}
+
+// Run executes the command to show details of a specific projector.
+func (cmd *ProjectorOpenCmd) Run(ctx *context) error {
+	if cmd.SourceName == "" {
+		currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+		if err != nil {
+			return fmt.Errorf("failed to get current program scene: %w", err)
+		}
+		cmd.SourceName = currentScene.SceneName
+	}
+
+	monitors, err := ctx.Client.Ui.GetMonitorList()
+	if err != nil {
+		return err
+	}
+
+	var monitorName string
+	for _, monitor := range monitors.Monitors {
+		if monitor.MonitorIndex == cmd.MonitorIndex {
+			monitorName = monitor.MonitorName
+			break
+		}
+	}
+
+	if monitorName == "" {
+		return fmt.Errorf(
+			"monitor with index %s not found. use %s to list available monitors",
+			ctx.Style.Error(fmt.Sprintf("%d", cmd.MonitorIndex)),
+			ctx.Style.Error("gobs-cli prj ls-m"),
+		)
+	}
+
+	ctx.Client.Ui.OpenSourceProjector(ui.NewOpenSourceProjectorParams().
+		WithSourceName(cmd.SourceName).
+		WithMonitorIndex(cmd.MonitorIndex))
+
+	fmt.Fprintf(
+		ctx.Out,
+		"Opened projector for source %s on monitor %s.\n",
+		ctx.Style.Highlight(cmd.SourceName),
+		ctx.Style.Highlight(monitorName),
+	)
+	return nil
+}
--- a/record.go
+++ b/record.go
@ -2,6 +2,9 @@ package main

 import (
 	"fmt"
+
+	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/andreykaipov/goobs/api/requests/record"
 )

 // RecordCmd handles the recording commands.
@ -9,8 +12,12 @@ type RecordCmd struct {
 	Start     RecordStartCmd     `cmd:"" help:"Start recording."                   aliases:"s"`
 	Stop      RecordStopCmd      `cmd:"" help:"Stop recording."                    aliases:"st"`
 	Toggle    RecordToggleCmd    `cmd:"" help:"Toggle recording."                  aliases:"tg"`
+	Status    RecordStatusCmd    `cmd:"" help:"Show recording status."             aliases:"ss"`
 	Pause     RecordPauseCmd     `cmd:"" help:"Pause recording."                   aliases:"p"`
 	Resume    RecordResumeCmd    `cmd:"" help:"Resume recording."                  aliases:"r"`
+	Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory."       aliases:"d"`
+	Split     RecordSplitCmd     `cmd:"" help:"Split recording."                   aliases:"sp"`
+	Chapter   RecordChapterCmd   `cmd:"" help:"Create a chapter in the recording." aliases:"c"`
 }

 // RecordStartCmd starts the recording.
@ -18,7 +25,19 @@ type RecordStartCmd struct{} // size = 0x0

 // Run executes the command to start recording.
 func (cmd *RecordStartCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Record.StartRecord()
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if status.OutputActive {
+		if status.OutputPaused {
+			return fmt.Errorf("recording is already in progress and paused")
+		}
+		return fmt.Errorf("recording is already in progress")
+	}
+
+	_, err = ctx.Client.Record.StartRecord()
 	if err != nil {
 		return err
 	}
@ -31,11 +50,24 @@ type RecordStopCmd struct{} // size = 0x0

 // Run executes the command to stop recording.
 func (cmd *RecordStopCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Record.StopRecord()
+	status, err := ctx.Client.Record.GetRecordStatus()
 	if err != nil {
 		return err
 	}
-	fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+
+	resp, err := ctx.Client.Record.StopRecord()
+	if err != nil {
+		return err
+	}
+	fmt.Fprintf(
+		ctx.Out,
+		"%s",
+		fmt.Sprintf("Recording stopped successfully. Output file: %s\n", ctx.Style.Highlight(resp.OutputPath)),
+	)
 	return nil
 }

@ -44,25 +76,39 @@ type RecordToggleCmd struct{} // size = 0x0

 // Run executes the command to toggle recording.
 func (cmd *RecordToggleCmd) Run(ctx *context) error {
-	// Check if recording is in progress
+	status, err := ctx.Client.Record.ToggleRecord()
+	if err != nil {
+		return err
+	}
+
+	if status.OutputActive {
+		fmt.Fprintln(ctx.Out, "Recording started successfully.")
+	} else {
+		fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
+	}
+	return nil
+}
+
+// RecordStatusCmd shows the recording status.
+type RecordStatusCmd struct{} // size = 0x0
+
+// Run executes the command to show recording status.
+func (cmd *RecordStatusCmd) Run(ctx *context) error {
 	status, err := ctx.Client.Record.GetRecordStatus()
 	if err != nil {
 		return err
 	}

 	if status.OutputActive {
-		_, err = ctx.Client.Record.StopRecord()
-		if err != nil {
-			return err
-		}
-		fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
+		if status.OutputPaused {
+			fmt.Fprintln(ctx.Out, "Recording is paused.")
 		} else {
-		_, err = ctx.Client.Record.StartRecord()
-		if err != nil {
-			return err
+			fmt.Fprintln(ctx.Out, "Recording is in progress.")
 		}
-		fmt.Fprintln(ctx.Out, "Recording started successfully.")
+	} else {
+		fmt.Fprintln(ctx.Out, "Recording is not in progress.")
 	}
+
 	return nil
 }

@ -117,3 +163,95 @@ func (cmd *RecordResumeCmd) Run(ctx *context) error {
 	fmt.Fprintln(ctx.Out, "Recording resumed successfully.")
 	return nil
 }
+
+// RecordDirectoryCmd sets the recording directory.
+type RecordDirectoryCmd struct {
+	RecordDirectory string `arg:"" help:"Directory to save recordings." default:""`
+}
+
+// Run executes the command to set the recording directory.
+func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
+	if cmd.RecordDirectory == "" {
+		resp, err := ctx.Client.Config.GetRecordDirectory()
+		if err != nil {
+			return err
+		}
+		fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", ctx.Style.Highlight(resp.RecordDirectory))
+		return nil
+	}
+
+	_, err := ctx.Client.Config.SetRecordDirectory(
+		config.NewSetRecordDirectoryParams().WithRecordDirectory(cmd.RecordDirectory),
+	)
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
+	return nil
+}
+
+// RecordSplitCmd splits the current recording.
+type RecordSplitCmd struct{} // size = 0x0
+
+// Run executes the command to split the recording.
+func (cmd *RecordSplitCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot split")
+	}
+
+	_, err = ctx.Client.Record.SplitRecordFile()
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintln(ctx.Out, "Recording split successfully.")
+	return nil
+}
+
+// RecordChapterCmd creates a chapter in the recording.
+type RecordChapterCmd struct {
+	ChapterName string `arg:"" help:"Name of the chapter to create." default:""`
+}
+
+// Run executes the command to create a chapter in the recording.
+func (cmd *RecordChapterCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot create chapter")
+	}
+
+	var params *record.CreateRecordChapterParams
+	if cmd.ChapterName == "" {
+		params = record.NewCreateRecordChapterParams()
+	} else {
+		params = record.NewCreateRecordChapterParams().WithChapterName(cmd.ChapterName)
+	}
+
+	_, err = ctx.Client.Record.CreateRecordChapter(params)
+	if err != nil {
+		return err
+	}
+
+	if cmd.ChapterName == "" {
+		cmd.ChapterName = "unnamed"
+	}
+
+	fmt.Fprintf(ctx.Out, "Chapter %s created successfully.\n", ctx.Style.Highlight(cmd.ChapterName))
+	return nil
+}
--- a/record_test.go
+++ b/record_test.go
@ -0,0 +1,126 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+	"time"
+)
+
+func TestRecordStart(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdStatus := &RecordStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get recording status: %v", err)
+	}
+	var active bool
+	if out.String() == "Recording is in progress.\n" {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStart := &RecordStartCmd{}
+	err = cmdStart.Run(context)
+	if active {
+		if err == nil {
+			t.Fatalf("Expected error when starting recording while active, got nil")
+		}
+		if !strings.Contains(err.Error(), "recording is already in progress") {
+			t.Fatalf("Expected error message to contain 'recording is already in progress', got '%s'", err.Error())
+		}
+		return
+	}
+
+	if err != nil {
+		t.Fatalf("Failed to start recording: %v", err)
+	}
+	if out.String() != "Recording started successfully.\n" {
+		t.Fatalf("Expected output to contain 'Recording started successfully.', got '%s'", out.String())
+	}
+	time.Sleep(1 * time.Second) // Wait for the recording to start
+}
+
+func TestRecordStop(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdStatus := &RecordStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get recording status: %v", err)
+	}
+	var active bool
+	if out.String() == "Recording is in progress.\n" {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStop := &RecordStopCmd{}
+	err = cmdStop.Run(context)
+	if !active {
+		if err == nil {
+			t.Fatalf("Expected error when stopping recording while inactive, got nil")
+		}
+		if !strings.Contains(err.Error(), "recording is not in progress") {
+			t.Fatalf("Expected error message to contain 'recording is not in progress', got '%s'", err.Error())
+		}
+		return
+	}
+
+	if err != nil {
+		t.Fatalf("Failed to stop recording: %v", err)
+	}
+	if !strings.Contains(out.String(), "Recording stopped successfully. Output file: ") {
+		t.Fatalf("Expected output to contain 'Recording stopped successfully. Output file: ', got '%s'", out.String())
+	}
+	time.Sleep(1 * time.Second) // Wait for the recording to stop
+}
+
+func TestRecordToggle(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdStatus := &RecordStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get recording status: %v", err)
+	}
+	var active bool
+	if out.String() == "Recording is in progress.\n" {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdToggle := &RecordToggleCmd{}
+	err = cmdToggle.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to toggle recording: %v", err)
+	}
+
+	time.Sleep(1 * time.Second) // Wait for a second to ensure toggle has taken effect
+
+	if active {
+		if out.String() != "Recording stopped successfully.\n" {
+			t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
+		}
+	} else {
+		if out.String() != "Recording started successfully.\n" {
+			t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
+		}
+	}
+}
--- a/replaybuffer.go
+++ b/replaybuffer.go
@ -8,6 +8,7 @@ import (
 type ReplayBufferCmd struct {
 	Start  ReplayBufferStartCmd  `help:"Start replay buffer."      cmd:"" aliases:"s"`
 	Stop   ReplayBufferStopCmd   `help:"Stop replay buffer."       cmd:"" aliases:"st"`
+	Toggle ReplayBufferToggleCmd `help:"Toggle replay buffer."     cmd:"" aliases:"tg"`
 	Status ReplayBufferStatusCmd `help:"Get replay buffer status." cmd:"" aliases:"ss"`
 	Save   ReplayBufferSaveCmd   `help:"Save replay buffer."       cmd:"" aliases:"sv"`
 }
@ -18,7 +19,11 @@ type ReplayBufferStartCmd struct{} // size = 0x0
 // Run executes the command to start the replay buffer.
 func (cmd *ReplayBufferStartCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Outputs.StartReplayBuffer()
-	return err
+	if err != nil {
+		return fmt.Errorf("failed to start replay buffer: %w", err)
+	}
+	fmt.Fprintln(ctx.Out, "Replay buffer started.")
+	return nil
 }

