mirror of
https://github.com/onyx-and-iris/gobs-cli.git
synced 2026-04-19 15:43:41 +00:00
Compare commits
10 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
| eb30cae5b7 | |||
| e6c03a2c92 | |||
| f6b82383f9 | |||
| 55f3b0c981 | |||
| 7da80a1ad2 | |||
| ea4ca2aeb9 | |||
| d2f0a64180 | |||
| f01fd0ca84 | |||
| 10d50df445 | |||
| 06cefe58ed |
18
CHANGELOG.md
18
CHANGELOG.md
@@ -5,6 +5,24 @@ All notable changes to this project will be documented in this file.
|
|||||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
|
# [0.13.3] - 2025-06-27
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- usage is now printed on errors.
|
||||||
|
- help is printed in compact mode. This should make it easier to page through help on the root command.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Item ID alignment in sceneitem list table.
|
||||||
|
|
||||||
|
# [0.13.0] - 2025-06-23
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
|
||||||
|
- As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
|
||||||
|
|
||||||
# [0.12.1] - 2025-06-21
|
# [0.12.1] - 2025-06-21
|
||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|||||||
83
README.md
83
README.md
@@ -4,6 +4,16 @@ A command line interface for OBS Websocket v5
|
|||||||
|
|
||||||
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
||||||
|
|
||||||
|
-----
|
||||||
|
|
||||||
|
## Table of Contents
|
||||||
|
|
||||||
|
- [Installation](#installation)
|
||||||
|
- [Configuration](#configuration)
|
||||||
|
- [Style](#style)
|
||||||
|
- [Commands](#commands)
|
||||||
|
- [License](#license)
|
||||||
|
|
||||||
## Installation
|
## Installation
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@@ -40,6 +50,36 @@ OBS_PASSWORD=<websocket password>
|
|||||||
OBS_TIMEOUT=5
|
OBS_TIMEOUT=5
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## Style
|
||||||
|
|
||||||
|
Styling is opt-in, by default you will get a colourless output:
|
||||||
|
|
||||||
|

|
||||||
|
|
||||||
|
You may enable styling with the --style/-s flag:
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli --style="red" sceneitem list
|
||||||
|
```
|
||||||
|
|
||||||
|
Available styles: _red, magenta, purple, blue, cyan, green, yellow, orange, white, grey, navy, black_
|
||||||
|
|
||||||
|

|
||||||
|
|
||||||
|
Optionally you may disable border colouring with the --no-border flag:
|
||||||
|
|
||||||
|

|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli --style="red" --no-border sceneitem list
|
||||||
|
```
|
||||||
|
|
||||||
|
Or with environment variables:
|
||||||
|
|
||||||
|
```env
|
||||||
|
GOBS_STYLE=cyan
|
||||||
|
GOBS_STYLE_NO_BORDER=true
|
||||||
|
```
|
||||||
|
|
||||||
## Commands
|
## Commands
|
||||||
|
|
||||||
@@ -313,6 +353,21 @@ gobs-cli record directory "/home/me/obs-vids/"
|
|||||||
gobs-cli record directory "C:/Users/me/Videos"
|
gobs-cli record directory "C:/Users/me/Videos"
|
||||||
```
|
```
|
||||||
|
|
||||||
|
- split: Split recording.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record split
|
||||||
|
```
|
||||||
|
|
||||||
|
- chapter: Create a chapter in the recording.
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- arg: ChapterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record chapter "Chapter Name"
|
||||||
|
```
|
||||||
|
|
||||||
### StreamCmd
|
### StreamCmd
|
||||||
|
|
||||||
- start: Start streaming.
|
- start: Start streaming.
|
||||||
@@ -606,33 +661,9 @@ gobs-cli projector open --monitor-index=1 "test_group"
|
|||||||
gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
|
gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
|
||||||
```
|
```
|
||||||
|
|
||||||
## Style
|
## License
|
||||||
|
|
||||||
By default styling is disabled but you may enable and configure it in the following ways:
|
`gobs-cli` is distributed under the terms of the [MIT](https://spdx.org/licenses/MIT.html) license.
|
||||||
|
|
||||||
- --style/-s: Style used in output.
|
|
||||||
- GOBS_STYLE
|
|
||||||
- --no-border/-b: Disable table border styling in output.