 // ReplayBufferStopCmd stops the replay buffer.
@ -27,9 +32,31 @@ type ReplayBufferStopCmd struct{} // size = 0x0
 // Run executes the command to stop the replay buffer.
 func (cmd *ReplayBufferStopCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Outputs.StopReplayBuffer()
+	if err != nil {
+		return fmt.Errorf("failed to stop replay buffer: %w", err)
+	}
+	fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
+	return nil
+}
+
+// ReplayBufferToggleCmd toggles the replay buffer state.
+type ReplayBufferToggleCmd struct{} // size = 0x0
+
+// Run executes the command to toggle the replay buffer.
+func (cmd *ReplayBufferToggleCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Outputs.ToggleReplayBuffer()
+	if err != nil {
 		return err
 	}

+	if status.OutputActive {
+		fmt.Fprintln(ctx.Out, "Replay buffer started.")
+	} else {
+		fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
+	}
+	return nil
+}
+
 // ReplayBufferStatusCmd retrieves the status of the replay buffer.
 type ReplayBufferStatusCmd struct{} // size = 0x0

--- a/replaybuffer_test.go
+++ b/replaybuffer_test.go
@ -0,0 +1,76 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestReplayBufferStart(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &ReplayBufferStartCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to start replay buffer: %v", err)
+	}
+	if out.String() != "Replay buffer started.\n" {
+		t.Fatalf("Expected output to be 'Replay buffer started', got '%s'", out.String())
+	}
+}
+
+func TestReplayBufferStop(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &ReplayBufferStopCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to stop replay buffer: %v", err)
+	}
+	if out.String() != "Replay buffer stopped.\n" {
+		t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
+	}
+}
+
+func TestReplayBufferToggle(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdStatus := &ReplayBufferStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get replay buffer status: %v", err)
+	}
+	var active bool
+	if strings.Contains(out.String(), "Replay buffer is active") {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdToggle := &ReplayBufferToggleCmd{}
+	err = cmdToggle.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to toggle replay buffer: %v", err)
+	}
+	if active {
+		if out.String() != "Replay buffer stopped.\n" {
+			t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
+		}
+	} else {
+		if out.String() != "Replay buffer started.\n" {
+			t.Fatalf("Expected output to be 'Replay buffer started.', got '%s'", out.String())
+		}
+	}
+}
--- a/scene.go
+++ b/scene.go
@ -5,6 +5,8 @@ import (
 	"slices"

 	"github.com/andreykaipov/goobs/api/requests/scenes"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )

 // SceneCmd provides commands to manage scenes in OBS Studio.
@ -15,19 +17,64 @@ type SceneCmd struct {
 }

 // SceneListCmd provides a command to list all scenes.
-type SceneListCmd struct{} // size = 0x0
+type SceneListCmd struct {
+	UUID bool `flag:"" help:"Display UUIDs of scenes."`
+}

 // Run executes the command to list all scenes.
+// nolint: misspell
 func (cmd *SceneListCmd) Run(ctx *context) error {
 	scenes, err := ctx.Client.Scenes.GetSceneList()
 	if err != nil {
 		return err
 	}

+	currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+	if err != nil {
+		return err
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	if cmd.UUID {
+		t.Headers("Scene Name", "Active", "UUID")
+	} else {
+		t.Headers("Scene Name", "Active")
+	}
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		case 1:
+			style = style.Align(lipgloss.Center)
+		case 2:
+			style = style.Align(lipgloss.Left)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+
 	slices.Reverse(scenes.Scenes)
 	for _, scene := range scenes.Scenes {
-		fmt.Fprintln(ctx.Out, scene.SceneName)
+		var activeMark string
+		if scene.SceneName == currentScene.SceneName {
+			activeMark = getEnabledMark(true)
 		}
+		if cmd.UUID {
+			t.Row(scene.SceneName, activeMark, scene.SceneUuid)
+		} else {
+			t.Row(scene.SceneName, activeMark)
+		}
+	}
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }

@ -43,13 +90,13 @@ func (cmd *SceneCurrentCmd) Run(ctx *context) error {
 		if err != nil {
 			return err
 		}
-		fmt.Fprintln(ctx.Out, scene.SceneName)
+		fmt.Fprintf(ctx.Out, "Current preview scene: %s\n", ctx.Style.Highlight(scene.SceneName))
 	} else {
 		scene, err := ctx.Client.Scenes.GetCurrentProgramScene()
 		if err != nil {
 			return err
 		}
-		fmt.Fprintln(ctx.Out, scene.SceneName)
+		fmt.Fprintf(ctx.Out, "Current program scene: %s\n", ctx.Style.Highlight(scene.SceneName))
 	}
 	return nil
 }
@ -69,7 +116,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
 			return err
 		}

-		fmt.Fprintln(ctx.Out, "Switched to preview scene:", cmd.NewScene)
+		fmt.Fprintf(ctx.Out, "Switched to preview scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
 	} else {
 		_, err := ctx.Client.Scenes.SetCurrentProgramScene(scenes.NewSetCurrentProgramSceneParams().
 			WithSceneName(cmd.NewScene))
@ -77,7 +124,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
 			return err
 		}

-		fmt.Fprintln(ctx.Out, "Switched to program scene:", cmd.NewScene)
+		fmt.Fprintf(ctx.Out, "Switched to program scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
 	}
 	return nil
 }
--- a/scene_test.go
+++ b/scene_test.go
@ -0,0 +1,51 @@
+package main
+
+import (
+	"bytes"
+	"testing"
+)
+
+func TestSceneList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &SceneListCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list scenes: %v", err)
+	}
+	if out.String() == "Current program scene: gobs-test\n" {
+		t.Fatalf("Expected output to be 'Current program scene: gobs-test', got '%s'", out.String())
+	}
+}
+
+func TestSceneCurrent(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	// Set the current scene to "gobs-test"
+	cmdSwitch := &SceneSwitchCmd{
+		NewScene: "gobs-test",
+	}
+	err := cmdSwitch.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to switch to scene: %v", err)
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdCurrent := &SceneCurrentCmd{}
+	err = cmdCurrent.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get current scene: %v", err)
+	}
+	if out.String() != "Current program scene: gobs-test\n" {
+		t.Fatalf("Expected output to be 'Current program scene: gobs-test', got '%s'", out.String())
+	}
+}
--- a/scenecollection.go
+++ b/scenecollection.go
@ -4,38 +4,61 @@ import (
 	"fmt"

 	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )

 // SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
 type SceneCollectionCmd struct {
-	List    ListSceneCollectionCmd    `help:"List scene collections."       cmd:"" aliases:"ls"`
-	Current CurrentSceneCollectionCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
-	Switch  SwitchSceneCollectionCmd  `help:"Switch scene collection."      cmd:"" aliases:"sw"`
-	Create  CreateSceneCollectionCmd  `help:"Create scene collection."      cmd:"" aliases:"cr"`
+	List    SceneCollectionListCmd    `help:"List scene collections."       cmd:"" aliases:"ls"`
+	Current SceneCollectionCurrentCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
+	Switch  SceneCollectionSwitchCmd  `help:"Switch scene collection."      cmd:"" aliases:"sw"`
+	Create  SceneCollectionCreateCmd  `help:"Create scene collection."      cmd:"" aliases:"new"`
 }

-// ListSceneCollectionCmd provides a command to list all scene collections.
-type ListSceneCollectionCmd struct{} // size = 0x0
+// SceneCollectionListCmd provides a command to list all scene collections.
+type SceneCollectionListCmd struct{} // size = 0x0

 // Run executes the command to list all scene collections.
-func (cmd *ListSceneCollectionCmd) Run(ctx *context) error {
+// nolint: misspell
+func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
 	collections, err := ctx.Client.Config.GetSceneCollectionList()
 	if err != nil {
 		return fmt.Errorf("failed to get scene collection list: %w", err)
 	}

-	for _, collection := range collections.SceneCollections {
-		fmt.Fprintln(ctx.Out, collection)
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+		Headers("Scene Collection Name").
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Left)
 			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})

+	for _, collection := range collections.SceneCollections {
+		t.Row(collection)
+	}
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }

-// CurrentSceneCollectionCmd provides a command to get the current scene collection.
-type CurrentSceneCollectionCmd struct{} // size = 0x0
+// SceneCollectionCurrentCmd provides a command to get the current scene collection.
+type SceneCollectionCurrentCmd struct{} // size = 0x0

 // Run executes the command to get the current scene collection.
-func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
+func (cmd *SceneCollectionCurrentCmd) Run(ctx *context) error {
 	collections, err := ctx.Client.Config.GetSceneCollectionList()
 	if err != nil {
 		return fmt.Errorf("failed to get scene collection list: %w", err)
@ -45,13 +68,13 @@ func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
 	return nil
 }

-// SwitchSceneCollectionCmd provides a command to switch to a different scene collection.
-type SwitchSceneCollectionCmd struct {
+// SceneCollectionSwitchCmd provides a command to switch to a different scene collection.
+type SceneCollectionSwitchCmd struct {
 	Name string `arg:"" help:"Name of the scene collection to switch to." required:""`
 }

 // Run executes the command to switch to a different scene collection.
-func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
+func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
 	collections, err := ctx.Client.Config.GetSceneCollectionList()
 	if err != nil {
 		return err
@ -59,35 +82,35 @@ func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
 	current := collections.CurrentSceneCollectionName

 	if current == cmd.Name {
-		return fmt.Errorf("scene collection %s is already active", cmd.Name)
+		return fmt.Errorf("scene collection %s is already active", ctx.Style.Error(cmd.Name))
 	}

 	_, err = ctx.Client.Config.SetCurrentSceneCollection(
 		config.NewSetCurrentSceneCollectionParams().WithSceneCollectionName(cmd.Name),
 	)
 	if err != nil {
-		return fmt.Errorf("failed to switch scene collection: %w", err)
+		return fmt.Errorf("failed to switch scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
 	}

-	fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", cmd.Name)
+	fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", ctx.Style.Highlight(cmd.Name))

 	return nil
 }

-// CreateSceneCollectionCmd provides a command to create a new scene collection.
-type CreateSceneCollectionCmd struct {
+// SceneCollectionCreateCmd provides a command to create a new scene collection.
+type SceneCollectionCreateCmd struct {
 	Name string `arg:"" help:"Name of the scene collection to create." required:""`
 }

 // Run executes the command to create a new scene collection.
-func (cmd *CreateSceneCollectionCmd) Run(ctx *context) error {
+func (cmd *SceneCollectionCreateCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Config.CreateSceneCollection(
 		config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
 	)
 	if err != nil {
-		return fmt.Errorf("failed to create scene collection: %w", err)
+		return fmt.Errorf("failed to create scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
 	}

-	fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", cmd.Name)
+	fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
 	return nil
 }
--- a/sceneitem.go
+++ b/sceneitem.go
@ -1,10 +1,14 @@
+// nolint: misspell
 package main

 import (
 	"fmt"
+	"sort"

 	"github.com/andreykaipov/goobs"
 	"github.com/andreykaipov/goobs/api/requests/sceneitems"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )

 // SceneItemCmd provides commands to manage scene items in OBS Studio.
@ -14,50 +18,153 @@ type SceneItemCmd struct {
 	Hide      SceneItemHideCmd      `cmd:"" help:"Hide scene item."           aliases:"h"`
 	Toggle    SceneItemToggleCmd    `cmd:"" help:"Toggle scene item."         aliases:"tg"`
 	Visible   SceneItemVisibleCmd   `cmd:"" help:"Get scene item visibility." aliases:"v"`
+	Transform SceneItemTransformCmd `cmd:"" help:"Transform scene item."      aliases:"t"`
 }

 // SceneItemListCmd provides a command to list all scene items in a scene.
 type SceneItemListCmd struct {
-	SceneName string `arg:"" help:"Scene name."`
+	UUID      bool   `flag:"" help:"Display UUIDs of scene items."`
+	SceneName string `        help:"Name of the scene to list items from." arg:"" default:""`
 }

 // Run executes the command to list all scene items in a scene.
 func (cmd *SceneItemListCmd) Run(ctx *context) error {
+	if cmd.SceneName == "" {
+		currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+		if err != nil {
+			return fmt.Errorf("failed to get current program scene: %w", err)
+		}
+		cmd.SceneName = currentScene.SceneName
+	}
+
 	resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
 		WithSceneName(cmd.SceneName))
 	if err != nil {
 		return fmt.Errorf("failed to get scene item list: %w", err)
 	}
-	for _, item := range resp.SceneItems {
-		fmt.Fprintf(ctx.Out, "Item ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
-	}
+
+	if len(resp.SceneItems) == 0 {
+		fmt.Fprintf(ctx.Out, "No scene items found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
 		return nil
 	}

+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	if cmd.UUID {
+		t.Headers("Item ID", "Item Name", "In Group", "Enabled", "UUID")
+	} else {
+		t.Headers("Item ID", "Item Name", "In Group", "Enabled")
+	}
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Center)
+		case 1:
+			style = style.Align(lipgloss.Left)
+		case 2:
+			style = style.Align(lipgloss.Center)
+		case 3:
+			style = style.Align(lipgloss.Center)
+		case 4:
+			style = style.Align(lipgloss.Left)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+
+	sort.Slice(resp.SceneItems, func(i, j int) bool {
+		return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
+	})
+
+	for _, item := range resp.SceneItems {
+		if item.IsGroup {
+			resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
+				WithSceneName(item.SourceName))
+			if err != nil {
+				return fmt.Errorf(
+					"failed to get group scene item list for group %s: %w",
+					ctx.Style.Error(item.SourceName),
+					err,
+				)
+			}
+
+			sort.Slice(resp.SceneItems, func(i, j int) bool {
+				return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
+			})
+
+			for _, groupItem := range resp.SceneItems {
+				if cmd.UUID {
+					t.Row(
+						fmt.Sprintf("%d", groupItem.SceneItemID),
+						groupItem.SourceName,
+						item.SourceName,
+						getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
+						groupItem.SourceUuid,
+					)
+				} else {
+					t.Row(
+						fmt.Sprintf("%d", groupItem.SceneItemID),
+						groupItem.SourceName,
+						item.SourceName,
+						getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
+					)
+				}
+			}
+		} else {
+			if cmd.UUID {
+				t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "",
+					getEnabledMark(item.SceneItemEnabled), item.SourceUuid)
+			} else {
+				t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", getEnabledMark(item.SceneItemEnabled))
+			}
+		}
+	}
+	fmt.Fprintln(ctx.Out, t.Render())
+	return nil
+}
+
+// getSceneNameAndItemID retrieves the scene name and item ID for a given item in a scene or group.
 func getSceneNameAndItemID(
-	client *goobs.Client,
+	ctx *context,
 	sceneName string,
 	itemName string,
-	parent string,
+	group string,
 ) (string, int, error) {
-	if parent != "" {
-		resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
-			WithSceneName(parent))
+	if group != "" {
+		resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
+			WithSceneName(group))
 		if err != nil {
 			return "", 0, err
 		}
 		for _, item := range resp.SceneItems {
 			if item.SourceName == itemName {
-				return parent, int(item.SceneItemID), nil
+				return group, int(item.SceneItemID), nil
 			}
 		}
-		return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
+		return "", 0, fmt.Errorf("item %s not found in scene %s", ctx.Style.Error(itemName), ctx.Style.Error(sceneName))
 	}