|
|
||||||
- GOBS_STYLE_NO_BORDER
|
|
||||||
|
|
||||||
Available styles:
|
|
||||||
|
|
||||||
- red
|
|
||||||
- magenta
|
|
||||||
- purple
|
|
||||||
- blue
|
|
||||||
- cyan
|
|
||||||
- green
|
|
||||||
- yellow
|
|
||||||
- orange
|
|
||||||
- white
|
|
||||||
- grey
|
|
||||||
- navy
|
|
||||||
- black
|
|
||||||
|
|
||||||
```console
|
|
||||||
gobs-cli --style=cyan --no-border scene list
|
|
||||||
```
|
|
||||||
|
|
||||||
|
|
||||||
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
||||||
|
|||||||
BIN
img/coloured-border.png
Executable file
BIN
img/coloured-border.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 6.1 KiB |
BIN
img/coloured-no-border.png
Executable file
BIN
img/coloured-no-border.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 6.1 KiB |
BIN
img/colourless.png
Executable file
BIN
img/colourless.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 4.6 KiB |
36
main.go
36
main.go
@@ -8,6 +8,8 @@ import (
|
|||||||
"io"
|
"io"
|
||||||
"os"
|
"os"
|
||||||
"path/filepath"
|
"path/filepath"
|
||||||
|
"runtime/debug"
|
||||||
|
"strings"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/alecthomas/kong"
|
"github.com/alecthomas/kong"
|
||||||
@@ -16,6 +18,19 @@ import (
|
|||||||
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
||||||
)
|
)
|
||||||
|
|
||||||
|
var version string // Version of the CLI, set at build time.
|
||||||
|
|
||||||
|
// VersionFlag is a custom flag type that prints the version and exits.
|
||||||
|
type VersionFlag string
|
||||||
|
|
||||||
|
func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil } // nolint: revive
|
||||||
|
func (v VersionFlag) IsBool() bool { return true } // nolint: revive
|
||||||
|
func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
|
||||||
|
fmt.Printf("gobs-cli version: %s\n", vars["version"])
|
||||||
|
app.Exit(0)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
||||||
type ObsConfig struct {
|
type ObsConfig struct {
|
||||||
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST" short:"H"`
|
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST" short:"H"`
|
||||||
@@ -31,7 +46,7 @@ type StyleConfig struct {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// CLI is the main command line interface structure.
|
// CLI is the main command line interface structure.
|
||||||
// It embeds the ObsConfig struct to inherit its fields and flags.
|
// It embeds ObsConfig and StyleConfig to provide configuration options.
|
||||||
type CLI struct {
|
type CLI struct {
|
||||||
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
||||||
StyleConfig `embed:"" help:"Style configuration."`
|
StyleConfig `embed:"" help:"Style configuration."`
|
||||||
@@ -81,10 +96,25 @@ func main() {
|
|||||||
var cli CLI
|
var cli CLI
|
||||||
ctx := kong.Parse(
|
ctx := kong.Parse(
|
||||||
&cli,
|
&cli,
|
||||||
kong.Name("GOBS-CLI"),
|
kong.Name("gobs-cli"),
|
||||||
kong.Description("A command line tool to interact with OBS Websocket."),
|
kong.Description("A command line tool to interact with OBS Websocket."),
|
||||||
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
||||||
)
|
kong.UsageOnError(),
|
||||||
|
kong.ConfigureHelp(kong.HelpOptions{
|
||||||
|
Compact: true,
|
||||||
|
}),
|
||||||
|
kong.Vars{
|
||||||
|
"version": func() string {
|
||||||
|
if version == "" {
|
||||||
|
info, ok := debug.ReadBuildInfo()
|
||||||
|
if !ok {
|
||||||
|
return "(unable to read build info)"
|
||||||
|
}
|
||||||
|
version = strings.Split(info.Main.Version, "-")[0]
|
||||||
|
}
|
||||||
|
return version
|
||||||
|
}(),
|
||||||
|
})
|
||||||
|
|
||||||
client, err := connectObs(cli.ObsConfig)
|
client, err := connectObs(cli.ObsConfig)
|
||||||
ctx.FatalIfErrorf(err)
|
ctx.FatalIfErrorf(err)
|
||||||
|
|||||||
82
record.go
82
record.go
@@ -4,17 +4,20 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/config"
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/record"
|
||||||
)
|
)
|
||||||
|
|
||||||
// RecordCmd handles the recording commands.