-	itemID, err := client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
+	itemID, err := ctx.Client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
 		WithSceneName(sceneName).
 		WithSourceName(itemName))
 	if err != nil {
+		if err.Error() == "request GetSceneItemId: ResourceNotFound (600): No scene items were found in the specified scene by that name or offset." {
+			return "", 0, fmt.Errorf(
+				"item %s not found in scene %s. is it in a group? if so use the %s flag to specify the parent group\nuse %s for a list of items in the scene",
+				ctx.Style.Error(itemName),
+				ctx.Style.Error(sceneName),
+				ctx.Style.Error("--group"),
+				ctx.Style.Error("gobs-cli si ls"),
+			)
+		}
 		return "", 0, err
 	}
 	return sceneName, int(itemID.SceneItemId), nil
@ -65,7 +172,7 @@ func getSceneNameAndItemID(

 // SceneItemShowCmd provides a command to show a scene item.
 type SceneItemShowCmd struct {
-	Parent string `flag:"" help:"Parent group name."`
+	Group string `flag:"" help:"Parent group name."`

 	SceneName string `arg:"" help:"Scene name."`
 	ItemName  string `arg:"" help:"Item name."`
@ -73,7 +180,7 @@ type SceneItemShowCmd struct {

 // Run executes the command to show a scene item.
 func (cmd *SceneItemShowCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@ -85,12 +192,24 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
 	if err != nil {
 		return err
 	}
+
+	if cmd.Group != "" {
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in group %s is now visible.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.Group),
+		)
+	} else {
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
+	}
+
 	return nil
 }

 // SceneItemHideCmd provides a command to hide a scene item.
 type SceneItemHideCmd struct {
-	Parent string `flag:"" help:"Parent group name."`
+	Group string `flag:"" help:"Parent group name."`

 	SceneName string `arg:"" help:"Scene name."`
 	ItemName  string `arg:"" help:"Item name."`
@ -98,7 +217,7 @@ type SceneItemHideCmd struct {

 // Run executes the command to hide a scene item.
 func (cmd *SceneItemHideCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@ -110,6 +229,18 @@ func (cmd *SceneItemHideCmd) Run(ctx *context) error {
 	if err != nil {
 		return err
 	}
+
+	if cmd.Group != "" {
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in group %s is now hidden.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.Group),
+		)
+	} else {
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
+	}
+
 	return nil
 }

@ -126,7 +257,7 @@ func getItemEnabled(client *goobs.Client, sceneName string, itemID int) (bool, e

 // SceneItemToggleCmd provides a command to toggle the visibility of a scene item.
 type SceneItemToggleCmd struct {
-	Parent string `flag:"" help:"Parent group name."`
+	Group string `flag:"" help:"Parent group name."`

 	SceneName string `arg:"" help:"Scene name."`
 	ItemName  string `arg:"" help:"Item name."`
@ -134,7 +265,7 @@ type SceneItemToggleCmd struct {

 // Run executes the command to toggle the visibility of a scene item.
 func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@ -151,12 +282,24 @@ func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
 	if err != nil {
 		return err
 	}
+
+	if itemEnabled {
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in scene %s is now hidden.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.SceneName),
+		)
+	} else {
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
+	}
+
 	return nil
 }

 // SceneItemVisibleCmd provides a command to check the visibility of a scene item.
 type SceneItemVisibleCmd struct {
-	Parent string `flag:"" help:"Parent group name."`
+	Group string `flag:"" help:"Parent group name."`

 	SceneName string `arg:"" help:"Scene name."`
 	ItemName  string `arg:"" help:"Item name."`
@ -164,7 +307,7 @@ type SceneItemVisibleCmd struct {

 // Run executes the command to check the visibility of a scene item.
 func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@ -175,9 +318,126 @@ func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
 	}

 	if itemEnabled {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is visible.\n", cmd.ItemName, cmd.SceneName)
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in scene %s is visible.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.SceneName),
+		)
 	} else {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is hidden.\n", cmd.ItemName, cmd.SceneName)
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
 	}
 	return nil
 }
+
+// SceneItemTransformCmd provides a command to transform a scene item.
+type SceneItemTransformCmd struct {
+	SceneName string `arg:"" help:"Scene name."`
+	ItemName  string `arg:"" help:"Item name."`
+
+	Group string `flag:"" help:"Parent group name."`
+
+	Alignment       float64 `flag:"" help:"Alignment of the scene item."`
+	BoundsAlignment float64 `flag:"" help:"Bounds alignment of the scene item."`
+	BoundsHeight    float64 `flag:"" help:"Bounds height of the scene item."          default:"1.0"`
+	BoundsType      string  `flag:"" help:"Bounds type of the scene item."            default:"OBS_BOUNDS_NONE"`
+	BoundsWidth     float64 `flag:"" help:"Bounds width of the scene item."           default:"1.0"`
+	CropToBounds    bool    `flag:"" help:"Whether to crop the scene item to bounds."`
+	CropBottom      float64 `flag:"" help:"Crop bottom value of the scene item."`
+	CropLeft        float64 `flag:"" help:"Crop left value of the scene item."`
+	CropRight       float64 `flag:"" help:"Crop right value of the scene item."`
+	CropTop         float64 `flag:"" help:"Crop top value of the scene item."`
+	PositionX       float64 `flag:"" help:"X position of the scene item."`
+	PositionY       float64 `flag:"" help:"Y position of the scene item."`
+	Rotation        float64 `flag:"" help:"Rotation of the scene item."`
+	ScaleX          float64 `flag:"" help:"X scale of the scene item."`
+	ScaleY          float64 `flag:"" help:"Y scale of the scene item."`
+}
+
+// Run executes the command to transform a scene item.
+func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
+	if err != nil {
+		return err
+	}
+
+	// Get the current transform of the scene item
+	resp, err := ctx.Client.SceneItems.GetSceneItemTransform(sceneitems.NewGetSceneItemTransformParams().
+		WithSceneName(sceneName).
+		WithSceneItemId(sceneItemID))
+	if err != nil {
+		return err
+	}
+
+	// Update the transform with the provided values
+	transform := resp.SceneItemTransform
+
+	if cmd.Alignment != 0 {
+		transform.Alignment = cmd.Alignment
+	}
+	if cmd.BoundsAlignment != 0 {
+		transform.BoundsAlignment = cmd.BoundsAlignment
+	}
+
+	if cmd.BoundsHeight != 0 {
+		transform.BoundsHeight = cmd.BoundsHeight
+	}
+	if cmd.BoundsType != "" {
+		transform.BoundsType = cmd.BoundsType
+	}
+	if cmd.BoundsWidth != 0 {
+		transform.BoundsWidth = cmd.BoundsWidth
+	}
+
+	if cmd.CropToBounds {
+		transform.CropToBounds = cmd.CropToBounds
+	}
+	if cmd.CropBottom != 0 {
+		transform.CropBottom = cmd.CropBottom
+	}
+	if cmd.CropLeft != 0 {
+		transform.CropLeft = cmd.CropLeft
+	}
+	if cmd.CropRight != 0 {
+		transform.CropRight = cmd.CropRight
+	}
+	if cmd.CropTop != 0 {
+		transform.CropTop = cmd.CropTop
+	}
+	if cmd.PositionX != 0 {
+		transform.PositionX = cmd.PositionX
+	}
+	if cmd.PositionY != 0 {
+		transform.PositionY = cmd.PositionY
+	}
+	if cmd.Rotation != 0 {
+		transform.Rotation = cmd.Rotation
+	}
+	if cmd.ScaleX != 0 {
+		transform.ScaleX = cmd.ScaleX
+	}
+	if cmd.ScaleY != 0 {
+		transform.ScaleY = cmd.ScaleY
+	}
+
+	_, err = ctx.Client.SceneItems.SetSceneItemTransform(sceneitems.NewSetSceneItemTransformParams().
+		WithSceneName(sceneName).
+		WithSceneItemId(sceneItemID).
+		WithSceneItemTransform(transform))
+	if err != nil {
+		return err
+	}
+
+	if cmd.Group != "" {
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in group %s transformed.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.Group),
+		)
+	} else {
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s transformed.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
+	}
+
+	return nil
+}
--- a/sceneitem_test.go
+++ b/sceneitem_test.go
@ -0,0 +1,29 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestSceneItemList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &SceneItemListCmd{
+		SceneName: "gobs-test",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list scene items: %v", err)
+	}
+	if !strings.Contains(out.String(), "gobs-test-input") {
+		t.Fatalf("Expected output to contain 'gobs-test-input', got '%s'", out.String())
+	}
+	if !strings.Contains(out.String(), "gobs-test-input-2") {
+		t.Fatalf("Expected output to contain 'gobs-test-input-2', got '%s'", out.String())
+	}
+}
--- a/screenshot.go
+++ b/screenshot.go
@ -0,0 +1,41 @@
+package main
+
+import (
+	"fmt"
+	"path/filepath"
+
+	"github.com/andreykaipov/goobs/api/requests/sources"
+)
+
+// ScreenshotCmd provides commands to manage screenshots in OBS Studio.
+type ScreenshotCmd struct {
+	Save ScreenshotSaveCmd `cmd:"" help:"Take a screenshot and save it to a file." aliases:"sv"`
+}
+
+// ScreenshotSaveCmd represents the command to save a screenshot of a source in OBS.
+type ScreenshotSaveCmd struct {
+	SourceName string  `arg:"" help:"Name of the source to take a screenshot of."`
+	FilePath   string  `arg:"" help:"Path to the file where the screenshot will be saved."`
+	Width      float64 `       help:"Width of the screenshot in pixels."                   flag:"" default:"1920"`
+	Height     float64 `       help:"Height of the screenshot in pixels."                  flag:"" default:"1080"`
+	Quality    float64 `       help:"Quality of the screenshot (1-100)."                   flag:"" default:"-1"`
+}
+
+// Run executes the command to take a screenshot and save it to a file.
+func (cmd *ScreenshotSaveCmd) Run(ctx *context) error {
+	_, err := ctx.Client.Sources.SaveSourceScreenshot(
+		sources.NewSaveSourceScreenshotParams().
+			WithSourceName(cmd.SourceName).
+			WithImageFormat(trimPrefix(filepath.Ext(cmd.FilePath), ".")).
+			WithImageFilePath(cmd.FilePath).
+			WithImageWidth(cmd.Width).
+			WithImageHeight(cmd.Height).
+			WithImageCompressionQuality(cmd.Quality),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to take screenshot: %w", err)
+	}
+
+	fmt.Fprintf(ctx.Out, "Screenshot saved to %s.\n", ctx.Style.Highlight(cmd.FilePath))
+	return nil
+}
--- a/stream.go
+++ b/stream.go
@ -17,10 +17,21 @@ type StreamStartCmd struct{} // size = 0x0