|
// RecordCmd handles the recording commands.
|
||||||
type RecordCmd struct {
|
type RecordCmd struct {
|
||||||
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
||||||
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
||||||
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
||||||
Status RecordStatusCmd `cmd:"" help:"Show recording status." aliases:"ss"`
|
Status RecordStatusCmd `cmd:"" help:"Show recording status." aliases:"ss"`
|
||||||
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
||||||
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
||||||
Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
|
Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
|
||||||
|
Split RecordSplitCmd `cmd:"" help:"Split recording." aliases:"sp"`
|
||||||
|
Chapter RecordChapterCmd `cmd:"" help:"Create a chapter in the recording." aliases:"c"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// RecordStartCmd starts the recording.
|
// RecordStartCmd starts the recording.
|
||||||
@@ -187,3 +190,68 @@ func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
|
|||||||
fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
|
fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// RecordSplitCmd splits the current recording.
|
||||||
|
type RecordSplitCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to split the recording.
|
||||||
|
func (cmd *RecordSplitCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
if status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is paused, cannot split")
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.SplitRecordFile()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording split successfully.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordChapterCmd creates a chapter in the recording.
|
||||||
|
type RecordChapterCmd struct {
|
||||||
|
ChapterName string `arg:"" help:"Name of the chapter to create." default:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to create a chapter in the recording.
|
||||||
|
func (cmd *RecordChapterCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
if status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is paused, cannot create chapter")
|
||||||
|
}
|
||||||
|
|
||||||
|
var params *record.CreateRecordChapterParams
|
||||||
|
if cmd.ChapterName == "" {
|
||||||
|
params = record.NewCreateRecordChapterParams()
|
||||||
|
} else {
|
||||||
|
params = record.NewCreateRecordChapterParams().WithChapterName(cmd.ChapterName)
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.CreateRecordChapter(params)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if cmd.ChapterName == "" {
|
||||||
|
cmd.ChapterName = "unnamed"
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Chapter %s created successfully.\n", ctx.Style.Highlight(cmd.ChapterName))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|||||||
@@ -59,7 +59,7 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
|||||||
style := lipgloss.NewStyle().Padding(0, 3)
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
switch col {
|
switch col {
|
||||||
case 0:
|
case 0:
|
||||||
style = style.Align(lipgloss.Left)
|
style = style.Align(lipgloss.Center)
|
||||||
case 1:
|
case 1:
|
||||||
style = style.Align(lipgloss.Left)
|
style = style.Align(lipgloss.Left)
|
||||||
case 2:
|
case 2:
|
||||||
|
|||||||
30
version.go
30
version.go
@@ -2,38 +2,8 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
"runtime/debug"
|
|
||||||
"strings"
|
|
||||||
|
|
||||||
"github.com/alecthomas/kong"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
var version string
|
|
||||||
|
|
||||||
// VersionFlag is a custom flag type for displaying version information.
|
|
||||||
type VersionFlag string
|
|
||||||
|
|
||||||
// Decode implements the kong.Flag interface.
|
|
||||||
func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }
|
|
||||||
|
|
||||||
// IsBool implements the kong.Flag interface.
|
|
||||||
func (v VersionFlag) IsBool() bool { return true }
|
|
||||||
|
|
||||||
// BeforeApply implements the kong.Flag interface.
|
|
||||||
func (v VersionFlag) BeforeApply(app *kong.Kong, _ kong.Vars) error { // nolint: unparam
|
|
||||||
if version == "" {
|
|
||||||
info, ok := debug.ReadBuildInfo()
|
|
||||||
if !ok {
|
|
||||||
return fmt.Errorf("failed to read build info")
|
|
||||||
}
|
|
||||||
version = strings.Split(info.Main.Version, "-")[0]
|
|
||||||
}
|
|
||||||
|
|
||||||
fmt.Printf("gobs-cli version: %s\n", version)
|
|
||||||
app.Exit(0) // Exit the application after printing the version
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
|
|
||||||
// ObsVersionCmd handles the version command.
|
// ObsVersionCmd handles the version command.
|
||||||
type ObsVersionCmd struct{} // size = 0x0
|
type ObsVersionCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
|||||||
Reference in New Issue
Block a user