 // Run executes the command to start streaming.
 func (cmd *StreamStartCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Stream.StartStream()
+	// Check if the stream is already active
+	status, err := ctx.Client.Stream.GetStreamStatus()
 	if err != nil {
 		return err
 	}
+	if status.OutputActive {
+		return fmt.Errorf("stream is already in progress")
+	}
+
+	_, err = ctx.Client.Stream.StartStream()
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintln(ctx.Out, "Stream started successfully.")
 	return nil
 }

@ -29,10 +40,21 @@ type StreamStopCmd struct{} // size = 0x0

 // Run executes the command to stop streaming.
 func (cmd *StreamStopCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Stream.StopStream()
+	// Check if the stream is already inactive
+	status, err := ctx.Client.Stream.GetStreamStatus()
 	if err != nil {
 		return err
 	}
+	if !status.OutputActive {
+		return fmt.Errorf("stream is not in progress")
+	}
+
+	_, err = ctx.Client.Stream.StopStream()
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
 	return nil
 }

@ -41,19 +63,15 @@ type StreamToggleCmd struct{} // size = 0x0

 // Run executes the command to toggle streaming.
 func (cmd *StreamToggleCmd) Run(ctx *context) error {
-	status, err := ctx.Client.Stream.GetStreamStatus()
+	status, err := ctx.Client.Stream.ToggleStream()
 	if err != nil {
 		return err
 	}
+
 	if status.OutputActive {
-		_, err = ctx.Client.Stream.StopStream()
-		fmt.Fprintf(ctx.Out, "Stopping stream...\n")
+		fmt.Fprintln(ctx.Out, "Stream started successfully.")
 	} else {
-		_, err = ctx.Client.Stream.StartStream()
-		fmt.Fprintf(ctx.Out, "Starting stream...\n")
-	}
-	if err != nil {
-		return err
+		fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
 	}
 	return nil
 }
--- a/stream_test.go
+++ b/stream_test.go
@ -0,0 +1,123 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+	"time"
+)
+
+func TestStreamStart(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdStatus := &StreamStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get stream status: %v", err)
+	}
+	var active bool
+	if strings.Contains(out.String(), "Output active: true") {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStart := &StreamStartCmd{}
+	err = cmdStart.Run(context)
+	if active {
+		if err == nil {
+			t.Fatalf("Expected error when starting stream while active, got nil")
+		}
+		if !strings.Contains(err.Error(), "stream is already in progress") {
+			t.Fatalf("Expected error message to contain 'stream is already in progress', got '%s'", err.Error())
+		}
+		return
+	}
+	if err != nil {
+		t.Fatalf("Failed to start stream: %v", err)
+	}
+	if out.String() != "Stream started successfully.\n" {
+		t.Fatalf("Expected output to contain 'Stream started successfully.', got '%s'", out.String())
+	}
+	time.Sleep(2 * time.Second) // Wait for the stream to start
+}
+
+func TestStreamStop(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdStatus := &StreamStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get stream status: %v", err)
+	}
+	var active bool
+	if strings.Contains(out.String(), "Output active: true") {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStop := &StreamStopCmd{}
+	err = cmdStop.Run(context)
+	if !active {
+		if err == nil {
+			t.Fatalf("Expected error when stopping stream while inactive, got nil")
+		}
+		if !strings.Contains(err.Error(), "stream is not in progress") {
+			t.Fatalf("Expected error message to contain 'stream is not in progress', got '%s'", err.Error())
+		}
+		return
+	}
+	if err != nil {
+		t.Fatalf("Failed to stop stream: %v", err)
+	}
+	if out.String() != "Stream stopped successfully.\n" {
+		t.Fatalf("Expected output to contain 'Stream stopped successfully.', got '%s'", out.String())
+	}
+	time.Sleep(2 * time.Second) // Wait for the stream to stop
+}
+
+func TestStreamToggle(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdStatus := &StreamStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get stream status: %v", err)
+	}
+	var active bool
+	if strings.Contains(out.String(), "Output active: true") {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdToggle := &StreamToggleCmd{}
+	err = cmdToggle.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to toggle stream: %v", err)
+	}
+
+	if active {
+		if out.String() != "Stream stopped successfully.\n" {
+			t.Fatalf("Expected 'Stream stopped successfully.', got: %s", out.String())
+		}
+	} else {
+		if out.String() != "Stream started successfully.\n" {
+			t.Fatalf("Expected 'Stream started successfully.', got: %s", out.String())
+		}
+	}
+	time.Sleep(2 * time.Second) // Wait for the stream to toggle
+}
--- a/studiomode.go
+++ b/studiomode.go
@ -23,6 +23,8 @@ func (cmd *StudioModeEnableCmd) Run(ctx *context) error {
 	if err != nil {
 		return fmt.Errorf("failed to enable studio mode: %w", err)
 	}
+
+	fmt.Fprintln(ctx.Out, "Studio mode is now enabled")
 	return nil
 }

@ -35,6 +37,8 @@ func (cmd *StudioModeDisableCmd) Run(ctx *context) error {
 	if err != nil {
 		return fmt.Errorf("failed to disable studio mode: %w", err)
 	}
+
+	fmt.Fprintln(ctx.Out, "Studio mode is now disabled")
 	return nil
 }

--- a/studiomode_test.go
+++ b/studiomode_test.go
@ -0,0 +1,62 @@
+package main
+
+import (
+	"bytes"
+	"testing"
+)
+
+func TestStudioModeEnable(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdEnable := &StudioModeEnableCmd{}
+	err := cmdEnable.Run(context)
+	if err != nil {
+		t.Fatalf("failed to enable studio mode: %v", err)
+	}
+	if out.String() != "Studio mode is now enabled\n" {
+		t.Fatalf("expected 'Studio mode is now enabled', got: %s", out.String())
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStatus := &StudioModeStatusCmd{}
+	err = cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("failed to get studio mode status: %v", err)
+	}
+	if out.String() != "Studio mode is enabled\n" {
+		t.Fatalf("expected 'Studio mode is enabled', got: %s", out.String())
+	}
+}
+
+func TestStudioModeDisable(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmdDisable := &StudioModeDisableCmd{}
+	err := cmdDisable.Run(context)
+	if err != nil {
+		t.Fatalf("failed to disable studio mode: %v", err)
+	}
+	if out.String() != "Studio mode is now disabled\n" {
+		t.Fatalf("expected 'Studio mode is now disabled', got: %s", out.String())
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStatus := &StudioModeStatusCmd{}
+	err = cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("failed to get studio mode status: %v", err)
+	}
+	if out.String() != "Studio mode is disabled\n" {
+		t.Fatalf("expected 'Studio mode is disabled', got: %s", out.String())
+	}
+}
--- a/style.go
+++ b/style.go
@ -0,0 +1,192 @@
+// nolint: misspell
+package main
+
+import (
+	"fmt"
+	"os"
+
+	"github.com/charmbracelet/lipgloss"
+)
+
+// Style defines colours for the table styles.
+type Style struct {
+	name      string
+	border    lipgloss.Color
+	oddRows   lipgloss.Color
+	evenRows  lipgloss.Color
+	highlight lipgloss.Color
+}
+
+// Highlight applies the highlight style to the given text.
+func (s *Style) Highlight(text string) string {
+	return lipgloss.NewStyle().Foreground(s.highlight).Render(text)
+}
+
+func (s *Style) Error(text string) string {
+	return lipgloss.NewStyle().Foreground(lipgloss.Color("#FF0000")).Render(text) // Red for errors
+}
+
+func newRedStyle() Style {
+	return Style{
+		name:      "red",
+		border:    lipgloss.Color("#D32F2F"), // Strong red for border
+		oddRows:   lipgloss.Color("#FFCDD2"), // Very light red for odd rows
+		evenRows:  lipgloss.Color("#EF9A9A"), // Light red for even rows
+		highlight: lipgloss.Color("#EF9A9A"), // Highlight in light red
+	}
+}
+
+func newMagentaStyle() Style {
+	return Style{
+		name:      "magenta",
+		border:    lipgloss.Color("#C2185B"), // Strong magenta for border
+		oddRows:   lipgloss.Color("#F8BBD0"), // Very light magenta/pink for odd rows
+		evenRows:  lipgloss.Color("#F48FB1"), // Light magenta/pink for even rows
+		highlight: lipgloss.Color("#F48FB1"), // Highlight in light magenta/pink
+	}
+}
+
+func newPurpleStyle() Style {
+	return Style{
+		name:      "purple",
+		border:    lipgloss.Color("#7B1FA2"), // Strong purple for border
+		oddRows:   lipgloss.Color("#E1BEE7"), // Very light purple for odd rows
+		evenRows:  lipgloss.Color("#CE93D8"), // Light purple for even rows
+		highlight: lipgloss.Color("#CE93D8"), // Highlight in light purple
+	}
+}
+
+func newBlueStyle() Style {
+	return Style{
+		name:      "blue",
+		border:    lipgloss.Color("#1976D2"), // Medium blue for border
+		oddRows:   lipgloss.Color("#E3F2FD"), // Very light blue for odd rows
+		evenRows:  lipgloss.Color("#BBDEFB"), // Light blue for even rows
+		highlight: lipgloss.Color("#1976D2"), // Highlight in medium blue
+	}
+}
+
+func newCyanStyle() Style {
+	return Style{
+		name:      "cyan",
+		border:    lipgloss.Color("#00BFCF"), // A strong cyan for border
+		oddRows:   lipgloss.Color("#E0F7FA"), // Very light cyan for odd rows
+		evenRows:  lipgloss.Color("#B2EBF2"), // Slightly darker light cyan for even rows
+		highlight: lipgloss.Color("#00BFCF"), // Highlight in strong cyan
+	}
+}
+
+func newGreenStyle() Style {
+	return Style{
+		name:      "green",
+		border:    lipgloss.Color("#43A047"), // Medium green for border
+		oddRows:   lipgloss.Color("#E8F5E9"), // Very light green for odd rows
+		evenRows:  lipgloss.Color("#C8E6C9"), // Light green for even rows
+		highlight: lipgloss.Color("#43A047"), // Highlight in medium green
+	}
+}
+
+func newYellowStyle() Style {
+	return Style{
+		name:      "yellow",
+		border:    lipgloss.Color("#FBC02D"), // Strong yellow for border
+		oddRows:   lipgloss.Color("#FFF9C4"), // Very light yellow for odd rows
+		evenRows:  lipgloss.Color("#FFF59D"), // Light yellow for even rows
+		highlight: lipgloss.Color("#FBC02D"), // Highlight in strong yellow
+	}
+}
+
+func newOrangeStyle() Style {
+	return Style{
+		name:      "orange",
+		border:    lipgloss.Color("#F57C00"), // Strong orange for border
+		oddRows:   lipgloss.Color("#FFF3E0"), // Very light orange for odd rows
+		evenRows:  lipgloss.Color("#FFE0B2"), // Light orange for even rows
+		highlight: lipgloss.Color("#F57C00"), // Highlight in strong orange
+	}
+}
+
+func newWhiteStyle() Style {
+	return Style{
+		name:      "white",
+		border:    lipgloss.Color("#FFFFFF"), // White for border
+		oddRows:   lipgloss.Color("#F0F0F0"), // Very light grey for odd rows
+		evenRows:  lipgloss.Color("#E0E0E0"), // Light grey for even rows
+		highlight: lipgloss.Color("#FFFFFF"), // Highlight in white
+	}
+}
+
+func newGreyStyle() Style {
+	return Style{
+		name:      "grey",
+		border:    lipgloss.Color("#9E9E9E"), // Medium grey for border
+		oddRows:   lipgloss.Color("#F5F5F5"), // Very light grey for odd rows
+		evenRows:  lipgloss.Color("#EEEEEE"), // Light grey for even rows
+		highlight: lipgloss.Color("#9E9E9E"), // Highlight in medium grey
+	}
+}
+
+func newNavyBlueStyle() Style {
+	return Style{
+		name:      "navy",
+		border:    lipgloss.Color("#001F3F"), // Navy blue for border
+		oddRows:   lipgloss.Color("#CFE2F3"), // Very light blue for odd rows
+		evenRows:  lipgloss.Color("#A9CCE3"), // Light blue for even rows
+		highlight: lipgloss.Color("#001F3F"), // Highlight in navy blue
+	}
+}
+
+func newBlackStyle() Style {
+	return Style{
+		name:      "black",
+		border:    lipgloss.Color("#000000"), // Black for border
+		oddRows:   lipgloss.Color("#333333"), // Dark grey for odd rows
+		evenRows:  lipgloss.Color("#444444"), // Slightly lighter dark grey for even rows
+		highlight: lipgloss.Color("#000000"), // Highlight in black
+	}
+}
+
+func styleFromFlag(cfg StyleConfig) *Style {
+	var style Style
+
+	switch cfg.Style {
+	case "red":
+		style = newRedStyle()
+	case "magenta":
+		style = newMagentaStyle()
+	case "purple":
+		style = newPurpleStyle()
+	case "blue":
+		style = newBlueStyle()
+	case "cyan":
+		style = newCyanStyle()
+	case "green":
+		style = newGreenStyle()
+	case "yellow":
+		style = newYellowStyle()
+	case "orange":
+		style = newOrangeStyle()
+	case "white":
+		style = newWhiteStyle()
+	case "grey":
+		style = newGreyStyle()
+	case "navy":
+		style = newNavyBlueStyle()
+	case "black":
+		style = newBlackStyle()
+	default:
+		err := os.Setenv("NO_COLOR", "1") // nolint: misspell
+		if err != nil {
+			// If we can't set NO_COLOR, we just log the error and continue
+			// This is a fallback to ensure that the application can still run
+			fmt.Fprintf(os.Stderr, "Error setting NO_COLOR: %v\n", err)
+		}
+	}
+
+	// If noBorder is true, we disable the border styling
+	if cfg.NoBorder {
+		style.border = ""
+	}
+
+	return &style
+}
--- a/util.go
+++ b/util.go
@ -0,0 +1,38 @@
+// Package util provides utility functions for the application.
+
+package main
+
+import (
+	"os"
+	"strings"
+)
+
+func snakeCaseToTitleCase(snake string) string {
+	words := strings.Split(snake, "_")
+	for i, word := range words {
+		if len(word) > 0 {
+			words[i] = strings.ToUpper(word[:1]) + word[1:]
+		}
+	}
+	return strings.Join(words, " ")
+}
+
+func getEnabledMark(enabled bool) string {
+	if enabled {
+		if os.Getenv("NO_COLOR") != "" { // nolint: misspell
+			return "✓"
+		}
+		return "✅"
+	}
+	if os.Getenv("NO_COLOR") != "" { // nolint: misspell
+		return "✗"
+	}
+	return "❌"
+}
+
+func trimPrefix(s, prefix string) string {
+	if strings.HasPrefix(s, prefix) {
+		return s[len(prefix):]
+	}
+	return s
+}
--- a/util_test.go
+++ b/util_test.go
@ -0,0 +1,20 @@
+package main
+
+import "testing"
+
+func TestSnakeCaseToTitleCase(t *testing.T) {
+	tests := []struct {
+		input    string
+		expected string
+	}{
+		{"hello_world", "Hello World"},
+		{"snake_case_to_title_case", "Snake Case To Title Case"},
+	}
+
+	for _, test := range tests {
+		result := snakeCaseToTitleCase(test.input)
+		if result != test.expected {
+			t.Errorf("Expected '%s' but got '%s'", test.expected, result)
+		}
+	}
+}
--- a/version.go
+++ b/version.go
@ -4,11 +4,11 @@ import (
 	"fmt"
 )

-// VersionCmd handles the version command.
-type VersionCmd struct{} // size = 0x0
+// ObsVersionCmd handles the version command.
+type ObsVersionCmd struct{} // size = 0x0

 // Run executes the command to get the OBS client version.
-func (cmd *VersionCmd) Run(ctx *context) error {
+func (cmd *ObsVersionCmd) Run(ctx *context) error {
 	version, err := ctx.Client.General.GetVersion()
 	if err != nil {
 		return err
--- a/version_test.go
+++ b/version_test.go
@ -0,0 +1,27 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestVersion(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := newContext(client, &out, StyleConfig{})
+
+	cmd := &ObsVersionCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get version: %v", err)
+	}
+	if !strings.Contains(out.String(), "OBS Client Version:") {
+		t.Fatalf("Expected output to contain 'OBS Client Version:', got '%s'", out.String())
+	}
+	if !strings.Contains(out.String(), "with Websocket Version:") {
+		t.Fatalf("Expected output to contain 'with Websocket Version:', got '%s'", out.String())
+	}
+}
--- a/virtualcam.go
+++ b/virtualcam.go
@ -6,17 +6,17 @@ import (

 // VirtualCamCmd handles the virtual camera commands.
 type VirtualCamCmd struct {
-	Start  StartVirtualCamCmd  `help:"Start virtual camera."      cmd:"" aliases:"s"`
-	Stop   StopVirtualCamCmd   `help:"Stop virtual camera."       cmd:"" aliases:"st"`
-	Toggle ToggleVirtualCamCmd `help:"Toggle virtual camera."     cmd:"" aliases:"tg"`
-	Status StatusVirtualCamCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
+	Start  VirtualCamStartCmd  `help:"Start virtual camera."      cmd:"" aliases:"s"`
+	Stop   VirtualCamStopCmd   `help:"Stop virtual camera."       cmd:"" aliases:"st"`
+	Toggle VirtualCamToggleCmd `help:"Toggle virtual camera."     cmd:"" aliases:"tg"`
+	Status VirtualCamStatusCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
 }

-// StartVirtualCamCmd starts the virtual camera.
-type StartVirtualCamCmd struct{} // size = 0x0
+// VirtualCamStartCmd starts the virtual camera.
+type VirtualCamStartCmd struct{} // size = 0x0

 // Run executes the command to start the virtual camera.
-func (c *StartVirtualCamCmd) Run(ctx *context) error {
+func (c *VirtualCamStartCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Outputs.StartVirtualCam()
 	if err != nil {
 		return fmt.Errorf("failed to start virtual camera: %w", err)
@ -25,11 +25,11 @@ func (c *StartVirtualCamCmd) Run(ctx *context) error {
 	return nil
 }

-// StopVirtualCamCmd stops the virtual camera.
-type StopVirtualCamCmd struct{} // size = 0x0
+// VirtualCamStopCmd stops the virtual camera.
+type VirtualCamStopCmd struct{} // size = 0x0

 // Run executes the command to stop the virtual camera.
-func (c *StopVirtualCamCmd) Run(ctx *context) error {
+func (c *VirtualCamStopCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Outputs.StopVirtualCam()
 	if err != nil {
 		return fmt.Errorf("failed to stop virtual camera: %w", err)
@ -38,23 +38,29 @@ func (c *StopVirtualCamCmd) Run(ctx *context) error {
 	return nil
 }

-// ToggleVirtualCamCmd toggles the virtual camera.
-type ToggleVirtualCamCmd struct{} // size = 0x0
+// VirtualCamToggleCmd toggles the virtual camera.
+type VirtualCamToggleCmd struct{} // size = 0x0

 // Run executes the command to toggle the virtual camera.
-func (c *ToggleVirtualCamCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Outputs.ToggleVirtualCam()
+func (c *VirtualCamToggleCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Outputs.ToggleVirtualCam()
 	if err != nil {
 		return fmt.Errorf("failed to toggle virtual camera: %w", err)
 	}
+
+	if resp.OutputActive {
+		fmt.Fprintln(ctx.Out, "Virtual camera is now active.")
+	} else {
+		fmt.Fprintln(ctx.Out, "Virtual camera is now inactive.")
+	}
 	return nil
 }

-// StatusVirtualCamCmd retrieves the status of the virtual camera.
-type StatusVirtualCamCmd struct{} // size = 0x0
+// VirtualCamStatusCmd retrieves the status of the virtual camera.
+type VirtualCamStatusCmd struct{} // size = 0x0

 // Run executes the command to get the status of the virtual camera.
-func (c *StatusVirtualCamCmd) Run(ctx *context) error {
+func (c *VirtualCamStatusCmd) Run(ctx *context) error {
 	status, err := ctx.Client.Outputs.GetVirtualCamStatus()
 	if err != nil {
 		return fmt.Errorf("failed to get virtual camera status: %w", err)
Author	SHA1	Message	Date
onyx-and-iris	9eb6c8a282	use red in example	2025-06-27 13:53:55 +01:00
onyx-and-iris	eb30cae5b7	add 0.13.3 to CHANGELOG	2025-06-27 13:51:42 +01:00
onyx-and-iris	e6c03a2c92	add style to ToC	2025-06-27 13:49:34 +01:00
onyx-and-iris	f6b82383f9	add ToC to README move style section. add imgs	2025-06-27 13:48:17 +01:00
onyx-and-iris	55f3b0c981	fix item id alignment	2025-06-27 13:38:51 +01:00
onyx-and-iris	7da80a1ad2	fix patch number...	2025-06-26 12:15:36 +01:00
onyx-and-iris	ea4ca2aeb9	fix patch number	2025-06-26 12:14:40 +01:00
onyx-and-iris	d2f0a64180	changes to help: - print help on error - print in compact mode move version + VersionFlag into main store version in kong.Vars add 0.13.3 to CHANGELOG	2025-06-26 12:13:32 +01:00
onyx-and-iris	f01fd0ca84	check if output is paused before attempting record split/chapter. add note to changelog about supported file format for record chapter.	2025-06-23 08:28:49 +01:00
onyx-and-iris	10d50df445	add 0.13.0 to CHANGELOG	2025-06-23 08:03:52 +01:00
onyx-and-iris	06cefe58ed	add record split and record chapter commands	2025-06-23 08:02:31 +01:00
onyx-and-iris	7cd1c78f6a	add --no-border to 0.12.1 Added	2025-06-21 20:29:42 +01:00
onyx-and-iris	842d98edd3	upd Style section in README add example	2025-06-21 20:27:46 +01:00
onyx-and-iris	930b387b85	newContext now requires a StyleConfig, update tests.	2025-06-21 20:27:17 +01:00
onyx-and-iris	2ab1c5bfc3	if --no-border is set, disable the border styling	2025-06-21 20:25:48 +01:00
onyx-and-iris	08f23fe47d	add --no-border flag use it to disable table border styling	2025-06-21 20:25:19 +01:00
onyx-and-iris	bbc6aec230	add note about style env var in README add 0.12.0 to CHANGELOG	2025-06-21 06:59:36 +01:00
onyx-and-iris	5d0ed2a166	fix --style shortname add Style section to README	2025-06-21 06:47:25 +01:00
onyx-and-iris	62579b1c5e	upd docstrings	2025-06-21 06:44:16 +01:00
onyx-and-iris	9ed00cd67c	return colourless check/cross marks if NO_COLOR is set	2025-06-21 06:44:08 +01:00
onyx-and-iris	69bfaf694d	add context factory method to tests update scene_test outputs	2025-06-21 06:43:38 +01:00
onyx-and-iris	7147c3f1ca	style tables and add out/err highlights improve projector open error message if an invalid monitor index is passed. it now prints the monitor name and suggests `gobs-cli prj ls-m` improve error message for sceneitem commands if a scene item in a group is queried without the --group flag.	2025-06-21 06:41:12 +01:00
onyx-and-iris	d699939298	add --style flag to root command define styles	2025-06-21 06:36:05 +01:00
onyx-and-iris	82c0756dde	add 0.11.0 to CHANGELOG	2025-06-20 04:41:26 +01:00
onyx-and-iris	4395c981c6	update README with --uuid flags	2025-06-20 04:41:18 +01:00
onyx-and-iris	dc043b5847	add --uuid flag to scene list, sceneitem list and input list	2025-06-20 04:40:56 +01:00
onyx-and-iris	c8a055fa28	add group tags, makes --help more legible	2025-06-19 18:00:10 +01:00
onyx-and-iris	d9c0e40d8f	add 0.10.3 to CHANGELOG	2025-06-07 20:10:56 +01:00
onyx-and-iris	42ab45b9fb	upd flags for input list command	2025-06-07 19:19:31 +01:00
onyx-and-iris	27c3c5369b	add --fmpeg and --vlc flags to filter list add Muted column to table	2025-06-07 19:19:10 +01:00
onyx-and-iris	0a0c75ae51	sceneitem list now prints enabled mark patch bump	2025-06-04 14:43:16 +01:00
onyx-and-iris	cf5da68137	add filter list fixes to 0.10.1 section	2025-06-04 14:34:09 +01:00
onyx-and-iris	14d9feb43e	add missing SourceName arg to filter list	2025-06-04 14:32:32 +01:00
onyx-and-iris	8204d6520d	filter list SourceName arg now defaults to current scene filter list now prints defaults for unchanged values	2025-06-04 14:32:08 +01:00
onyx-and-iris	1d590eb788	add 0.10.0 to CHANGELOG	2025-06-04 12:57:32 +01:00
onyx-and-iris	29fe6fedfb	add ScreenshotCmd	2025-06-04 12:57:17 +01:00
onyx-and-iris	ee47832cd6	add ScreenshotCmd to README	2025-06-04 12:56:00 +01:00
onyx-and-iris	17b8e53da3	read version from build info if version was not injected at build time (go install) inject version from tag at build time for local builds	2025-06-03 16:35:19 +01:00
onyx-and-iris	92761ab1b3	upd link to --version	2025-06-03 13:12:22 +01:00
onyx-and-iris	4446784709	add short names for root options fix flag example in readme	2025-06-03 12:33:37 +01:00
onyx-and-iris	89a5add7ad	upd VersionCmd test	2025-06-02 18:12:43 +01:00
onyx-and-iris	878ecbd33e	add 0.9.0 to CHANGELOG	2025-06-02 18:12:06 +01:00
onyx-and-iris	18a90e727f	define main.version in local builds	2025-06-02 18:11:56 +01:00
onyx-and-iris	95ebb2afb6	add VersionFlag to CLI struct upd VersionCmd struct	2025-06-02 18:11:37 +01:00
onyx-and-iris	666b4cf744	add VersionFlag upd VersionCmd	2025-06-02 18:10:07 +01:00
onyx-and-iris	9ee6fa9e34	typo	2025-05-29 20:03:37 +01:00
onyx-and-iris	e5223fbdfd	add 0.8.2 to CHANGELOG	2025-05-29 15:31:53 +01:00
onyx-and-iris	c22ab4384d	upd README to reflect changes to --parent option	2025-05-29 15:28:21 +01:00
onyx-and-iris	93a3d3e49f	print a more useful sceneitem list table rename --parent option to --group	2025-05-29 15:28:02 +01:00
onyx-and-iris	2228574837	fix err message test	2025-05-28 15:50:02 +01:00
onyx-and-iris	8f1d42b677	ensure studio mode disabled at end of tests	2025-05-28 15:39:12 +01:00
onyx-and-iris	620adf7e98	return errors if required upd tests to reflect changes	2025-05-28 15:38:59 +01:00
onyx-and-iris	4a7b8a074a	check current active state before starting/stopping recording return appropriate errors if required update tests to reflect changes	2025-05-28 15:33:53 +01:00
onyx-and-iris	0811d711aa	split record start/stop tests test output according to current active state	2025-05-28 14:37:55 +01:00
onyx-and-iris	306f19eeae	add 0.8.0 to CHANGELOG	2025-05-27 01:28:14 +01:00
onyx-and-iris	43dd77ffdc	record directory added to README	2025-05-27 01:27:50 +01:00
onyx-and-iris	f94ac1ca0c	record stop now prints output path of recording record directory command added	2025-05-27 01:27:30 +01:00
onyx-and-iris	c27a5ea6c5	add 0.7.0 section to CHANGELOG	2025-05-26 22:08:44 +01:00
onyx-and-iris	af962a26cc	add projector commands add ProjectorCmd section to README	2025-05-26 22:08:33 +01:00
onyx-and-iris	360d45aa47	create source filters on test setup remove source filters, ensure replyabuffer is stopped on test teardown	2025-05-26 19:51:27 +01:00
onyx-and-iris	3deb03cf32	add filter/input/version tests	2025-05-26 19:49:51 +01:00
onyx-and-iris	f58b2dfeab	add output to replaybuffer start/stop add replaybuffer tests	2025-05-26 19:49:30 +01:00
onyx-and-iris	6ad530ce2e	virtualcam - print OutputActive status on toggle	2025-05-25 22:18:24 +01:00
Onyx and Iris	d9d3c7c8b2	Merge pull request #1 from onyx-and-iris/dependabot/go_modules/golang.org/x/sys-0.1.0 Bump golang.org/x/sys from 0.0.0-20210615035016-665e8c7367d1 to 0.1.0	2025-05-25 15:18:07 +01:00
dependabot[bot]	f72e34adfb	Bump golang.org/x/sys from 0.0.0-20210615035016-665e8c7367d1 to 0.1.0 Bumps [golang.org/x/sys](https://github.com/golang/sys) from 0.0.0-20210615035016-665e8c7367d1 to 0.1.0. - [Commits](https://github.com/golang/sys/commits/v0.1.0) --- updated-dependencies: - dependency-name: golang.org/x/sys dependency-version: 0.1.0 dependency-type: indirect ... Signed-off-by: dependabot[bot] <support@github.com>	2025-05-25 14:17:44 +00:00
onyx-and-iris	ccb3f59513	md fix	2025-05-25 15:09:41 +01:00
onyx-and-iris	e3fd88cf92	upd CHANGELOG + README	2025-05-25 15:07:34 +01:00
onyx-and-iris	12dfab5642	print list commands as tables	2025-05-25 15:07:13 +01:00
onyx-and-iris	7a2765f72c	fix link to filtercmd section	2025-05-25 11:58:19 +01:00
onyx-and-iris	90aa5d4423	add filter commands upd README, CHANGELOG	2025-05-25 11:55:45 +01:00
onyx-and-iris	da010d67a0	uppercase CLI struct name	2025-05-22 16:41:01 +01:00
onyx-and-iris	0c695298fd	add 0.5.0 section to changelog	2025-05-22 09:48:34 +01:00
onyx-and-iris	2f77fa1c54	add hotkey commands	2025-05-22 09:48:26 +01:00
onyx-and-iris	eafc3312a5	add HotkeyCmd section	2025-05-22 09:46:59 +01:00
onyx-and-iris	02541f9915	upd changelog 0.4.2	2025-05-08 05:13:08 +01:00
onyx-and-iris	7fa43eb35c	add unit tests	2025-05-08 05:04:03 +01:00
onyx-and-iris	8aeb7cb183	add studiomode enable/disable output	2025-05-08 01:19:11 +01:00
onyx-and-iris	6e25927bc1	add stream start/stop output	2025-05-08 01:18:58 +01:00
onyx-and-iris	dd0bbfc0da	add missing record status command add replaybuffer toggle to readme	2025-05-08 00:47:15 +01:00
onyx-and-iris	c04324d173	add 0.4.0 to changelog	2025-05-07 20:24:30 +01:00
onyx-and-iris	36d0753bd9	use ToggleRecord()/ToggleStream methods	2025-05-07 20:17:26 +01:00
onyx-and-iris	3095c0c49d	add replaybuffer toggle command	2025-05-07 20:16:44 +01:00
onyx-and-iris	53bbb58cfb	keep struct names consistent	2025-05-07 20:16:31 +01:00
onyx-and-iris	5f2fe05caa	fix date	2025-05-02 13:33:29 +01:00
onyx-and-iris	c653047c66	add 0.3.1 to changelog	2025-05-02 12:26:42 +01:00
onyx-and-iris	30fabe8cfc	add env file resolver	2025-05-02 12:24:46 +01:00
onyx-and-iris	8cf969c906	add task to view man page move man tasks into Taskfile.man.yaml	2025-04-29 18:35:58 +01:00
onyx-and-iris	3540c60c4b	reword	2025-04-29 16:59:08 +01:00
onyx-and-iris	b2c5980b4a	use task var	2025-04-29 16:54:51 +01:00
onyx-and-iris	da1ef9f993	upd task name + outfile name	2025-04-29 16:50:45 +01:00
onyx-and-iris	0a2c622645	add --man flag for generating manfile	2025-04-29 15:19:16 +01:00
onyx-and-iris	cb973c09f5	add installation section to readme	2025-04-27 14:14:42 +01:00
onyx-and-iris	4fa32bfb42	upd changelog	2025-04-27 13:30:44 +01:00
onyx-and-iris	8616f3b486	add sceneitem transform upd readme	2025-04-27 13:24:57 +01:00
onyx-and-iris	05f13ab87a	upd create alias	2025-04-26 16:16:33 +01:00
onyx-and-iris	71300a416b	typo	2025-04-26 14:03:30 +01:00
Onyx and Iris	2fc2000b11	Create LICENSE	2025-04-24 16:20:24 +01:00
onyx-and-iris	7692de752b	remove err check, FatalIfErrorf will do that.	2025-04-24 12:56:43 +01:00
onyx-and-iris	107d1bca38	remove redundant var initialization	2025-04-24 12:54:53 +01:00
onyx-and-iris	035b467a14	fix profile examples	2025-04-24 12:22:59 +01:00